mirror of https://github.com/docker/buildx.git
vendor: initial vendor
Signed-off-by: Tonis Tiigi <tonistiigi@gmail.com>
This commit is contained in:
Tonis Tiigi
parent
4f2cc0e220
commit
fd8fbf21e6
|
|
@ -0,0 +1,94 @@
|
||||||
|
module github.com/tonistiigi/buildx
|
||||||
|
|
||||||
|
require (
|
||||||
|
github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 // indirect
|
||||||
|
github.com/Microsoft/go-winio v0.4.12 // indirect
|
||||||
|
github.com/Microsoft/hcsshim v0.8.6 // indirect
|
||||||
|
github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d // indirect
|
||||||
|
github.com/agl/ed25519 v0.0.0-20170116200512-5312a6153412 // indirect
|
||||||
|
github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973 // indirect
|
||||||
|
github.com/bitly/go-hostpool v0.0.0-20171023180738-a3a6125de932 // indirect
|
||||||
|
github.com/bitly/go-simplejson v0.5.0 // indirect
|
||||||
|
github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869 // indirect
|
||||||
|
github.com/bugsnag/bugsnag-go v1.4.1 // indirect
|
||||||
|
github.com/bugsnag/panicwrap v1.2.0 // indirect
|
||||||
|
github.com/cenkalti/backoff v2.1.1+incompatible // indirect
|
||||||
|
github.com/cloudflare/cfssl v0.0.0-20181213083726-b94e044bb51e // indirect
|
||||||
|
github.com/containerd/cgroups v0.0.0-20190226200435-dbea6f2bd416 // indirect
|
||||||
|
github.com/containerd/containerd v1.2.5 // indirect
|
||||||
|
github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 // indirect
|
||||||
|
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect
|
||||||
|
github.com/containerd/typeurl v0.0.0-20190228175220-2a93cfde8c20 // indirect
|
||||||
|
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e // indirect
|
||||||
|
github.com/denisenkom/go-mssqldb v0.0.0-20190315220205-a8ed825ac853 // indirect
|
||||||
|
github.com/docker/cli v0.0.0-20190321234815-f40f9c240ab0
|
||||||
|
github.com/docker/compose-on-kubernetes v0.4.19-0.20190128150448-356b2919c496 // indirect
|
||||||
|
github.com/docker/distribution v2.7.1-0.20190205005809-0d3efadf0154+incompatible // indirect
|
||||||
|
github.com/docker/docker v1.14.0-0.20190319210016-827cb09f8796 // indirect
|
||||||
|
github.com/docker/docker-credential-helpers v0.6.1 // indirect
|
||||||
|
github.com/docker/go v1.5.1-1.0.20160303222718-d30aec9fd63c // indirect
|
||||||
|
github.com/docker/go-connections v0.4.0 // indirect
|
||||||
|
github.com/docker/go-events v0.0.0-20170721190031-9461782956ad // indirect
|
||||||
|
github.com/docker/go-metrics v0.0.0-20170502235133-d466d4f6fd96 // indirect
|
||||||
|
github.com/docker/go-units v0.3.3 // indirect
|
||||||
|
github.com/docker/libtrust v0.0.0-20150526203908-9cbd2a1374f4 // indirect
|
||||||
|
github.com/erikstmartin/go-testdb v0.0.0-20160219214506-8d10e4a1bae5 // indirect
|
||||||
|
github.com/ghodss/yaml v1.0.0 // indirect
|
||||||
|
github.com/go-sql-driver/mysql v1.4.1 // indirect
|
||||||
|
github.com/godbus/dbus v4.1.0+incompatible // indirect
|
||||||
|
github.com/gofrs/uuid v3.2.0+incompatible // indirect
|
||||||
|
github.com/gogo/googleapis v1.1.0 // indirect
|
||||||
|
github.com/gogo/protobuf v1.2.1 // indirect
|
||||||
|
github.com/google/btree v1.0.0 // indirect
|
||||||
|
github.com/google/certificate-transparency-go v1.0.21 // indirect
|
||||||
|
github.com/google/go-cmp v0.2.0 // indirect
|
||||||
|
github.com/google/gofuzz v0.0.0-20170612174753-24818f796faf // indirect
|
||||||
|
github.com/googleapis/gnostic v0.2.0 // indirect
|
||||||
|
github.com/gorilla/mux v1.7.0 // indirect
|
||||||
|
github.com/gregjones/httpcache v0.0.0-20190212212710-3befbb6ad0cc // indirect
|
||||||
|
github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed // indirect
|
||||||
|
github.com/hashicorp/go-version v1.1.0 // indirect
|
||||||
|
github.com/imdario/mergo v0.3.7 // indirect
|
||||||
|
github.com/inconshreveable/mousetrap v1.0.0 // indirect
|
||||||
|
github.com/jinzhu/gorm v1.9.2 // indirect
|
||||||
|
github.com/jinzhu/inflection v0.0.0-20180308033659-04140366298a // indirect
|
||||||
|
github.com/jinzhu/now v1.0.0 // indirect
|
||||||
|
github.com/json-iterator/go v1.1.6 // indirect
|
||||||
|
github.com/kardianos/osext v0.0.0-20190222173326-2bc1f35cddc0 // indirect
|
||||||
|
github.com/kr/pretty v0.1.0 // indirect
|
||||||
|
github.com/lib/pq v1.0.0 // indirect
|
||||||
|
github.com/mattn/go-sqlite3 v1.10.0 // indirect
|
||||||
|
github.com/matttproud/golang_protobuf_extensions v1.0.1 // indirect
|
||||||
|
github.com/miekg/pkcs11 v0.0.0-20190322140431-074fd7a1ed19 // indirect
|
||||||
|
github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd // indirect
|
||||||
|
github.com/modern-go/reflect2 v1.0.1 // indirect
|
||||||
|
github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c // indirect
|
||||||
|
github.com/opencontainers/go-digest v1.0.0-rc1 // indirect
|
||||||
|
github.com/opencontainers/image-spec v1.0.1 // indirect
|
||||||
|
github.com/opencontainers/runc v0.1.1 // indirect
|
||||||
|
github.com/opencontainers/runtime-spec v1.0.1 // indirect
|
||||||
|
github.com/peterbourgon/diskv v2.0.1+incompatible // indirect
|
||||||
|
github.com/pkg/errors v0.8.1 // indirect
|
||||||
|
github.com/prometheus/client_golang v0.8.0 // indirect
|
||||||
|
github.com/prometheus/client_model v0.0.0-20170216185247-6f3806018612 // indirect
|
||||||
|
github.com/prometheus/common v0.0.0-20180518154759-7600349dcfe1 // indirect
|
||||||
|
github.com/prometheus/procfs v0.0.0-20180612222113-7d6f385de8be // indirect
|
||||||
|
github.com/sirupsen/logrus v1.4.0 // indirect
|
||||||
|
github.com/spf13/cobra v0.0.3
|
||||||
|
github.com/spf13/viper v1.3.2 // indirect
|
||||||
|
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 // indirect
|
||||||
|
github.com/theupdateframework/notary v0.6.1 // indirect
|
||||||
|
github.com/xlab/handysort v0.0.0-20150421192137-fb3537ed64a1 // indirect
|
||||||
|
golang.org/x/sys v0.0.0-20190322080309-f49334f85ddc // indirect
|
||||||
|
golang.org/x/time v0.0.0-20190308202827-9d24e82272b4 // indirect
|
||||||
|
google.golang.org/grpc v1.19.1 // indirect
|
||||||
|
gopkg.in/dancannon/gorethink.v3 v3.0.5 // indirect
|
||||||
|
gopkg.in/fatih/pool.v2 v2.0.0 // indirect
|
||||||
|
gopkg.in/gorethink/gorethink.v3 v3.0.5 // indirect
|
||||||
|
gopkg.in/inf.v0 v0.9.1 // indirect
|
||||||
|
gotest.tools v2.2.0+incompatible // indirect
|
||||||
|
k8s.io/api v0.0.0-20180712090710-2d6f90ab1293 // indirect
|
||||||
|
k8s.io/apimachinery v0.0.0-20180621070125-103fd098999d // indirect
|
||||||
|
k8s.io/client-go v2.0.0-alpha.0.0.20180806134042-1f13a808da65+incompatible // indirect
|
||||||
|
vbom.ml/util v0.0.0-20180919145318-efcd4e0f9787 // indirect
|
||||||
|
)
|
||||||
|
|
@ -0,0 +1,255 @@
|
||||||
|
cloud.google.com/go v0.26.0 h1:e0WKqKTd5BnrG8aKH3J3h+QvEIQtSUcf2n5UZ5ZgLtQ=
|
||||||
|
cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
|
||||||
|
github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78 h1:w+iIsaOQNcT7OZ575w+acHgRric5iCyQh+xv+KJ4HB8=
|
||||||
|
github.com/Azure/go-ansiterm v0.0.0-20170929234023-d6e3b3328b78/go.mod h1:LmzpDX56iTiv29bbRTIsUNlaFfuhWRQBWjQdVyAevI8=
|
||||||
|
github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ=
|
||||||
|
github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
|
||||||
|
github.com/Microsoft/go-winio v0.4.12 h1:xAfWHN1IrQ0NJ9TBC0KBZoqLjzDTr1ML+4MywiUOryc=
|
||||||
|
github.com/Microsoft/go-winio v0.4.12/go.mod h1:VhR8bwka0BXejwEJY73c50VrPtXAaKcyvVC4A4RozmA=
|
||||||
|
github.com/Microsoft/hcsshim v0.8.6 h1:ZfF0+zZeYdzMIVMZHKtDKJvLHj76XCuVae/jNkjj0IA=
|
||||||
|
github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg=
|
||||||
|
github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d h1:UrqY+r/OJnIp5u0s1SbQ8dVfLCZJsnvazdBP5hS4iRs=
|
||||||
|
github.com/Shopify/logrus-bugsnag v0.0.0-20171204204709-577dee27f20d/go.mod h1:HI8ITrYtUY+O+ZhtlqUnD8+KwNPOyugEhfP9fdUIaEQ=
|
||||||
|
github.com/agl/ed25519 v0.0.0-20170116200512-5312a6153412 h1:w1UutsfOrms1J05zt7ISrnJIXKzwaspym5BTKGx93EI=
|
||||||
|
github.com/agl/ed25519 v0.0.0-20170116200512-5312a6153412/go.mod h1:WPjqKcmVOxf0XSf3YxCJs6N6AOSrOx3obionmG7T0y0=
|
||||||
|
github.com/armon/consul-api v0.0.0-20180202201655-eb2c6b5be1b6/go.mod h1:grANhF5doyWs3UAsr3K4I6qtAmlQcZDesFNEHPZAzj8=
|
||||||
|
github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973 h1:xJ4a3vCFaGF/jqvzLMYoU8P317H5OQ+Via4RmuPwCS0=
|
||||||
|
github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q=
|
||||||
|
github.com/bitly/go-hostpool v0.0.0-20171023180738-a3a6125de932 h1:mXoPYz/Ul5HYEDvkta6I8/rnYM5gSdSV2tJ6XbZuEtY=
|
||||||
|
github.com/bitly/go-hostpool v0.0.0-20171023180738-a3a6125de932/go.mod h1:NOuUCSz6Q9T7+igc/hlvDOUdtWKryOrtFyIVABv/p7k=
|
||||||
|
github.com/bitly/go-simplejson v0.5.0 h1:6IH+V8/tVMab511d5bn4M7EwGXZf9Hj6i2xSwkNEM+Y=
|
||||||
|
github.com/bitly/go-simplejson v0.5.0/go.mod h1:cXHtHw4XUPsvGaxgjIAn8PhEWG9NfngEKAMDJEczWVA=
|
||||||
|
github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869 h1:DDGfHa7BWjL4YnC6+E63dPcxHo2sUxDIu8g3QgEJdRY=
|
||||||
|
github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869/go.mod h1:Ekp36dRnpXw/yCqJaO+ZrUyxD+3VXMFFr56k5XYrpB4=
|
||||||
|
github.com/bugsnag/bugsnag-go v1.4.1 h1:TT3P9AX69w8mbSGE8L7IJOO2KBlPN0iQtYD0dUlrWHc=
|
||||||
|
github.com/bugsnag/bugsnag-go v1.4.1/go.mod h1:2oa8nejYd4cQ/b0hMIopN0lCRxU0bueqREvZLWFrtK8=
|
||||||
|
github.com/bugsnag/panicwrap v1.2.0 h1:OzrKrRvXis8qEvOkfcxNcYbOd2O7xXS2nnKMEMABFQA=
|
||||||
|
github.com/bugsnag/panicwrap v1.2.0/go.mod h1:D/8v3kj0zr8ZAKg1AQ6crr+5VwKN5eIywRkfhyM/+dE=
|
||||||
|
github.com/cenkalti/backoff v2.1.1+incompatible h1:tKJnvO2kl0zmb/jA5UKAt4VoEVw1qxKWjE/Bpp46npY=
|
||||||
|
github.com/cenkalti/backoff v2.1.1+incompatible/go.mod h1:90ReRw6GdpyfrHakVjL/QHaoyV4aDUVVkXQJJJ3NXXM=
|
||||||
|
github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
|
||||||
|
github.com/cloudflare/cfssl v0.0.0-20181213083726-b94e044bb51e h1:Qux+lbuMaRzkQyTdzgtz8MgzPtzmaPQy6DXmxpdxT3U=
|
||||||
|
github.com/cloudflare/cfssl v0.0.0-20181213083726-b94e044bb51e/go.mod h1:yMWuSON2oQp+43nFtAV/uvKQIFpSPerB57DCt9t8sSA=
|
||||||
|
github.com/containerd/cgroups v0.0.0-20190226200435-dbea6f2bd416 h1:AaSMvkPaxfZD/OsDVBueAKzY5lnWAqLWgUivNg37WHA=
|
||||||
|
github.com/containerd/cgroups v0.0.0-20190226200435-dbea6f2bd416/go.mod h1:X9rLEHIqSf/wfK8NsPqxJmeZgW4pcfzdXITDrUSJ6uI=
|
||||||
|
github.com/containerd/containerd v1.2.5 h1:D+s0XmoswfcRJXgmMMlI1vAblp+LTCftRnEjKsgbFPU=
|
||||||
|
github.com/containerd/containerd v1.2.5/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA=
|
||||||
|
github.com/containerd/continuity v0.0.0-20181203112020-004b46473808 h1:4BX8f882bXEDKfWIf0wa8HRvpnBoPszJJXL+TVbBw4M=
|
||||||
|
github.com/containerd/continuity v0.0.0-20181203112020-004b46473808/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y=
|
||||||
|
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4=
|
||||||
|
github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI=
|
||||||
|
github.com/containerd/typeurl v0.0.0-20190228175220-2a93cfde8c20 h1:14r0i3IeJj6zkNLigAJiv/TWSR8EY+pxIjv5tFiT+n8=
|
||||||
|
github.com/containerd/typeurl v0.0.0-20190228175220-2a93cfde8c20/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc=
|
||||||
|
github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE=
|
||||||
|
github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8NzMklzPG4d5KIOhIy30Tk=
|
||||||
|
github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk=
|
||||||
|
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e h1:Wf6HqHfScWJN9/ZjdUKyjop4mf3Qdd+1TvvltAvM3m8=
|
||||||
|
github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4=
|
||||||
|
github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c=
|
||||||
|
github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
|
||||||
|
github.com/denisenkom/go-mssqldb v0.0.0-20190315220205-a8ed825ac853 h1:tTngnoO/B6HQnJ+pK8tN7kEAhmhIfaJOutqq/A4/JTM=
|
||||||
|
github.com/denisenkom/go-mssqldb v0.0.0-20190315220205-a8ed825ac853/go.mod h1:xN/JuLBIz4bjkxNmByTiV1IbhfnYb6oo99phBn4Eqhc=
|
||||||
|
github.com/docker/cli v0.0.0-20190321234815-f40f9c240ab0 h1:E7NTtHfZYV+iu35yZ49AbrxqhMHpiOl3FstDYm38vQ0=
|
||||||
|
github.com/docker/cli v0.0.0-20190321234815-f40f9c240ab0/go.mod h1:JLrzqnKDaYBop7H2jaqPtU4hHvMKP+vjCwu2uszcLI8=
|
||||||
|
github.com/docker/compose-on-kubernetes v0.4.19-0.20190128150448-356b2919c496 h1:90ytrX1dbzL7Uf/hHiuWwvywC+gikHv4hkAy4CwRTbs=
|
||||||
|
github.com/docker/compose-on-kubernetes v0.4.19-0.20190128150448-356b2919c496/go.mod h1:iT2pYfi580XlpaV4KmK0T6+4/9+XoKmk/fhoDod1emE=
|
||||||
|
github.com/docker/distribution v2.7.1-0.20190205005809-0d3efadf0154+incompatible h1:dvc1KSkIYTVjZgHf/CTC2diTYC8PzhaA5sFISRfNVrE=
|
||||||
|
github.com/docker/distribution v2.7.1-0.20190205005809-0d3efadf0154+incompatible/go.mod h1:J2gT2udsDAN96Uj4KfcMRqY0/ypR+oyYUYmja8H+y+w=
|
||||||
|
github.com/docker/docker v1.14.0-0.20190319210016-827cb09f8796 h1:UK2i+hkrwfmWD0N2XVIww9MHn7pKpFpFko26vyf3bzg=
|
||||||
|
github.com/docker/docker v1.14.0-0.20190319210016-827cb09f8796/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
|
||||||
|
github.com/docker/docker-credential-helpers v0.6.1 h1:Dq4iIfcM7cNtddhLVWe9h4QDjsi4OER3Z8voPu/I52g=
|
||||||
|
github.com/docker/docker-credential-helpers v0.6.1/go.mod h1:WRaJzqw3CTB9bk10avuGsjVBZsD05qeibJ1/TYlvc0Y=
|
||||||
|
github.com/docker/go v1.5.1-1.0.20160303222718-d30aec9fd63c h1:lzqkGL9b3znc+ZUgi7FlLnqjQhcXxkNM/quxIjBVMD0=
|
||||||
|
github.com/docker/go v1.5.1-1.0.20160303222718-d30aec9fd63c/go.mod h1:CADgU4DSXK5QUlFslkQu2yW2TKzFZcXq/leZfM0UH5Q=
|
||||||
|
github.com/docker/go-connections v0.4.0 h1:El9xVISelRB7BuFusrZozjnkIM5YnzCViNKohAFqRJQ=
|
||||||
|
github.com/docker/go-connections v0.4.0/go.mod h1:Gbd7IOopHjR8Iph03tsViu4nIes5XhDvyHbTtUxmeec=
|
||||||
|
github.com/docker/go-events v0.0.0-20170721190031-9461782956ad h1:VXIse57M5C6ezDuCPyq6QmMvEJ2xclYKZ35SfkXdm3E=
|
||||||
|
github.com/docker/go-events v0.0.0-20170721190031-9461782956ad/go.mod h1:Uw6UezgYA44ePAFQYUehOuCzmy5zmg/+nl2ZfMWGkpA=
|
||||||
|
github.com/docker/go-metrics v0.0.0-20170502235133-d466d4f6fd96 h1:HVQ/BC7Ze+bcVle903SvZMvncOcG2y3zI2K7i3jEHSM=
|
||||||
|
github.com/docker/go-metrics v0.0.0-20170502235133-d466d4f6fd96/go.mod h1:/u0gXw0Gay3ceNrsHubL3BtdOL2fHf93USgMTe0W5dI=
|
||||||
|
github.com/docker/go-units v0.3.3 h1:Xk8S3Xj5sLGlG5g67hJmYMmUgXv5N4PhkjJHHqrwnTk=
|
||||||
|
github.com/docker/go-units v0.3.3/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
|
||||||
|
github.com/docker/libtrust v0.0.0-20150526203908-9cbd2a1374f4 h1:k8TfKGeAcDQFFQOGCQMRN04N4a9YrPlRMMKnzAuvM9Q=
|
||||||
|
github.com/docker/libtrust v0.0.0-20150526203908-9cbd2a1374f4/go.mod h1:cyGadeNEkKy96OOhEzfZl+yxihPEzKnqJwvfuSUqbZE=
|
||||||
|
github.com/erikstmartin/go-testdb v0.0.0-20160219214506-8d10e4a1bae5 h1:Yzb9+7DPaBjB8zlTR87/ElzFsnQfuHnVUVqpZZIcV5Y=
|
||||||
|
github.com/erikstmartin/go-testdb v0.0.0-20160219214506-8d10e4a1bae5/go.mod h1:a2zkGnVExMxdzMo3M0Hi/3sEU+cWnZpSni0O6/Yb/P0=
|
||||||
|
github.com/fsnotify/fsnotify v1.4.7 h1:IXs+QLmnXW2CcXuY+8Mzv/fWEsPGWxqefPtCP5CnV9I=
|
||||||
|
github.com/fsnotify/fsnotify v1.4.7/go.mod h1:jwhsz4b93w/PPRr/qN1Yymfu8t87LnFCMoQvtojpjFo=
|
||||||
|
github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk=
|
||||||
|
github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
|
||||||
|
github.com/go-sql-driver/mysql v1.4.1 h1:g24URVg0OFbNUTx9qqY1IRZ9D9z3iPyi5zKhQZpNwpA=
|
||||||
|
github.com/go-sql-driver/mysql v1.4.1/go.mod h1:zAC/RDZ24gD3HViQzih4MyKcchzm+sOG5ZlKdlhCg5w=
|
||||||
|
github.com/godbus/dbus v4.1.0+incompatible h1:WqqLRTsQic3apZUK9qC5sGNfXthmPXzUZ7nQPrNITa4=
|
||||||
|
github.com/godbus/dbus v4.1.0+incompatible/go.mod h1:/YcGZj5zSblfDWMMoOzV4fas9FZnQYTkDnsGvmh2Grw=
|
||||||
|
github.com/gofrs/uuid v3.2.0+incompatible h1:y12jRkkFxsd7GpqdSZ+/KCs/fJbqpEXSGd4+jfEaewE=
|
||||||
|
github.com/gofrs/uuid v3.2.0+incompatible/go.mod h1:b2aQJv3Z4Fp6yNu3cdSllBxTCLRxnplIgP/c0N/04lM=
|
||||||
|
github.com/gogo/googleapis v1.1.0 h1:kFkMAZBNAn4j7K0GiZr8cRYzejq68VbheufiV3YuyFI=
|
||||||
|
github.com/gogo/googleapis v1.1.0/go.mod h1:gf4bu3Q80BeJ6H1S1vYPm8/ELATdvryBaNFGgqEef3s=
|
||||||
|
github.com/gogo/protobuf v1.2.1 h1:/s5zKNz0uPFCZ5hddgPdo2TK2TVrUNMn0OOX8/aZMTE=
|
||||||
|
github.com/gogo/protobuf v1.2.1/go.mod h1:hp+jE20tsWTFYpLwKvXlhS1hjn+gTNwPg2I6zVXpSg4=
|
||||||
|
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58=
|
||||||
|
github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
|
||||||
|
github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
|
||||||
|
github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM=
|
||||||
|
github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
|
||||||
|
github.com/google/btree v1.0.0 h1:0udJVsspx3VBr5FwtLhQQtuAsVc79tTq0ocGIPAU6qo=
|
||||||
|
github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
|
||||||
|
github.com/google/certificate-transparency-go v1.0.21 h1:Yf1aXowfZ2nuboBsg7iYGLmwsOARdV86pfH3g95wXmE=
|
||||||
|
github.com/google/certificate-transparency-go v1.0.21/go.mod h1:QeJfpSbVSfYc7RgB3gJFj9cbuQMMchQxrWXz8Ruopmg=
|
||||||
|
github.com/google/go-cmp v0.2.0 h1:+dTQ8DZQJz0Mb/HjFlkptS1FeQ4cWSnN941F8aEG4SQ=
|
||||||
|
github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
|
||||||
|
github.com/google/gofuzz v0.0.0-20170612174753-24818f796faf h1:+RRA9JqSOZFfKrOeqr2z77+8R2RKyh8PG66dcu1V0ck=
|
||||||
|
github.com/google/gofuzz v0.0.0-20170612174753-24818f796faf/go.mod h1:HP5RmnzzSNb993RKQDq4+1A4ia9nllfqcQFTQJedwGI=
|
||||||
|
github.com/googleapis/gnostic v0.2.0 h1:l6N3VoaVzTncYYW+9yOz2LJJammFZGBO13sqgEhpy9g=
|
||||||
|
github.com/googleapis/gnostic v0.2.0/go.mod h1:sJBsCZ4ayReDTBIg8b9dl28c5xFWyhBTVRp3pOg5EKY=
|
||||||
|
github.com/gorilla/mux v1.7.0 h1:tOSd0UKHQd6urX6ApfOn4XdBMY6Sh1MfxV3kmaazO+U=
|
||||||
|
github.com/gorilla/mux v1.7.0/go.mod h1:1lud6UwP+6orDFRuTfBEV8e9/aOM/c4fVVCaMa2zaAs=
|
||||||
|
github.com/gregjones/httpcache v0.0.0-20190212212710-3befbb6ad0cc h1:f8eY6cV/x1x+HLjOp4r72s/31/V2aTUtg5oKRRPf8/Q=
|
||||||
|
github.com/gregjones/httpcache v0.0.0-20190212212710-3befbb6ad0cc/go.mod h1:FecbI9+v66THATjSRHfNgh1IVFe/9kFxbXtjV0ctIMA=
|
||||||
|
github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed h1:5upAirOpQc1Q53c0bnx2ufif5kANL7bfZWcc6VJWJd8=
|
||||||
|
github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed/go.mod h1:tMWxXQ9wFIaZeTI9F+hmhFiGpFmhOHzyShyFUhRm0H4=
|
||||||
|
github.com/hashicorp/go-version v1.1.0 h1:bPIoEKD27tNdebFGGxxYwcL4nepeY4j1QP23PFRGzg0=
|
||||||
|
github.com/hashicorp/go-version v1.1.0/go.mod h1:fltr4n8CU8Ke44wwGCBoEymUuxUHl09ZGVZPK5anwXA=
|
||||||
|
github.com/hashicorp/hcl v1.0.0 h1:0Anlzjpi4vEasTeNFn2mLJgTSwt0+6sfsiTG8qcWGx4=
|
||||||
|
github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
|
||||||
|
github.com/imdario/mergo v0.3.7 h1:Y+UAYTZ7gDEuOfhxKWy+dvb5dRQ6rJjFSdX2HZY1/gI=
|
||||||
|
github.com/imdario/mergo v0.3.7/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA=
|
||||||
|
github.com/inconshreveable/mousetrap v1.0.0 h1:Z8tu5sraLXCXIcARxBp/8cbvlwVa7Z1NHg9XEKhtSvM=
|
||||||
|
github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8=
|
||||||
|
github.com/jinzhu/gorm v1.9.2 h1:lCvgEaqe/HVE+tjAR2mt4HbbHAZsQOv3XAZiEZV37iw=
|
||||||
|
github.com/jinzhu/gorm v1.9.2/go.mod h1:Vla75njaFJ8clLU1W44h34PjIkijhjHIYnZxMqCdxqo=
|
||||||
|
github.com/jinzhu/inflection v0.0.0-20180308033659-04140366298a h1:eeaG9XMUvRBYXJi4pg1ZKM7nxc5AfXfojeLLW7O5J3k=
|
||||||
|
github.com/jinzhu/inflection v0.0.0-20180308033659-04140366298a/go.mod h1:h+uFLlag+Qp1Va5pdKtLDYj+kHp5pxUVkryuEj+Srlc=
|
||||||
|
github.com/jinzhu/now v1.0.0 h1:6WV8LvwPpDhKjo5U9O6b4+xdG/jTXNPwlDme/MTo8Ns=
|
||||||
|
github.com/jinzhu/now v1.0.0/go.mod h1:oHTiXerJ20+SfYcrdlBO7rzZRJWGwSTQ0iUY2jI6Gfc=
|
||||||
|
github.com/json-iterator/go v1.1.6 h1:MrUvLMLTMxbqFJ9kzlvat/rYZqZnW3u4wkLzWTaFwKs=
|
||||||
|
github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU=
|
||||||
|
github.com/kardianos/osext v0.0.0-20190222173326-2bc1f35cddc0 h1:iQTw/8FWTuc7uiaSepXwyf3o52HaUYcV+Tu66S3F5GA=
|
||||||
|
github.com/kardianos/osext v0.0.0-20190222173326-2bc1f35cddc0/go.mod h1:1NbS8ALrpOvjt0rHPNLyCIeMtbizbir8U//inJ+zuB8=
|
||||||
|
github.com/kisielk/errcheck v1.1.0/go.mod h1:EZBBE59ingxPouuu3KfxchcWSUPOHkagtvWXihfKN4Q=
|
||||||
|
github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
|
||||||
|
github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk=
|
||||||
|
github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
|
||||||
|
github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI=
|
||||||
|
github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
|
||||||
|
github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ=
|
||||||
|
github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE=
|
||||||
|
github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI=
|
||||||
|
github.com/lib/pq v1.0.0 h1:X5PMW56eZitiTeO7tKzZxFCSpbFZJtkMMooicw2us9A=
|
||||||
|
github.com/lib/pq v1.0.0/go.mod h1:5WUZQaWbwv1U+lTReE5YruASi9Al49XbQIvNi/34Woo=
|
||||||
|
github.com/magiconair/properties v1.8.0 h1:LLgXmsheXeRoUOBOjtwPQCWIYqM/LU1ayDtDePerRcY=
|
||||||
|
github.com/magiconair/properties v1.8.0/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ=
|
||||||
|
github.com/mattn/go-sqlite3 v1.10.0 h1:jbhqpg7tQe4SupckyijYiy0mJJ/pRyHvXf7JdWK860o=
|
||||||
|
github.com/mattn/go-sqlite3 v1.10.0/go.mod h1:FPy6KqzDD04eiIsT53CuJW3U88zkxoIYsOqkbpncsNc=
|
||||||
|
github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0jegS5sx/RkqARlsWZ6pIwiU=
|
||||||
|
github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
|
||||||
|
github.com/miekg/pkcs11 v0.0.0-20190322140431-074fd7a1ed19 h1:UEWeJCqsIp+93IcMCuqA3KFln2LAUd/tDtoItl0bgJM=
|
||||||
|
github.com/miekg/pkcs11 v0.0.0-20190322140431-074fd7a1ed19/go.mod h1:WCBAbTOdfhHhz7YXujeZMF7owC4tPb1naKFsgfUISjo=
|
||||||
|
github.com/mitchellh/mapstructure v1.1.2 h1:fmNYVwqnSfB9mZU6OS2O6GsXM+wcskZDuKQzvN1EDeE=
|
||||||
|
github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
|
||||||
|
github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd h1:TRLaZ9cD/w8PVh93nsPXa1VrQ6jlwL5oN8l14QlcNfg=
|
||||||
|
github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
|
||||||
|
github.com/modern-go/reflect2 v1.0.1 h1:9f412s+6RmYXLWZSEzVVgPGK7C2PphHj5RJrvfx9AWI=
|
||||||
|
github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
|
||||||
|
github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c h1:nXxl5PrvVm2L/wCy8dQu6DMTwH4oIuGN8GJDAlqDdVE=
|
||||||
|
github.com/morikuni/aec v0.0.0-20170113033406-39771216ff4c/go.mod h1:BbKIizmSmc5MMPqRYbxO4ZU0S0+P200+tUnFx7PXmsc=
|
||||||
|
github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ=
|
||||||
|
github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s=
|
||||||
|
github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI=
|
||||||
|
github.com/opencontainers/image-spec v1.0.1/go.mod h1:BtxoFyWECRxE4U/7sNtV5W15zMzWCbyJoFRP3s7yZA0=
|
||||||
|
github.com/opencontainers/runc v0.1.1 h1:GlxAyO6x8rfZYN9Tt0Kti5a/cP41iuiO2yYT0IJGY8Y=
|
||||||
|
github.com/opencontainers/runc v0.1.1/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U=
|
||||||
|
github.com/opencontainers/runtime-spec v1.0.1 h1:wY4pOY8fBdSIvs9+IDHC55thBuEulhzfSgKeC1yFvzQ=
|
||||||
|
github.com/opencontainers/runtime-spec v1.0.1/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0=
|
||||||
|
github.com/pelletier/go-toml v1.2.0 h1:T5zMGML61Wp+FlcbWjRDT7yAxhJNAiPPLOFECq181zc=
|
||||||
|
github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/94hg7ilaic=
|
||||||
|
github.com/peterbourgon/diskv v2.0.1+incompatible h1:UBdAOUP5p4RWqPBg048CAvpKN+vxiaj6gdUUzhl4XmI=
|
||||||
|
github.com/peterbourgon/diskv v2.0.1+incompatible/go.mod h1:uqqh8zWWbv1HBMNONnaR/tNboyR3/BZd58JJSHlUSCU=
|
||||||
|
github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I=
|
||||||
|
github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
|
||||||
|
github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM=
|
||||||
|
github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
|
||||||
|
github.com/prometheus/client_golang v0.8.0 h1:1921Yw9Gc3iSc4VQh3PIoOqgPCZS7G/4xQNVUp8Mda8=
|
||||||
|
github.com/prometheus/client_golang v0.8.0/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw=
|
||||||
|
github.com/prometheus/client_model v0.0.0-20170216185247-6f3806018612 h1:13pIdM2tpaDi4OVe24fgoIS7ZTqMt0QI+bwQsX5hq+g=
|
||||||
|
github.com/prometheus/client_model v0.0.0-20170216185247-6f3806018612/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo=
|
||||||
|
github.com/prometheus/common v0.0.0-20180518154759-7600349dcfe1 h1:osmNoEW2SCW3L7EX0km2LYM8HKpNWRiouxjE3XHkyGc=
|
||||||
|
github.com/prometheus/common v0.0.0-20180518154759-7600349dcfe1/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro=
|
||||||
|
github.com/prometheus/procfs v0.0.0-20180612222113-7d6f385de8be h1:MoyXp/VjXUwM0GyDcdwT7Ubea2gxOSHpPaFo3qV+Y2A=
|
||||||
|
github.com/prometheus/procfs v0.0.0-20180612222113-7d6f385de8be/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
|
||||||
|
github.com/sirupsen/logrus v1.4.0 h1:yKenngtzGh+cUSSh6GWbxW2abRqhYUSR/t/6+2QqNvE=
|
||||||
|
github.com/sirupsen/logrus v1.4.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo=
|
||||||
|
github.com/spf13/afero v1.1.2 h1:m8/z1t7/fwjysjQRYbP0RD+bUIF/8tJwPdEZsI83ACI=
|
||||||
|
github.com/spf13/afero v1.1.2/go.mod h1:j4pytiNVoe2o6bmDsKpLACNPDBIoEAkihy7loJ1B0CQ=
|
||||||
|
github.com/spf13/cast v1.3.0 h1:oget//CVOEoFewqQxwr0Ej5yjygnqGkvggSE/gB35Q8=
|
||||||
|
github.com/spf13/cast v1.3.0/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE=
|
||||||
|
github.com/spf13/cobra v0.0.3 h1:ZlrZ4XsMRm04Fr5pSFxBgfND2EBVa1nLpiy1stUsX/8=
|
||||||
|
github.com/spf13/cobra v0.0.3/go.mod h1:1l0Ry5zgKvJasoi3XT1TypsSe7PqH0Sj9dhYf7v3XqQ=
|
||||||
|
github.com/spf13/jwalterweatherman v1.0.0 h1:XHEdyB+EcvlqZamSM4ZOMGlc93t6AcsBEu9Gc1vn7yk=
|
||||||
|
github.com/spf13/jwalterweatherman v1.0.0/go.mod h1:cQK4TGJAtQXfYWX+Ddv3mKDzgVb68N+wFjFa4jdeBTo=
|
||||||
|
github.com/spf13/pflag v1.0.3 h1:zPAT6CGy6wXeQ7NtTnaTerfKOsV6V6F8agHXFiazDkg=
|
||||||
|
github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4=
|
||||||
|
github.com/spf13/viper v1.3.2 h1:VUFqw5KcqRf7i70GOzW7N+Q7+gxVBkSSqiXB12+JQ4M=
|
||||||
|
github.com/spf13/viper v1.3.2/go.mod h1:ZiWeW+zYFKm7srdB9IoDzzZXaJaI5eL9QjNiN/DMA2s=
|
||||||
|
github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
|
||||||
|
github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w=
|
||||||
|
github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
|
||||||
|
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2 h1:b6uOv7YOFK0TYG7HtkIgExQo+2RdLuwRft63jn2HWj8=
|
||||||
|
github.com/syndtr/gocapability v0.0.0-20180916011248-d98352740cb2/go.mod h1:hkRG7XYTFWNJGYcbNJQlaLq0fg1yr4J4t/NcTQtrfww=
|
||||||
|
github.com/theupdateframework/notary v0.6.1 h1:7wshjstgS9x9F5LuB1L5mBI2xNMObWqjz+cjWoom6l0=
|
||||||
|
github.com/theupdateframework/notary v0.6.1/go.mod h1:MOfgIfmox8s7/7fduvB2xyPPMJCrjRLRizA8OFwpnKY=
|
||||||
|
github.com/ugorji/go/codec v0.0.0-20181204163529-d75b2dcb6bc8/go.mod h1:VFNgLljTbGfSG7qAOspJ7OScBnGdDN/yBr0sguwnwf0=
|
||||||
|
github.com/xlab/handysort v0.0.0-20150421192137-fb3537ed64a1 h1:j2hhcujLRHAg872RWAV5yaUrEjHEObwDv3aImCaNLek=
|
||||||
|
github.com/xlab/handysort v0.0.0-20150421192137-fb3537ed64a1/go.mod h1:QcJo0QPSfTONNIgpN5RA8prR7fF8nkF6cTWTcNerRO8=
|
||||||
|
github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q=
|
||||||
|
golang.org/x/crypto v0.0.0-20180904163835-0709b304e793 h1:u+LnwYTOOW7Ukr/fppxEb1Nwz0AtPflrblfvUudpo+I=
|
||||||
|
golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
|
||||||
|
golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9 h1:mKdxBk7AujPs8kU4m80U72y/zjbZ3UcXC7dClwKbUI0=
|
||||||
|
golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
|
||||||
|
golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
|
||||||
|
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d h1:g9qWBGx4puODJTMVyoPrpoxPFgVGd+z1DZwjfRu4d0I=
|
||||||
|
golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be h1:vEDujvNQGv4jgYKudGeI/+DAX4Jffq6hpD55MmoEvKs=
|
||||||
|
golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
|
||||||
|
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f h1:wMNYb4v58l5UBM7MYRLPG6ZhfOqbKu7X5eyFl8ZhKvA=
|
||||||
|
golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
|
||||||
|
golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||||
|
golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||||
|
golang.org/x/sys v0.0.0-20181205085412-a5c9d58dba9a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
|
||||||
|
golang.org/x/sys v0.0.0-20190322080309-f49334f85ddc h1:4gbWbmmPFp4ySWICouJl6emP0MyS31yy9SrTlAGFT+g=
|
||||||
|
golang.org/x/sys v0.0.0-20190322080309-f49334f85ddc/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
|
||||||
|
golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg=
|
||||||
|
golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
|
||||||
|
golang.org/x/time v0.0.0-20190308202827-9d24e82272b4 h1:SvFZT6jyqRaOeXpc5h/JSfZenJ2O330aBsf7JfSUXmQ=
|
||||||
|
golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
|
||||||
|
golang.org/x/tools v0.0.0-20180221164845-07fd8470d635/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||||
|
golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
|
||||||
|
google.golang.org/appengine v1.1.0 h1:igQkv0AAhEIvTEpD5LIpAfav2eeVO9HBTjvKHVJPRSs=
|
||||||
|
google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
|
||||||
|
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc=
|
||||||
|
google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
|
||||||
|
google.golang.org/grpc v1.19.1 h1:TrBcJ1yqAl1G++wO39nD/qtgpsW9/1+QGrluyMGEYgM=
|
||||||
|
google.golang.org/grpc v1.19.1/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
|
||||||
|
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405 h1:yhCVgyC4o1eVCa2tZl7eS0r+SDo693bJlVdllGtEeKM=
|
||||||
|
gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
|
||||||
|
gopkg.in/dancannon/gorethink.v3 v3.0.5 h1:/g7PWP7zUS6vSNmHSDbjCHQh1Rqn8Jy6zSMQxAsBSMQ=
|
||||||
|
gopkg.in/dancannon/gorethink.v3 v3.0.5/go.mod h1:GXsi1e3N2OcKhcP6nsYABTiUejbWMFO4GY5a4pEaeEc=
|
||||||
|
gopkg.in/fatih/pool.v2 v2.0.0 h1:xIFeWtxifuQJGk/IEPKsTduEKcKvPmhoiVDGpC40nKg=
|
||||||
|
gopkg.in/fatih/pool.v2 v2.0.0/go.mod h1:8xVGeu1/2jr2wm5V9SPuMht2H5AEmf5aFMGSQixtjTY=
|
||||||
|
gopkg.in/gorethink/gorethink.v3 v3.0.5 h1:e2Uc/Xe+hpcVQFsj6MuHlYog3r0JYpnTzwDj/y2O4MU=
|
||||||
|
gopkg.in/gorethink/gorethink.v3 v3.0.5/go.mod h1:+3yIIHJUGMBK+wyPH+iN5TP+88ikFDfZdqTlK3Y9q8I=
|
||||||
|
gopkg.in/inf.v0 v0.9.1 h1:73M5CoZyi3ZLMOyDlQh031Cx6N9NDJ2Vvfl76EDAgDc=
|
||||||
|
gopkg.in/inf.v0 v0.9.1/go.mod h1:cWUDdTG/fYaXco+Dcufb5Vnc6Gp2YChqWtbxRZE0mXw=
|
||||||
|
gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw=
|
||||||
|
gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
|
||||||
|
gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo=
|
||||||
|
gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw=
|
||||||
|
honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
|
||||||
|
k8s.io/api v0.0.0-20180712090710-2d6f90ab1293 h1:hROmpFC7JMobXFXMmD7ZKZLhDKvr1IKfFJoYS/45G/8=
|
||||||
|
k8s.io/api v0.0.0-20180712090710-2d6f90ab1293/go.mod h1:iuAfoD4hCxJ8Onx9kaTIt30j7jUFS00AXQi6QMi99vA=
|
||||||
|
k8s.io/apimachinery v0.0.0-20180621070125-103fd098999d h1:MZjlsu9igBoVPZkXpIGoxI6EonqNsXXZU7hhvfQLkd4=
|
||||||
|
k8s.io/apimachinery v0.0.0-20180621070125-103fd098999d/go.mod h1:ccL7Eh7zubPUSh9A3USN90/OzHNSVN6zxzde07TDCL0=
|
||||||
|
k8s.io/client-go v2.0.0-alpha.0.0.20180806134042-1f13a808da65+incompatible h1:Acx+j0h5biQofdqi4CveXrRuGy0ZKt2Jyewuun7bYGM=
|
||||||
|
k8s.io/client-go v2.0.0-alpha.0.0.20180806134042-1f13a808da65+incompatible/go.mod h1:7vJpHMYJwNQCWgzmNV+VYUl1zCObLyodBc8nIyt8L5s=
|
||||||
|
vbom.ml/util v0.0.0-20180919145318-efcd4e0f9787 h1:O69FD9pJA4WUZlEwYatBEEkRWKQ5cKodWpdKTrCS/iQ=
|
||||||
|
vbom.ml/util v0.0.0-20180919145318-efcd4e0f9787/go.mod h1:so/NYdZXCz+E3ZpW0uAoCj6uzU2+8OWDFv/HxUSs7kI=
|
||||||
|
|
@ -0,0 +1,21 @@
|
||||||
|
The MIT License (MIT)
|
||||||
|
|
||||||
|
Copyright (c) 2015 Microsoft Corporation
|
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
|
in the Software without restriction, including without limitation the rights
|
||||||
|
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||||
|
copies of the Software, and to permit persons to whom the Software is
|
||||||
|
furnished to do so, subject to the following conditions:
|
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be included in
|
||||||
|
all copies or substantial portions of the Software.
|
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||||
|
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||||
|
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||||
|
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||||
|
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||||
|
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
||||||
|
THE SOFTWARE.
|
||||||
|
|
@ -0,0 +1,12 @@
|
||||||
|
# go-ansiterm
|
||||||
|
|
||||||
|
This is a cross platform Ansi Terminal Emulation library. It reads a stream of Ansi characters and produces the appropriate function calls. The results of the function calls are platform dependent.
|
||||||
|
|
||||||
|
For example the parser might receive "ESC, [, A" as a stream of three characters. This is the code for Cursor Up (http://www.vt100.net/docs/vt510-rm/CUU). The parser then calls the cursor up function (CUU()) on an event handler. The event handler determines what platform specific work must be done to cause the cursor to move up one position.
|
||||||
|
|
||||||
|
The parser (parser.go) is a partial implementation of this state machine (http://vt100.net/emu/vt500_parser.png). There are also two event handler implementations, one for tests (test_event_handler.go) to validate that the expected events are being produced and called, the other is a Windows implementation (winterm/win_event_handler.go).
|
||||||
|
|
||||||
|
See parser_test.go for examples exercising the state machine and generating appropriate function calls.
|
||||||
|
|
||||||
|
-----
|
||||||
|
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/). For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
|
||||||
|
|
@ -0,0 +1,188 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
const LogEnv = "DEBUG_TERMINAL"
|
||||||
|
|
||||||
|
// ANSI constants
|
||||||
|
// References:
|
||||||
|
// -- http://www.ecma-international.org/publications/standards/Ecma-048.htm
|
||||||
|
// -- http://man7.org/linux/man-pages/man4/console_codes.4.html
|
||||||
|
// -- http://manpages.ubuntu.com/manpages/intrepid/man4/console_codes.4.html
|
||||||
|
// -- http://en.wikipedia.org/wiki/ANSI_escape_code
|
||||||
|
// -- http://vt100.net/emu/dec_ansi_parser
|
||||||
|
// -- http://vt100.net/emu/vt500_parser.svg
|
||||||
|
// -- http://invisible-island.net/xterm/ctlseqs/ctlseqs.html
|
||||||
|
// -- http://www.inwap.com/pdp10/ansicode.txt
|
||||||
|
const (
|
||||||
|
// ECMA-48 Set Graphics Rendition
|
||||||
|
// Note:
|
||||||
|
// -- Constants leading with an underscore (e.g., _ANSI_xxx) are unsupported or reserved
|
||||||
|
// -- Fonts could possibly be supported via SetCurrentConsoleFontEx
|
||||||
|
// -- Windows does not expose the per-window cursor (i.e., caret) blink times
|
||||||
|
ANSI_SGR_RESET = 0
|
||||||
|
ANSI_SGR_BOLD = 1
|
||||||
|
ANSI_SGR_DIM = 2
|
||||||
|
_ANSI_SGR_ITALIC = 3
|
||||||
|
ANSI_SGR_UNDERLINE = 4
|
||||||
|
_ANSI_SGR_BLINKSLOW = 5
|
||||||
|
_ANSI_SGR_BLINKFAST = 6
|
||||||
|
ANSI_SGR_REVERSE = 7
|
||||||
|
_ANSI_SGR_INVISIBLE = 8
|
||||||
|
_ANSI_SGR_LINETHROUGH = 9
|
||||||
|
_ANSI_SGR_FONT_00 = 10
|
||||||
|
_ANSI_SGR_FONT_01 = 11
|
||||||
|
_ANSI_SGR_FONT_02 = 12
|
||||||
|
_ANSI_SGR_FONT_03 = 13
|
||||||
|
_ANSI_SGR_FONT_04 = 14
|
||||||
|
_ANSI_SGR_FONT_05 = 15
|
||||||
|
_ANSI_SGR_FONT_06 = 16
|
||||||
|
_ANSI_SGR_FONT_07 = 17
|
||||||
|
_ANSI_SGR_FONT_08 = 18
|
||||||
|
_ANSI_SGR_FONT_09 = 19
|
||||||
|
_ANSI_SGR_FONT_10 = 20
|
||||||
|
_ANSI_SGR_DOUBLEUNDERLINE = 21
|
||||||
|
ANSI_SGR_BOLD_DIM_OFF = 22
|
||||||
|
_ANSI_SGR_ITALIC_OFF = 23
|
||||||
|
ANSI_SGR_UNDERLINE_OFF = 24
|
||||||
|
_ANSI_SGR_BLINK_OFF = 25
|
||||||
|
_ANSI_SGR_RESERVED_00 = 26
|
||||||
|
ANSI_SGR_REVERSE_OFF = 27
|
||||||
|
_ANSI_SGR_INVISIBLE_OFF = 28
|
||||||
|
_ANSI_SGR_LINETHROUGH_OFF = 29
|
||||||
|
ANSI_SGR_FOREGROUND_BLACK = 30
|
||||||
|
ANSI_SGR_FOREGROUND_RED = 31
|
||||||
|
ANSI_SGR_FOREGROUND_GREEN = 32
|
||||||
|
ANSI_SGR_FOREGROUND_YELLOW = 33
|
||||||
|
ANSI_SGR_FOREGROUND_BLUE = 34
|
||||||
|
ANSI_SGR_FOREGROUND_MAGENTA = 35
|
||||||
|
ANSI_SGR_FOREGROUND_CYAN = 36
|
||||||
|
ANSI_SGR_FOREGROUND_WHITE = 37
|
||||||
|
_ANSI_SGR_RESERVED_01 = 38
|
||||||
|
ANSI_SGR_FOREGROUND_DEFAULT = 39
|
||||||
|
ANSI_SGR_BACKGROUND_BLACK = 40
|
||||||
|
ANSI_SGR_BACKGROUND_RED = 41
|
||||||
|
ANSI_SGR_BACKGROUND_GREEN = 42
|
||||||
|
ANSI_SGR_BACKGROUND_YELLOW = 43
|
||||||
|
ANSI_SGR_BACKGROUND_BLUE = 44
|
||||||
|
ANSI_SGR_BACKGROUND_MAGENTA = 45
|
||||||
|
ANSI_SGR_BACKGROUND_CYAN = 46
|
||||||
|
ANSI_SGR_BACKGROUND_WHITE = 47
|
||||||
|
_ANSI_SGR_RESERVED_02 = 48
|
||||||
|
ANSI_SGR_BACKGROUND_DEFAULT = 49
|
||||||
|
// 50 - 65: Unsupported
|
||||||
|
|
||||||
|
ANSI_MAX_CMD_LENGTH = 4096
|
||||||
|
|
||||||
|
MAX_INPUT_EVENTS = 128
|
||||||
|
DEFAULT_WIDTH = 80
|
||||||
|
DEFAULT_HEIGHT = 24
|
||||||
|
|
||||||
|
ANSI_BEL = 0x07
|
||||||
|
ANSI_BACKSPACE = 0x08
|
||||||
|
ANSI_TAB = 0x09
|
||||||
|
ANSI_LINE_FEED = 0x0A
|
||||||
|
ANSI_VERTICAL_TAB = 0x0B
|
||||||
|
ANSI_FORM_FEED = 0x0C
|
||||||
|
ANSI_CARRIAGE_RETURN = 0x0D
|
||||||
|
ANSI_ESCAPE_PRIMARY = 0x1B
|
||||||
|
ANSI_ESCAPE_SECONDARY = 0x5B
|
||||||
|
ANSI_OSC_STRING_ENTRY = 0x5D
|
||||||
|
ANSI_COMMAND_FIRST = 0x40
|
||||||
|
ANSI_COMMAND_LAST = 0x7E
|
||||||
|
DCS_ENTRY = 0x90
|
||||||
|
CSI_ENTRY = 0x9B
|
||||||
|
OSC_STRING = 0x9D
|
||||||
|
ANSI_PARAMETER_SEP = ";"
|
||||||
|
ANSI_CMD_G0 = '('
|
||||||
|
ANSI_CMD_G1 = ')'
|
||||||
|
ANSI_CMD_G2 = '*'
|
||||||
|
ANSI_CMD_G3 = '+'
|
||||||
|
ANSI_CMD_DECPNM = '>'
|
||||||
|
ANSI_CMD_DECPAM = '='
|
||||||
|
ANSI_CMD_OSC = ']'
|
||||||
|
ANSI_CMD_STR_TERM = '\\'
|
||||||
|
|
||||||
|
KEY_CONTROL_PARAM_2 = ";2"
|
||||||
|
KEY_CONTROL_PARAM_3 = ";3"
|
||||||
|
KEY_CONTROL_PARAM_4 = ";4"
|
||||||
|
KEY_CONTROL_PARAM_5 = ";5"
|
||||||
|
KEY_CONTROL_PARAM_6 = ";6"
|
||||||
|
KEY_CONTROL_PARAM_7 = ";7"
|
||||||
|
KEY_CONTROL_PARAM_8 = ";8"
|
||||||
|
KEY_ESC_CSI = "\x1B["
|
||||||
|
KEY_ESC_N = "\x1BN"
|
||||||
|
KEY_ESC_O = "\x1BO"
|
||||||
|
|
||||||
|
FILL_CHARACTER = ' '
|
||||||
|
)
|
||||||
|
|
||||||
|
func getByteRange(start byte, end byte) []byte {
|
||||||
|
bytes := make([]byte, 0, 32)
|
||||||
|
for i := start; i <= end; i++ {
|
||||||
|
bytes = append(bytes, byte(i))
|
||||||
|
}
|
||||||
|
|
||||||
|
return bytes
|
||||||
|
}
|
||||||
|
|
||||||
|
var toGroundBytes = getToGroundBytes()
|
||||||
|
var executors = getExecuteBytes()
|
||||||
|
|
||||||
|
// SPACE 20+A0 hex Always and everywhere a blank space
|
||||||
|
// Intermediate 20-2F hex !"#$%&'()*+,-./
|
||||||
|
var intermeds = getByteRange(0x20, 0x2F)
|
||||||
|
|
||||||
|
// Parameters 30-3F hex 0123456789:;<=>?
|
||||||
|
// CSI Parameters 30-39, 3B hex 0123456789;
|
||||||
|
var csiParams = getByteRange(0x30, 0x3F)
|
||||||
|
|
||||||
|
var csiCollectables = append(getByteRange(0x30, 0x39), getByteRange(0x3B, 0x3F)...)
|
||||||
|
|
||||||
|
// Uppercase 40-5F hex @ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_
|
||||||
|
var upperCase = getByteRange(0x40, 0x5F)
|
||||||
|
|
||||||
|
// Lowercase 60-7E hex `abcdefghijlkmnopqrstuvwxyz{|}~
|
||||||
|
var lowerCase = getByteRange(0x60, 0x7E)
|
||||||
|
|
||||||
|
// Alphabetics 40-7E hex (all of upper and lower case)
|
||||||
|
var alphabetics = append(upperCase, lowerCase...)
|
||||||
|
|
||||||
|
var printables = getByteRange(0x20, 0x7F)
|
||||||
|
|
||||||
|
var escapeIntermediateToGroundBytes = getByteRange(0x30, 0x7E)
|
||||||
|
var escapeToGroundBytes = getEscapeToGroundBytes()
|
||||||
|
|
||||||
|
// See http://www.vt100.net/emu/vt500_parser.png for description of the complex
|
||||||
|
// byte ranges below
|
||||||
|
|
||||||
|
func getEscapeToGroundBytes() []byte {
|
||||||
|
escapeToGroundBytes := getByteRange(0x30, 0x4F)
|
||||||
|
escapeToGroundBytes = append(escapeToGroundBytes, getByteRange(0x51, 0x57)...)
|
||||||
|
escapeToGroundBytes = append(escapeToGroundBytes, 0x59)
|
||||||
|
escapeToGroundBytes = append(escapeToGroundBytes, 0x5A)
|
||||||
|
escapeToGroundBytes = append(escapeToGroundBytes, 0x5C)
|
||||||
|
escapeToGroundBytes = append(escapeToGroundBytes, getByteRange(0x60, 0x7E)...)
|
||||||
|
return escapeToGroundBytes
|
||||||
|
}
|
||||||
|
|
||||||
|
func getExecuteBytes() []byte {
|
||||||
|
executeBytes := getByteRange(0x00, 0x17)
|
||||||
|
executeBytes = append(executeBytes, 0x19)
|
||||||
|
executeBytes = append(executeBytes, getByteRange(0x1C, 0x1F)...)
|
||||||
|
return executeBytes
|
||||||
|
}
|
||||||
|
|
||||||
|
func getToGroundBytes() []byte {
|
||||||
|
groundBytes := []byte{0x18}
|
||||||
|
groundBytes = append(groundBytes, 0x1A)
|
||||||
|
groundBytes = append(groundBytes, getByteRange(0x80, 0x8F)...)
|
||||||
|
groundBytes = append(groundBytes, getByteRange(0x91, 0x97)...)
|
||||||
|
groundBytes = append(groundBytes, 0x99)
|
||||||
|
groundBytes = append(groundBytes, 0x9A)
|
||||||
|
groundBytes = append(groundBytes, 0x9C)
|
||||||
|
return groundBytes
|
||||||
|
}
|
||||||
|
|
||||||
|
// Delete 7F hex Always and everywhere ignored
|
||||||
|
// C1 Control 80-9F hex 32 additional control characters
|
||||||
|
// G1 Displayable A1-FE hex 94 additional displayable characters
|
||||||
|
// Special A0+FF hex Same as SPACE and DELETE
|
||||||
|
|
@ -0,0 +1,7 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type ansiContext struct {
|
||||||
|
currentChar byte
|
||||||
|
paramBuffer []byte
|
||||||
|
interBuffer []byte
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,49 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type csiEntryState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
||||||
|
func (csiState csiEntryState) Handle(b byte) (s state, e error) {
|
||||||
|
csiState.parser.logf("CsiEntry::Handle %#x", b)
|
||||||
|
|
||||||
|
nextState, err := csiState.baseState.Handle(b)
|
||||||
|
if nextState != nil || err != nil {
|
||||||
|
return nextState, err
|
||||||
|
}
|
||||||
|
|
||||||
|
switch {
|
||||||
|
case sliceContains(alphabetics, b):
|
||||||
|
return csiState.parser.ground, nil
|
||||||
|
case sliceContains(csiCollectables, b):
|
||||||
|
return csiState.parser.csiParam, nil
|
||||||
|
case sliceContains(executors, b):
|
||||||
|
return csiState, csiState.parser.execute()
|
||||||
|
}
|
||||||
|
|
||||||
|
return csiState, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (csiState csiEntryState) Transition(s state) error {
|
||||||
|
csiState.parser.logf("CsiEntry::Transition %s --> %s", csiState.Name(), s.Name())
|
||||||
|
csiState.baseState.Transition(s)
|
||||||
|
|
||||||
|
switch s {
|
||||||
|
case csiState.parser.ground:
|
||||||
|
return csiState.parser.csiDispatch()
|
||||||
|
case csiState.parser.csiParam:
|
||||||
|
switch {
|
||||||
|
case sliceContains(csiParams, csiState.parser.context.currentChar):
|
||||||
|
csiState.parser.collectParam()
|
||||||
|
case sliceContains(intermeds, csiState.parser.context.currentChar):
|
||||||
|
csiState.parser.collectInter()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (csiState csiEntryState) Enter() error {
|
||||||
|
csiState.parser.clear()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,38 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type csiParamState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
||||||
|
func (csiState csiParamState) Handle(b byte) (s state, e error) {
|
||||||
|
csiState.parser.logf("CsiParam::Handle %#x", b)
|
||||||
|
|
||||||
|
nextState, err := csiState.baseState.Handle(b)
|
||||||
|
if nextState != nil || err != nil {
|
||||||
|
return nextState, err
|
||||||
|
}
|
||||||
|
|
||||||
|
switch {
|
||||||
|
case sliceContains(alphabetics, b):
|
||||||
|
return csiState.parser.ground, nil
|
||||||
|
case sliceContains(csiCollectables, b):
|
||||||
|
csiState.parser.collectParam()
|
||||||
|
return csiState, nil
|
||||||
|
case sliceContains(executors, b):
|
||||||
|
return csiState, csiState.parser.execute()
|
||||||
|
}
|
||||||
|
|
||||||
|
return csiState, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (csiState csiParamState) Transition(s state) error {
|
||||||
|
csiState.parser.logf("CsiParam::Transition %s --> %s", csiState.Name(), s.Name())
|
||||||
|
csiState.baseState.Transition(s)
|
||||||
|
|
||||||
|
switch s {
|
||||||
|
case csiState.parser.ground:
|
||||||
|
return csiState.parser.csiDispatch()
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,36 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type escapeIntermediateState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
||||||
|
func (escState escapeIntermediateState) Handle(b byte) (s state, e error) {
|
||||||
|
escState.parser.logf("escapeIntermediateState::Handle %#x", b)
|
||||||
|
nextState, err := escState.baseState.Handle(b)
|
||||||
|
if nextState != nil || err != nil {
|
||||||
|
return nextState, err
|
||||||
|
}
|
||||||
|
|
||||||
|
switch {
|
||||||
|
case sliceContains(intermeds, b):
|
||||||
|
return escState, escState.parser.collectInter()
|
||||||
|
case sliceContains(executors, b):
|
||||||
|
return escState, escState.parser.execute()
|
||||||
|
case sliceContains(escapeIntermediateToGroundBytes, b):
|
||||||
|
return escState.parser.ground, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
return escState, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (escState escapeIntermediateState) Transition(s state) error {
|
||||||
|
escState.parser.logf("escapeIntermediateState::Transition %s --> %s", escState.Name(), s.Name())
|
||||||
|
escState.baseState.Transition(s)
|
||||||
|
|
||||||
|
switch s {
|
||||||
|
case escState.parser.ground:
|
||||||
|
return escState.parser.escDispatch()
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,47 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type escapeState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
||||||
|
func (escState escapeState) Handle(b byte) (s state, e error) {
|
||||||
|
escState.parser.logf("escapeState::Handle %#x", b)
|
||||||
|
nextState, err := escState.baseState.Handle(b)
|
||||||
|
if nextState != nil || err != nil {
|
||||||
|
return nextState, err
|
||||||
|
}
|
||||||
|
|
||||||
|
switch {
|
||||||
|
case b == ANSI_ESCAPE_SECONDARY:
|
||||||
|
return escState.parser.csiEntry, nil
|
||||||
|
case b == ANSI_OSC_STRING_ENTRY:
|
||||||
|
return escState.parser.oscString, nil
|
||||||
|
case sliceContains(executors, b):
|
||||||
|
return escState, escState.parser.execute()
|
||||||
|
case sliceContains(escapeToGroundBytes, b):
|
||||||
|
return escState.parser.ground, nil
|
||||||
|
case sliceContains(intermeds, b):
|
||||||
|
return escState.parser.escapeIntermediate, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
return escState, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (escState escapeState) Transition(s state) error {
|
||||||
|
escState.parser.logf("Escape::Transition %s --> %s", escState.Name(), s.Name())
|
||||||
|
escState.baseState.Transition(s)
|
||||||
|
|
||||||
|
switch s {
|
||||||
|
case escState.parser.ground:
|
||||||
|
return escState.parser.escDispatch()
|
||||||
|
case escState.parser.escapeIntermediate:
|
||||||
|
return escState.parser.collectInter()
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (escState escapeState) Enter() error {
|
||||||
|
escState.parser.clear()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,90 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type AnsiEventHandler interface {
|
||||||
|
// Print
|
||||||
|
Print(b byte) error
|
||||||
|
|
||||||
|
// Execute C0 commands
|
||||||
|
Execute(b byte) error
|
||||||
|
|
||||||
|
// CUrsor Up
|
||||||
|
CUU(int) error
|
||||||
|
|
||||||
|
// CUrsor Down
|
||||||
|
CUD(int) error
|
||||||
|
|
||||||
|
// CUrsor Forward
|
||||||
|
CUF(int) error
|
||||||
|
|
||||||
|
// CUrsor Backward
|
||||||
|
CUB(int) error
|
||||||
|
|
||||||
|
// Cursor to Next Line
|
||||||
|
CNL(int) error
|
||||||
|
|
||||||
|
// Cursor to Previous Line
|
||||||
|
CPL(int) error
|
||||||
|
|
||||||
|
// Cursor Horizontal position Absolute
|
||||||
|
CHA(int) error
|
||||||
|
|
||||||
|
// Vertical line Position Absolute
|
||||||
|
VPA(int) error
|
||||||
|
|
||||||
|
// CUrsor Position
|
||||||
|
CUP(int, int) error
|
||||||
|
|
||||||
|
// Horizontal and Vertical Position (depends on PUM)
|
||||||
|
HVP(int, int) error
|
||||||
|
|
||||||
|
// Text Cursor Enable Mode
|
||||||
|
DECTCEM(bool) error
|
||||||
|
|
||||||
|
// Origin Mode
|
||||||
|
DECOM(bool) error
|
||||||
|
|
||||||
|
// 132 Column Mode
|
||||||
|
DECCOLM(bool) error
|
||||||
|
|
||||||
|
// Erase in Display
|
||||||
|
ED(int) error
|
||||||
|
|
||||||
|
// Erase in Line
|
||||||
|
EL(int) error
|
||||||
|
|
||||||
|
// Insert Line
|
||||||
|
IL(int) error
|
||||||
|
|
||||||
|
// Delete Line
|
||||||
|
DL(int) error
|
||||||
|
|
||||||
|
// Insert Character
|
||||||
|
ICH(int) error
|
||||||
|
|
||||||
|
// Delete Character
|
||||||
|
DCH(int) error
|
||||||
|
|
||||||
|
// Set Graphics Rendition
|
||||||
|
SGR([]int) error
|
||||||
|
|
||||||
|
// Pan Down
|
||||||
|
SU(int) error
|
||||||
|
|
||||||
|
// Pan Up
|
||||||
|
SD(int) error
|
||||||
|
|
||||||
|
// Device Attributes
|
||||||
|
DA([]string) error
|
||||||
|
|
||||||
|
// Set Top and Bottom Margins
|
||||||
|
DECSTBM(int, int) error
|
||||||
|
|
||||||
|
// Index
|
||||||
|
IND() error
|
||||||
|
|
||||||
|
// Reverse Index
|
||||||
|
RI() error
|
||||||
|
|
||||||
|
// Flush updates from previous commands
|
||||||
|
Flush() error
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,24 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type groundState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
||||||
|
func (gs groundState) Handle(b byte) (s state, e error) {
|
||||||
|
gs.parser.context.currentChar = b
|
||||||
|
|
||||||
|
nextState, err := gs.baseState.Handle(b)
|
||||||
|
if nextState != nil || err != nil {
|
||||||
|
return nextState, err
|
||||||
|
}
|
||||||
|
|
||||||
|
switch {
|
||||||
|
case sliceContains(printables, b):
|
||||||
|
return gs, gs.parser.print()
|
||||||
|
|
||||||
|
case sliceContains(executors, b):
|
||||||
|
return gs, gs.parser.execute()
|
||||||
|
}
|
||||||
|
|
||||||
|
return gs, nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,31 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type oscStringState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
||||||
|
func (oscState oscStringState) Handle(b byte) (s state, e error) {
|
||||||
|
oscState.parser.logf("OscString::Handle %#x", b)
|
||||||
|
nextState, err := oscState.baseState.Handle(b)
|
||||||
|
if nextState != nil || err != nil {
|
||||||
|
return nextState, err
|
||||||
|
}
|
||||||
|
|
||||||
|
switch {
|
||||||
|
case isOscStringTerminator(b):
|
||||||
|
return oscState.parser.ground, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
return oscState, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// See below for OSC string terminators for linux
|
||||||
|
// http://man7.org/linux/man-pages/man4/console_codes.4.html
|
||||||
|
func isOscStringTerminator(b byte) bool {
|
||||||
|
|
||||||
|
if b == ANSI_BEL || b == 0x5C {
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,151 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
import (
|
||||||
|
"errors"
|
||||||
|
"log"
|
||||||
|
"os"
|
||||||
|
)
|
||||||
|
|
||||||
|
type AnsiParser struct {
|
||||||
|
currState state
|
||||||
|
eventHandler AnsiEventHandler
|
||||||
|
context *ansiContext
|
||||||
|
csiEntry state
|
||||||
|
csiParam state
|
||||||
|
dcsEntry state
|
||||||
|
escape state
|
||||||
|
escapeIntermediate state
|
||||||
|
error state
|
||||||
|
ground state
|
||||||
|
oscString state
|
||||||
|
stateMap []state
|
||||||
|
|
||||||
|
logf func(string, ...interface{})
|
||||||
|
}
|
||||||
|
|
||||||
|
type Option func(*AnsiParser)
|
||||||
|
|
||||||
|
func WithLogf(f func(string, ...interface{})) Option {
|
||||||
|
return func(ap *AnsiParser) {
|
||||||
|
ap.logf = f
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func CreateParser(initialState string, evtHandler AnsiEventHandler, opts ...Option) *AnsiParser {
|
||||||
|
ap := &AnsiParser{
|
||||||
|
eventHandler: evtHandler,
|
||||||
|
context: &ansiContext{},
|
||||||
|
}
|
||||||
|
for _, o := range opts {
|
||||||
|
o(ap)
|
||||||
|
}
|
||||||
|
|
||||||
|
if isDebugEnv := os.Getenv(LogEnv); isDebugEnv == "1" {
|
||||||
|
logFile, _ := os.Create("ansiParser.log")
|
||||||
|
logger := log.New(logFile, "", log.LstdFlags)
|
||||||
|
if ap.logf != nil {
|
||||||
|
l := ap.logf
|
||||||
|
ap.logf = func(s string, v ...interface{}) {
|
||||||
|
l(s, v...)
|
||||||
|
logger.Printf(s, v...)
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
ap.logf = logger.Printf
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if ap.logf == nil {
|
||||||
|
ap.logf = func(string, ...interface{}) {}
|
||||||
|
}
|
||||||
|
|
||||||
|
ap.csiEntry = csiEntryState{baseState{name: "CsiEntry", parser: ap}}
|
||||||
|
ap.csiParam = csiParamState{baseState{name: "CsiParam", parser: ap}}
|
||||||
|
ap.dcsEntry = dcsEntryState{baseState{name: "DcsEntry", parser: ap}}
|
||||||
|
ap.escape = escapeState{baseState{name: "Escape", parser: ap}}
|
||||||
|
ap.escapeIntermediate = escapeIntermediateState{baseState{name: "EscapeIntermediate", parser: ap}}
|
||||||
|
ap.error = errorState{baseState{name: "Error", parser: ap}}
|
||||||
|
ap.ground = groundState{baseState{name: "Ground", parser: ap}}
|
||||||
|
ap.oscString = oscStringState{baseState{name: "OscString", parser: ap}}
|
||||||
|
|
||||||
|
ap.stateMap = []state{
|
||||||
|
ap.csiEntry,
|
||||||
|
ap.csiParam,
|
||||||
|
ap.dcsEntry,
|
||||||
|
ap.escape,
|
||||||
|
ap.escapeIntermediate,
|
||||||
|
ap.error,
|
||||||
|
ap.ground,
|
||||||
|
ap.oscString,
|
||||||
|
}
|
||||||
|
|
||||||
|
ap.currState = getState(initialState, ap.stateMap)
|
||||||
|
|
||||||
|
ap.logf("CreateParser: parser %p", ap)
|
||||||
|
return ap
|
||||||
|
}
|
||||||
|
|
||||||
|
func getState(name string, states []state) state {
|
||||||
|
for _, el := range states {
|
||||||
|
if el.Name() == name {
|
||||||
|
return el
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) Parse(bytes []byte) (int, error) {
|
||||||
|
for i, b := range bytes {
|
||||||
|
if err := ap.handle(b); err != nil {
|
||||||
|
return i, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return len(bytes), ap.eventHandler.Flush()
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) handle(b byte) error {
|
||||||
|
ap.context.currentChar = b
|
||||||
|
newState, err := ap.currState.Handle(b)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if newState == nil {
|
||||||
|
ap.logf("WARNING: newState is nil")
|
||||||
|
return errors.New("New state of 'nil' is invalid.")
|
||||||
|
}
|
||||||
|
|
||||||
|
if newState != ap.currState {
|
||||||
|
if err := ap.changeState(newState); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) changeState(newState state) error {
|
||||||
|
ap.logf("ChangeState %s --> %s", ap.currState.Name(), newState.Name())
|
||||||
|
|
||||||
|
// Exit old state
|
||||||
|
if err := ap.currState.Exit(); err != nil {
|
||||||
|
ap.logf("Exit state '%s' failed with : '%v'", ap.currState.Name(), err)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Perform transition action
|
||||||
|
if err := ap.currState.Transition(newState); err != nil {
|
||||||
|
ap.logf("Transition from '%s' to '%s' failed with: '%v'", ap.currState.Name(), newState.Name, err)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Enter new state
|
||||||
|
if err := newState.Enter(); err != nil {
|
||||||
|
ap.logf("Enter state '%s' failed with: '%v'", newState.Name(), err)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
ap.currState = newState
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,99 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
import (
|
||||||
|
"strconv"
|
||||||
|
)
|
||||||
|
|
||||||
|
func parseParams(bytes []byte) ([]string, error) {
|
||||||
|
paramBuff := make([]byte, 0, 0)
|
||||||
|
params := []string{}
|
||||||
|
|
||||||
|
for _, v := range bytes {
|
||||||
|
if v == ';' {
|
||||||
|
if len(paramBuff) > 0 {
|
||||||
|
// Completed parameter, append it to the list
|
||||||
|
s := string(paramBuff)
|
||||||
|
params = append(params, s)
|
||||||
|
paramBuff = make([]byte, 0, 0)
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
paramBuff = append(paramBuff, v)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Last parameter may not be terminated with ';'
|
||||||
|
if len(paramBuff) > 0 {
|
||||||
|
s := string(paramBuff)
|
||||||
|
params = append(params, s)
|
||||||
|
}
|
||||||
|
|
||||||
|
return params, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func parseCmd(context ansiContext) (string, error) {
|
||||||
|
return string(context.currentChar), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func getInt(params []string, dflt int) int {
|
||||||
|
i := getInts(params, 1, dflt)[0]
|
||||||
|
return i
|
||||||
|
}
|
||||||
|
|
||||||
|
func getInts(params []string, minCount int, dflt int) []int {
|
||||||
|
ints := []int{}
|
||||||
|
|
||||||
|
for _, v := range params {
|
||||||
|
i, _ := strconv.Atoi(v)
|
||||||
|
// Zero is mapped to the default value in VT100.
|
||||||
|
if i == 0 {
|
||||||
|
i = dflt
|
||||||
|
}
|
||||||
|
ints = append(ints, i)
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(ints) < minCount {
|
||||||
|
remaining := minCount - len(ints)
|
||||||
|
for i := 0; i < remaining; i++ {
|
||||||
|
ints = append(ints, dflt)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return ints
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) modeDispatch(param string, set bool) error {
|
||||||
|
switch param {
|
||||||
|
case "?3":
|
||||||
|
return ap.eventHandler.DECCOLM(set)
|
||||||
|
case "?6":
|
||||||
|
return ap.eventHandler.DECOM(set)
|
||||||
|
case "?25":
|
||||||
|
return ap.eventHandler.DECTCEM(set)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) hDispatch(params []string) error {
|
||||||
|
if len(params) == 1 {
|
||||||
|
return ap.modeDispatch(params[0], true)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) lDispatch(params []string) error {
|
||||||
|
if len(params) == 1 {
|
||||||
|
return ap.modeDispatch(params[0], false)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func getEraseParam(params []string) int {
|
||||||
|
param := getInt(params, 0)
|
||||||
|
if param < 0 || 3 < param {
|
||||||
|
param = 0
|
||||||
|
}
|
||||||
|
|
||||||
|
return param
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,119 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
func (ap *AnsiParser) collectParam() error {
|
||||||
|
currChar := ap.context.currentChar
|
||||||
|
ap.logf("collectParam %#x", currChar)
|
||||||
|
ap.context.paramBuffer = append(ap.context.paramBuffer, currChar)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) collectInter() error {
|
||||||
|
currChar := ap.context.currentChar
|
||||||
|
ap.logf("collectInter %#x", currChar)
|
||||||
|
ap.context.paramBuffer = append(ap.context.interBuffer, currChar)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) escDispatch() error {
|
||||||
|
cmd, _ := parseCmd(*ap.context)
|
||||||
|
intermeds := ap.context.interBuffer
|
||||||
|
ap.logf("escDispatch currentChar: %#x", ap.context.currentChar)
|
||||||
|
ap.logf("escDispatch: %v(%v)", cmd, intermeds)
|
||||||
|
|
||||||
|
switch cmd {
|
||||||
|
case "D": // IND
|
||||||
|
return ap.eventHandler.IND()
|
||||||
|
case "E": // NEL, equivalent to CRLF
|
||||||
|
err := ap.eventHandler.Execute(ANSI_CARRIAGE_RETURN)
|
||||||
|
if err == nil {
|
||||||
|
err = ap.eventHandler.Execute(ANSI_LINE_FEED)
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
case "M": // RI
|
||||||
|
return ap.eventHandler.RI()
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) csiDispatch() error {
|
||||||
|
cmd, _ := parseCmd(*ap.context)
|
||||||
|
params, _ := parseParams(ap.context.paramBuffer)
|
||||||
|
ap.logf("Parsed params: %v with length: %d", params, len(params))
|
||||||
|
|
||||||
|
ap.logf("csiDispatch: %v(%v)", cmd, params)
|
||||||
|
|
||||||
|
switch cmd {
|
||||||
|
case "@":
|
||||||
|
return ap.eventHandler.ICH(getInt(params, 1))
|
||||||
|
case "A":
|
||||||
|
return ap.eventHandler.CUU(getInt(params, 1))
|
||||||
|
case "B":
|
||||||
|
return ap.eventHandler.CUD(getInt(params, 1))
|
||||||
|
case "C":
|
||||||
|
return ap.eventHandler.CUF(getInt(params, 1))
|
||||||
|
case "D":
|
||||||
|
return ap.eventHandler.CUB(getInt(params, 1))
|
||||||
|
case "E":
|
||||||
|
return ap.eventHandler.CNL(getInt(params, 1))
|
||||||
|
case "F":
|
||||||
|
return ap.eventHandler.CPL(getInt(params, 1))
|
||||||
|
case "G":
|
||||||
|
return ap.eventHandler.CHA(getInt(params, 1))
|
||||||
|
case "H":
|
||||||
|
ints := getInts(params, 2, 1)
|
||||||
|
x, y := ints[0], ints[1]
|
||||||
|
return ap.eventHandler.CUP(x, y)
|
||||||
|
case "J":
|
||||||
|
param := getEraseParam(params)
|
||||||
|
return ap.eventHandler.ED(param)
|
||||||
|
case "K":
|
||||||
|
param := getEraseParam(params)
|
||||||
|
return ap.eventHandler.EL(param)
|
||||||
|
case "L":
|
||||||
|
return ap.eventHandler.IL(getInt(params, 1))
|
||||||
|
case "M":
|
||||||
|
return ap.eventHandler.DL(getInt(params, 1))
|
||||||
|
case "P":
|
||||||
|
return ap.eventHandler.DCH(getInt(params, 1))
|
||||||
|
case "S":
|
||||||
|
return ap.eventHandler.SU(getInt(params, 1))
|
||||||
|
case "T":
|
||||||
|
return ap.eventHandler.SD(getInt(params, 1))
|
||||||
|
case "c":
|
||||||
|
return ap.eventHandler.DA(params)
|
||||||
|
case "d":
|
||||||
|
return ap.eventHandler.VPA(getInt(params, 1))
|
||||||
|
case "f":
|
||||||
|
ints := getInts(params, 2, 1)
|
||||||
|
x, y := ints[0], ints[1]
|
||||||
|
return ap.eventHandler.HVP(x, y)
|
||||||
|
case "h":
|
||||||
|
return ap.hDispatch(params)
|
||||||
|
case "l":
|
||||||
|
return ap.lDispatch(params)
|
||||||
|
case "m":
|
||||||
|
return ap.eventHandler.SGR(getInts(params, 1, 0))
|
||||||
|
case "r":
|
||||||
|
ints := getInts(params, 2, 1)
|
||||||
|
top, bottom := ints[0], ints[1]
|
||||||
|
return ap.eventHandler.DECSTBM(top, bottom)
|
||||||
|
default:
|
||||||
|
ap.logf("ERROR: Unsupported CSI command: '%s', with full context: %v", cmd, ap.context)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) print() error {
|
||||||
|
return ap.eventHandler.Print(ap.context.currentChar)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) clear() error {
|
||||||
|
ap.context = &ansiContext{}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ap *AnsiParser) execute() error {
|
||||||
|
return ap.eventHandler.Execute(ap.context.currentChar)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,71 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
type stateID int
|
||||||
|
|
||||||
|
type state interface {
|
||||||
|
Enter() error
|
||||||
|
Exit() error
|
||||||
|
Handle(byte) (state, error)
|
||||||
|
Name() string
|
||||||
|
Transition(state) error
|
||||||
|
}
|
||||||
|
|
||||||
|
type baseState struct {
|
||||||
|
name string
|
||||||
|
parser *AnsiParser
|
||||||
|
}
|
||||||
|
|
||||||
|
func (base baseState) Enter() error {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (base baseState) Exit() error {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (base baseState) Handle(b byte) (s state, e error) {
|
||||||
|
|
||||||
|
switch {
|
||||||
|
case b == CSI_ENTRY:
|
||||||
|
return base.parser.csiEntry, nil
|
||||||
|
case b == DCS_ENTRY:
|
||||||
|
return base.parser.dcsEntry, nil
|
||||||
|
case b == ANSI_ESCAPE_PRIMARY:
|
||||||
|
return base.parser.escape, nil
|
||||||
|
case b == OSC_STRING:
|
||||||
|
return base.parser.oscString, nil
|
||||||
|
case sliceContains(toGroundBytes, b):
|
||||||
|
return base.parser.ground, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (base baseState) Name() string {
|
||||||
|
return base.name
|
||||||
|
}
|
||||||
|
|
||||||
|
func (base baseState) Transition(s state) error {
|
||||||
|
if s == base.parser.ground {
|
||||||
|
execBytes := []byte{0x18}
|
||||||
|
execBytes = append(execBytes, 0x1A)
|
||||||
|
execBytes = append(execBytes, getByteRange(0x80, 0x8F)...)
|
||||||
|
execBytes = append(execBytes, getByteRange(0x91, 0x97)...)
|
||||||
|
execBytes = append(execBytes, 0x99)
|
||||||
|
execBytes = append(execBytes, 0x9A)
|
||||||
|
|
||||||
|
if sliceContains(execBytes, base.parser.context.currentChar) {
|
||||||
|
return base.parser.execute()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
type dcsEntryState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
||||||
|
type errorState struct {
|
||||||
|
baseState
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,21 @@
|
||||||
|
package ansiterm
|
||||||
|
|
||||||
|
import (
|
||||||
|
"strconv"
|
||||||
|
)
|
||||||
|
|
||||||
|
func sliceContains(bytes []byte, b byte) bool {
|
||||||
|
for _, v := range bytes {
|
||||||
|
if v == b {
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|
||||||
|
func convertBytesToInteger(bytes []byte) int {
|
||||||
|
s := string(bytes)
|
||||||
|
i, _ := strconv.Atoi(s)
|
||||||
|
return i
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,182 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"os"
|
||||||
|
"strconv"
|
||||||
|
"strings"
|
||||||
|
"syscall"
|
||||||
|
|
||||||
|
"github.com/Azure/go-ansiterm"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Windows keyboard constants
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/dd375731(v=vs.85).aspx.
|
||||||
|
const (
|
||||||
|
VK_PRIOR = 0x21 // PAGE UP key
|
||||||
|
VK_NEXT = 0x22 // PAGE DOWN key
|
||||||
|
VK_END = 0x23 // END key
|
||||||
|
VK_HOME = 0x24 // HOME key
|
||||||
|
VK_LEFT = 0x25 // LEFT ARROW key
|
||||||
|
VK_UP = 0x26 // UP ARROW key
|
||||||
|
VK_RIGHT = 0x27 // RIGHT ARROW key
|
||||||
|
VK_DOWN = 0x28 // DOWN ARROW key
|
||||||
|
VK_SELECT = 0x29 // SELECT key
|
||||||
|
VK_PRINT = 0x2A // PRINT key
|
||||||
|
VK_EXECUTE = 0x2B // EXECUTE key
|
||||||
|
VK_SNAPSHOT = 0x2C // PRINT SCREEN key
|
||||||
|
VK_INSERT = 0x2D // INS key
|
||||||
|
VK_DELETE = 0x2E // DEL key
|
||||||
|
VK_HELP = 0x2F // HELP key
|
||||||
|
VK_F1 = 0x70 // F1 key
|
||||||
|
VK_F2 = 0x71 // F2 key
|
||||||
|
VK_F3 = 0x72 // F3 key
|
||||||
|
VK_F4 = 0x73 // F4 key
|
||||||
|
VK_F5 = 0x74 // F5 key
|
||||||
|
VK_F6 = 0x75 // F6 key
|
||||||
|
VK_F7 = 0x76 // F7 key
|
||||||
|
VK_F8 = 0x77 // F8 key
|
||||||
|
VK_F9 = 0x78 // F9 key
|
||||||
|
VK_F10 = 0x79 // F10 key
|
||||||
|
VK_F11 = 0x7A // F11 key
|
||||||
|
VK_F12 = 0x7B // F12 key
|
||||||
|
|
||||||
|
RIGHT_ALT_PRESSED = 0x0001
|
||||||
|
LEFT_ALT_PRESSED = 0x0002
|
||||||
|
RIGHT_CTRL_PRESSED = 0x0004
|
||||||
|
LEFT_CTRL_PRESSED = 0x0008
|
||||||
|
SHIFT_PRESSED = 0x0010
|
||||||
|
NUMLOCK_ON = 0x0020
|
||||||
|
SCROLLLOCK_ON = 0x0040
|
||||||
|
CAPSLOCK_ON = 0x0080
|
||||||
|
ENHANCED_KEY = 0x0100
|
||||||
|
)
|
||||||
|
|
||||||
|
type ansiCommand struct {
|
||||||
|
CommandBytes []byte
|
||||||
|
Command string
|
||||||
|
Parameters []string
|
||||||
|
IsSpecial bool
|
||||||
|
}
|
||||||
|
|
||||||
|
func newAnsiCommand(command []byte) *ansiCommand {
|
||||||
|
|
||||||
|
if isCharacterSelectionCmdChar(command[1]) {
|
||||||
|
// Is Character Set Selection commands
|
||||||
|
return &ansiCommand{
|
||||||
|
CommandBytes: command,
|
||||||
|
Command: string(command),
|
||||||
|
IsSpecial: true,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// last char is command character
|
||||||
|
lastCharIndex := len(command) - 1
|
||||||
|
|
||||||
|
ac := &ansiCommand{
|
||||||
|
CommandBytes: command,
|
||||||
|
Command: string(command[lastCharIndex]),
|
||||||
|
IsSpecial: false,
|
||||||
|
}
|
||||||
|
|
||||||
|
// more than a single escape
|
||||||
|
if lastCharIndex != 0 {
|
||||||
|
start := 1
|
||||||
|
// skip if double char escape sequence
|
||||||
|
if command[0] == ansiterm.ANSI_ESCAPE_PRIMARY && command[1] == ansiterm.ANSI_ESCAPE_SECONDARY {
|
||||||
|
start++
|
||||||
|
}
|
||||||
|
// convert this to GetNextParam method
|
||||||
|
ac.Parameters = strings.Split(string(command[start:lastCharIndex]), ansiterm.ANSI_PARAMETER_SEP)
|
||||||
|
}
|
||||||
|
|
||||||
|
return ac
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ac *ansiCommand) paramAsSHORT(index int, defaultValue int16) int16 {
|
||||||
|
if index < 0 || index >= len(ac.Parameters) {
|
||||||
|
return defaultValue
|
||||||
|
}
|
||||||
|
|
||||||
|
param, err := strconv.ParseInt(ac.Parameters[index], 10, 16)
|
||||||
|
if err != nil {
|
||||||
|
return defaultValue
|
||||||
|
}
|
||||||
|
|
||||||
|
return int16(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ac *ansiCommand) String() string {
|
||||||
|
return fmt.Sprintf("0x%v \"%v\" (\"%v\")",
|
||||||
|
bytesToHex(ac.CommandBytes),
|
||||||
|
ac.Command,
|
||||||
|
strings.Join(ac.Parameters, "\",\""))
|
||||||
|
}
|
||||||
|
|
||||||
|
// isAnsiCommandChar returns true if the passed byte falls within the range of ANSI commands.
|
||||||
|
// See http://manpages.ubuntu.com/manpages/intrepid/man4/console_codes.4.html.
|
||||||
|
func isAnsiCommandChar(b byte) bool {
|
||||||
|
switch {
|
||||||
|
case ansiterm.ANSI_COMMAND_FIRST <= b && b <= ansiterm.ANSI_COMMAND_LAST && b != ansiterm.ANSI_ESCAPE_SECONDARY:
|
||||||
|
return true
|
||||||
|
case b == ansiterm.ANSI_CMD_G1 || b == ansiterm.ANSI_CMD_OSC || b == ansiterm.ANSI_CMD_DECPAM || b == ansiterm.ANSI_CMD_DECPNM:
|
||||||
|
// non-CSI escape sequence terminator
|
||||||
|
return true
|
||||||
|
case b == ansiterm.ANSI_CMD_STR_TERM || b == ansiterm.ANSI_BEL:
|
||||||
|
// String escape sequence terminator
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|
||||||
|
func isXtermOscSequence(command []byte, current byte) bool {
|
||||||
|
return (len(command) >= 2 && command[0] == ansiterm.ANSI_ESCAPE_PRIMARY && command[1] == ansiterm.ANSI_CMD_OSC && current != ansiterm.ANSI_BEL)
|
||||||
|
}
|
||||||
|
|
||||||
|
func isCharacterSelectionCmdChar(b byte) bool {
|
||||||
|
return (b == ansiterm.ANSI_CMD_G0 || b == ansiterm.ANSI_CMD_G1 || b == ansiterm.ANSI_CMD_G2 || b == ansiterm.ANSI_CMD_G3)
|
||||||
|
}
|
||||||
|
|
||||||
|
// bytesToHex converts a slice of bytes to a human-readable string.
|
||||||
|
func bytesToHex(b []byte) string {
|
||||||
|
hex := make([]string, len(b))
|
||||||
|
for i, ch := range b {
|
||||||
|
hex[i] = fmt.Sprintf("%X", ch)
|
||||||
|
}
|
||||||
|
return strings.Join(hex, "")
|
||||||
|
}
|
||||||
|
|
||||||
|
// ensureInRange adjusts the passed value, if necessary, to ensure it is within
|
||||||
|
// the passed min / max range.
|
||||||
|
func ensureInRange(n int16, min int16, max int16) int16 {
|
||||||
|
if n < min {
|
||||||
|
return min
|
||||||
|
} else if n > max {
|
||||||
|
return max
|
||||||
|
} else {
|
||||||
|
return n
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func GetStdFile(nFile int) (*os.File, uintptr) {
|
||||||
|
var file *os.File
|
||||||
|
switch nFile {
|
||||||
|
case syscall.STD_INPUT_HANDLE:
|
||||||
|
file = os.Stdin
|
||||||
|
case syscall.STD_OUTPUT_HANDLE:
|
||||||
|
file = os.Stdout
|
||||||
|
case syscall.STD_ERROR_HANDLE:
|
||||||
|
file = os.Stderr
|
||||||
|
default:
|
||||||
|
panic(fmt.Errorf("Invalid standard handle identifier: %v", nFile))
|
||||||
|
}
|
||||||
|
|
||||||
|
fd, err := syscall.GetStdHandle(nFile)
|
||||||
|
if err != nil {
|
||||||
|
panic(fmt.Errorf("Invalid standard handle identifier: %v -- %v", nFile, err))
|
||||||
|
}
|
||||||
|
|
||||||
|
return file, uintptr(fd)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,327 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
)
|
||||||
|
|
||||||
|
//===========================================================================================================
|
||||||
|
// IMPORTANT NOTE:
|
||||||
|
//
|
||||||
|
// The methods below make extensive use of the "unsafe" package to obtain the required pointers.
|
||||||
|
// Beginning in Go 1.3, the garbage collector may release local variables (e.g., incoming arguments, stack
|
||||||
|
// variables) the pointers reference *before* the API completes.
|
||||||
|
//
|
||||||
|
// As a result, in those cases, the code must hint that the variables remain in active by invoking the
|
||||||
|
// dummy method "use" (see below). Newer versions of Go are planned to change the mechanism to no longer
|
||||||
|
// require unsafe pointers.
|
||||||
|
//
|
||||||
|
// If you add or modify methods, ENSURE protection of local variables through the "use" builtin to inform
|
||||||
|
// the garbage collector the variables remain in use if:
|
||||||
|
//
|
||||||
|
// -- The value is not a pointer (e.g., int32, struct)
|
||||||
|
// -- The value is not referenced by the method after passing the pointer to Windows
|
||||||
|
//
|
||||||
|
// See http://golang.org/doc/go1.3.
|
||||||
|
//===========================================================================================================
|
||||||
|
|
||||||
|
var (
|
||||||
|
kernel32DLL = syscall.NewLazyDLL("kernel32.dll")
|
||||||
|
|
||||||
|
getConsoleCursorInfoProc = kernel32DLL.NewProc("GetConsoleCursorInfo")
|
||||||
|
setConsoleCursorInfoProc = kernel32DLL.NewProc("SetConsoleCursorInfo")
|
||||||
|
setConsoleCursorPositionProc = kernel32DLL.NewProc("SetConsoleCursorPosition")
|
||||||
|
setConsoleModeProc = kernel32DLL.NewProc("SetConsoleMode")
|
||||||
|
getConsoleScreenBufferInfoProc = kernel32DLL.NewProc("GetConsoleScreenBufferInfo")
|
||||||
|
setConsoleScreenBufferSizeProc = kernel32DLL.NewProc("SetConsoleScreenBufferSize")
|
||||||
|
scrollConsoleScreenBufferProc = kernel32DLL.NewProc("ScrollConsoleScreenBufferA")
|
||||||
|
setConsoleTextAttributeProc = kernel32DLL.NewProc("SetConsoleTextAttribute")
|
||||||
|
setConsoleWindowInfoProc = kernel32DLL.NewProc("SetConsoleWindowInfo")
|
||||||
|
writeConsoleOutputProc = kernel32DLL.NewProc("WriteConsoleOutputW")
|
||||||
|
readConsoleInputProc = kernel32DLL.NewProc("ReadConsoleInputW")
|
||||||
|
waitForSingleObjectProc = kernel32DLL.NewProc("WaitForSingleObject")
|
||||||
|
)
|
||||||
|
|
||||||
|
// Windows Console constants
|
||||||
|
const (
|
||||||
|
// Console modes
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms686033(v=vs.85).aspx.
|
||||||
|
ENABLE_PROCESSED_INPUT = 0x0001
|
||||||
|
ENABLE_LINE_INPUT = 0x0002
|
||||||
|
ENABLE_ECHO_INPUT = 0x0004
|
||||||
|
ENABLE_WINDOW_INPUT = 0x0008
|
||||||
|
ENABLE_MOUSE_INPUT = 0x0010
|
||||||
|
ENABLE_INSERT_MODE = 0x0020
|
||||||
|
ENABLE_QUICK_EDIT_MODE = 0x0040
|
||||||
|
ENABLE_EXTENDED_FLAGS = 0x0080
|
||||||
|
ENABLE_AUTO_POSITION = 0x0100
|
||||||
|
ENABLE_VIRTUAL_TERMINAL_INPUT = 0x0200
|
||||||
|
|
||||||
|
ENABLE_PROCESSED_OUTPUT = 0x0001
|
||||||
|
ENABLE_WRAP_AT_EOL_OUTPUT = 0x0002
|
||||||
|
ENABLE_VIRTUAL_TERMINAL_PROCESSING = 0x0004
|
||||||
|
DISABLE_NEWLINE_AUTO_RETURN = 0x0008
|
||||||
|
ENABLE_LVB_GRID_WORLDWIDE = 0x0010
|
||||||
|
|
||||||
|
// Character attributes
|
||||||
|
// Note:
|
||||||
|
// -- The attributes are combined to produce various colors (e.g., Blue + Green will create Cyan).
|
||||||
|
// Clearing all foreground or background colors results in black; setting all creates white.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms682088(v=vs.85).aspx#_win32_character_attributes.
|
||||||
|
FOREGROUND_BLUE uint16 = 0x0001
|
||||||
|
FOREGROUND_GREEN uint16 = 0x0002
|
||||||
|
FOREGROUND_RED uint16 = 0x0004
|
||||||
|
FOREGROUND_INTENSITY uint16 = 0x0008
|
||||||
|
FOREGROUND_MASK uint16 = 0x000F
|
||||||
|
|
||||||
|
BACKGROUND_BLUE uint16 = 0x0010
|
||||||
|
BACKGROUND_GREEN uint16 = 0x0020
|
||||||
|
BACKGROUND_RED uint16 = 0x0040
|
||||||
|
BACKGROUND_INTENSITY uint16 = 0x0080
|
||||||
|
BACKGROUND_MASK uint16 = 0x00F0
|
||||||
|
|
||||||
|
COMMON_LVB_MASK uint16 = 0xFF00
|
||||||
|
COMMON_LVB_REVERSE_VIDEO uint16 = 0x4000
|
||||||
|
COMMON_LVB_UNDERSCORE uint16 = 0x8000
|
||||||
|
|
||||||
|
// Input event types
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms683499(v=vs.85).aspx.
|
||||||
|
KEY_EVENT = 0x0001
|
||||||
|
MOUSE_EVENT = 0x0002
|
||||||
|
WINDOW_BUFFER_SIZE_EVENT = 0x0004
|
||||||
|
MENU_EVENT = 0x0008
|
||||||
|
FOCUS_EVENT = 0x0010
|
||||||
|
|
||||||
|
// WaitForSingleObject return codes
|
||||||
|
WAIT_ABANDONED = 0x00000080
|
||||||
|
WAIT_FAILED = 0xFFFFFFFF
|
||||||
|
WAIT_SIGNALED = 0x0000000
|
||||||
|
WAIT_TIMEOUT = 0x00000102
|
||||||
|
|
||||||
|
// WaitForSingleObject wait duration
|
||||||
|
WAIT_INFINITE = 0xFFFFFFFF
|
||||||
|
WAIT_ONE_SECOND = 1000
|
||||||
|
WAIT_HALF_SECOND = 500
|
||||||
|
WAIT_QUARTER_SECOND = 250
|
||||||
|
)
|
||||||
|
|
||||||
|
// Windows API Console types
|
||||||
|
// -- See https://msdn.microsoft.com/en-us/library/windows/desktop/ms682101(v=vs.85).aspx for Console specific types (e.g., COORD)
|
||||||
|
// -- See https://msdn.microsoft.com/en-us/library/aa296569(v=vs.60).aspx for comments on alignment
|
||||||
|
type (
|
||||||
|
CHAR_INFO struct {
|
||||||
|
UnicodeChar uint16
|
||||||
|
Attributes uint16
|
||||||
|
}
|
||||||
|
|
||||||
|
CONSOLE_CURSOR_INFO struct {
|
||||||
|
Size uint32
|
||||||
|
Visible int32
|
||||||
|
}
|
||||||
|
|
||||||
|
CONSOLE_SCREEN_BUFFER_INFO struct {
|
||||||
|
Size COORD
|
||||||
|
CursorPosition COORD
|
||||||
|
Attributes uint16
|
||||||
|
Window SMALL_RECT
|
||||||
|
MaximumWindowSize COORD
|
||||||
|
}
|
||||||
|
|
||||||
|
COORD struct {
|
||||||
|
X int16
|
||||||
|
Y int16
|
||||||
|
}
|
||||||
|
|
||||||
|
SMALL_RECT struct {
|
||||||
|
Left int16
|
||||||
|
Top int16
|
||||||
|
Right int16
|
||||||
|
Bottom int16
|
||||||
|
}
|
||||||
|
|
||||||
|
// INPUT_RECORD is a C/C++ union of which KEY_EVENT_RECORD is one case, it is also the largest
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms683499(v=vs.85).aspx.
|
||||||
|
INPUT_RECORD struct {
|
||||||
|
EventType uint16
|
||||||
|
KeyEvent KEY_EVENT_RECORD
|
||||||
|
}
|
||||||
|
|
||||||
|
KEY_EVENT_RECORD struct {
|
||||||
|
KeyDown int32
|
||||||
|
RepeatCount uint16
|
||||||
|
VirtualKeyCode uint16
|
||||||
|
VirtualScanCode uint16
|
||||||
|
UnicodeChar uint16
|
||||||
|
ControlKeyState uint32
|
||||||
|
}
|
||||||
|
|
||||||
|
WINDOW_BUFFER_SIZE struct {
|
||||||
|
Size COORD
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
// boolToBOOL converts a Go bool into a Windows int32.
|
||||||
|
func boolToBOOL(f bool) int32 {
|
||||||
|
if f {
|
||||||
|
return int32(1)
|
||||||
|
} else {
|
||||||
|
return int32(0)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetConsoleCursorInfo retrieves information about the size and visiblity of the console cursor.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms683163(v=vs.85).aspx.
|
||||||
|
func GetConsoleCursorInfo(handle uintptr, cursorInfo *CONSOLE_CURSOR_INFO) error {
|
||||||
|
r1, r2, err := getConsoleCursorInfoProc.Call(handle, uintptr(unsafe.Pointer(cursorInfo)), 0)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// SetConsoleCursorInfo sets the size and visiblity of the console cursor.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms686019(v=vs.85).aspx.
|
||||||
|
func SetConsoleCursorInfo(handle uintptr, cursorInfo *CONSOLE_CURSOR_INFO) error {
|
||||||
|
r1, r2, err := setConsoleCursorInfoProc.Call(handle, uintptr(unsafe.Pointer(cursorInfo)), 0)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// SetConsoleCursorPosition location of the console cursor.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms686025(v=vs.85).aspx.
|
||||||
|
func SetConsoleCursorPosition(handle uintptr, coord COORD) error {
|
||||||
|
r1, r2, err := setConsoleCursorPositionProc.Call(handle, coordToPointer(coord))
|
||||||
|
use(coord)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetConsoleMode gets the console mode for given file descriptor
|
||||||
|
// See http://msdn.microsoft.com/en-us/library/windows/desktop/ms683167(v=vs.85).aspx.
|
||||||
|
func GetConsoleMode(handle uintptr) (mode uint32, err error) {
|
||||||
|
err = syscall.GetConsoleMode(syscall.Handle(handle), &mode)
|
||||||
|
return mode, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// SetConsoleMode sets the console mode for given file descriptor
|
||||||
|
// See http://msdn.microsoft.com/en-us/library/windows/desktop/ms686033(v=vs.85).aspx.
|
||||||
|
func SetConsoleMode(handle uintptr, mode uint32) error {
|
||||||
|
r1, r2, err := setConsoleModeProc.Call(handle, uintptr(mode), 0)
|
||||||
|
use(mode)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetConsoleScreenBufferInfo retrieves information about the specified console screen buffer.
|
||||||
|
// See http://msdn.microsoft.com/en-us/library/windows/desktop/ms683171(v=vs.85).aspx.
|
||||||
|
func GetConsoleScreenBufferInfo(handle uintptr) (*CONSOLE_SCREEN_BUFFER_INFO, error) {
|
||||||
|
info := CONSOLE_SCREEN_BUFFER_INFO{}
|
||||||
|
err := checkError(getConsoleScreenBufferInfoProc.Call(handle, uintptr(unsafe.Pointer(&info)), 0))
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return &info, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func ScrollConsoleScreenBuffer(handle uintptr, scrollRect SMALL_RECT, clipRect SMALL_RECT, destOrigin COORD, char CHAR_INFO) error {
|
||||||
|
r1, r2, err := scrollConsoleScreenBufferProc.Call(handle, uintptr(unsafe.Pointer(&scrollRect)), uintptr(unsafe.Pointer(&clipRect)), coordToPointer(destOrigin), uintptr(unsafe.Pointer(&char)))
|
||||||
|
use(scrollRect)
|
||||||
|
use(clipRect)
|
||||||
|
use(destOrigin)
|
||||||
|
use(char)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// SetConsoleScreenBufferSize sets the size of the console screen buffer.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms686044(v=vs.85).aspx.
|
||||||
|
func SetConsoleScreenBufferSize(handle uintptr, coord COORD) error {
|
||||||
|
r1, r2, err := setConsoleScreenBufferSizeProc.Call(handle, coordToPointer(coord))
|
||||||
|
use(coord)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// SetConsoleTextAttribute sets the attributes of characters written to the
|
||||||
|
// console screen buffer by the WriteFile or WriteConsole function.
|
||||||
|
// See http://msdn.microsoft.com/en-us/library/windows/desktop/ms686047(v=vs.85).aspx.
|
||||||
|
func SetConsoleTextAttribute(handle uintptr, attribute uint16) error {
|
||||||
|
r1, r2, err := setConsoleTextAttributeProc.Call(handle, uintptr(attribute), 0)
|
||||||
|
use(attribute)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// SetConsoleWindowInfo sets the size and position of the console screen buffer's window.
|
||||||
|
// Note that the size and location must be within and no larger than the backing console screen buffer.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms686125(v=vs.85).aspx.
|
||||||
|
func SetConsoleWindowInfo(handle uintptr, isAbsolute bool, rect SMALL_RECT) error {
|
||||||
|
r1, r2, err := setConsoleWindowInfoProc.Call(handle, uintptr(boolToBOOL(isAbsolute)), uintptr(unsafe.Pointer(&rect)))
|
||||||
|
use(isAbsolute)
|
||||||
|
use(rect)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// WriteConsoleOutput writes the CHAR_INFOs from the provided buffer to the active console buffer.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms687404(v=vs.85).aspx.
|
||||||
|
func WriteConsoleOutput(handle uintptr, buffer []CHAR_INFO, bufferSize COORD, bufferCoord COORD, writeRegion *SMALL_RECT) error {
|
||||||
|
r1, r2, err := writeConsoleOutputProc.Call(handle, uintptr(unsafe.Pointer(&buffer[0])), coordToPointer(bufferSize), coordToPointer(bufferCoord), uintptr(unsafe.Pointer(writeRegion)))
|
||||||
|
use(buffer)
|
||||||
|
use(bufferSize)
|
||||||
|
use(bufferCoord)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReadConsoleInput reads (and removes) data from the console input buffer.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms684961(v=vs.85).aspx.
|
||||||
|
func ReadConsoleInput(handle uintptr, buffer []INPUT_RECORD, count *uint32) error {
|
||||||
|
r1, r2, err := readConsoleInputProc.Call(handle, uintptr(unsafe.Pointer(&buffer[0])), uintptr(len(buffer)), uintptr(unsafe.Pointer(count)))
|
||||||
|
use(buffer)
|
||||||
|
return checkError(r1, r2, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// WaitForSingleObject waits for the passed handle to be signaled.
|
||||||
|
// It returns true if the handle was signaled; false otherwise.
|
||||||
|
// See https://msdn.microsoft.com/en-us/library/windows/desktop/ms687032(v=vs.85).aspx.
|
||||||
|
func WaitForSingleObject(handle uintptr, msWait uint32) (bool, error) {
|
||||||
|
r1, _, err := waitForSingleObjectProc.Call(handle, uintptr(uint32(msWait)))
|
||||||
|
switch r1 {
|
||||||
|
case WAIT_ABANDONED, WAIT_TIMEOUT:
|
||||||
|
return false, nil
|
||||||
|
case WAIT_SIGNALED:
|
||||||
|
return true, nil
|
||||||
|
}
|
||||||
|
use(msWait)
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// String helpers
|
||||||
|
func (info CONSOLE_SCREEN_BUFFER_INFO) String() string {
|
||||||
|
return fmt.Sprintf("Size(%v) Cursor(%v) Window(%v) Max(%v)", info.Size, info.CursorPosition, info.Window, info.MaximumWindowSize)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (coord COORD) String() string {
|
||||||
|
return fmt.Sprintf("%v,%v", coord.X, coord.Y)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (rect SMALL_RECT) String() string {
|
||||||
|
return fmt.Sprintf("(%v,%v),(%v,%v)", rect.Left, rect.Top, rect.Right, rect.Bottom)
|
||||||
|
}
|
||||||
|
|
||||||
|
// checkError evaluates the results of a Windows API call and returns the error if it failed.
|
||||||
|
func checkError(r1, r2 uintptr, err error) error {
|
||||||
|
// Windows APIs return non-zero to indicate success
|
||||||
|
if r1 != 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Return the error if provided, otherwise default to EINVAL
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return syscall.EINVAL
|
||||||
|
}
|
||||||
|
|
||||||
|
// coordToPointer converts a COORD into a uintptr (by fooling the type system).
|
||||||
|
func coordToPointer(c COORD) uintptr {
|
||||||
|
// Note: This code assumes the two SHORTs are correctly laid out; the "cast" to uint32 is just to get a pointer to pass.
|
||||||
|
return uintptr(*((*uint32)(unsafe.Pointer(&c))))
|
||||||
|
}
|
||||||
|
|
||||||
|
// use is a no-op, but the compiler cannot see that it is.
|
||||||
|
// Calling use(p) ensures that p is kept live until that point.
|
||||||
|
func use(p interface{}) {}
|
||||||
|
|
@ -0,0 +1,100 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
import "github.com/Azure/go-ansiterm"
|
||||||
|
|
||||||
|
const (
|
||||||
|
FOREGROUND_COLOR_MASK = FOREGROUND_RED | FOREGROUND_GREEN | FOREGROUND_BLUE
|
||||||
|
BACKGROUND_COLOR_MASK = BACKGROUND_RED | BACKGROUND_GREEN | BACKGROUND_BLUE
|
||||||
|
)
|
||||||
|
|
||||||
|
// collectAnsiIntoWindowsAttributes modifies the passed Windows text mode flags to reflect the
|
||||||
|
// request represented by the passed ANSI mode.
|
||||||
|
func collectAnsiIntoWindowsAttributes(windowsMode uint16, inverted bool, baseMode uint16, ansiMode int16) (uint16, bool) {
|
||||||
|
switch ansiMode {
|
||||||
|
|
||||||
|
// Mode styles
|
||||||
|
case ansiterm.ANSI_SGR_BOLD:
|
||||||
|
windowsMode = windowsMode | FOREGROUND_INTENSITY
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_DIM, ansiterm.ANSI_SGR_BOLD_DIM_OFF:
|
||||||
|
windowsMode &^= FOREGROUND_INTENSITY
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_UNDERLINE:
|
||||||
|
windowsMode = windowsMode | COMMON_LVB_UNDERSCORE
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_REVERSE:
|
||||||
|
inverted = true
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_REVERSE_OFF:
|
||||||
|
inverted = false
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_UNDERLINE_OFF:
|
||||||
|
windowsMode &^= COMMON_LVB_UNDERSCORE
|
||||||
|
|
||||||
|
// Foreground colors
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_DEFAULT:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_MASK) | (baseMode & FOREGROUND_MASK)
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_BLACK:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK)
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_RED:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK) | FOREGROUND_RED
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_GREEN:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK) | FOREGROUND_GREEN
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_YELLOW:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK) | FOREGROUND_RED | FOREGROUND_GREEN
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_BLUE:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK) | FOREGROUND_BLUE
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_MAGENTA:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK) | FOREGROUND_RED | FOREGROUND_BLUE
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_CYAN:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK) | FOREGROUND_GREEN | FOREGROUND_BLUE
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_FOREGROUND_WHITE:
|
||||||
|
windowsMode = (windowsMode &^ FOREGROUND_COLOR_MASK) | FOREGROUND_RED | FOREGROUND_GREEN | FOREGROUND_BLUE
|
||||||
|
|
||||||
|
// Background colors
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_DEFAULT:
|
||||||
|
// Black with no intensity
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_MASK) | (baseMode & BACKGROUND_MASK)
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_BLACK:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK)
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_RED:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK) | BACKGROUND_RED
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_GREEN:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK) | BACKGROUND_GREEN
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_YELLOW:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK) | BACKGROUND_RED | BACKGROUND_GREEN
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_BLUE:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK) | BACKGROUND_BLUE
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_MAGENTA:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK) | BACKGROUND_RED | BACKGROUND_BLUE
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_CYAN:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK) | BACKGROUND_GREEN | BACKGROUND_BLUE
|
||||||
|
|
||||||
|
case ansiterm.ANSI_SGR_BACKGROUND_WHITE:
|
||||||
|
windowsMode = (windowsMode &^ BACKGROUND_COLOR_MASK) | BACKGROUND_RED | BACKGROUND_GREEN | BACKGROUND_BLUE
|
||||||
|
}
|
||||||
|
|
||||||
|
return windowsMode, inverted
|
||||||
|
}
|
||||||
|
|
||||||
|
// invertAttributes inverts the foreground and background colors of a Windows attributes value
|
||||||
|
func invertAttributes(windowsMode uint16) uint16 {
|
||||||
|
return (COMMON_LVB_MASK & windowsMode) | ((FOREGROUND_MASK & windowsMode) << 4) | ((BACKGROUND_MASK & windowsMode) >> 4)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,101 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
const (
|
||||||
|
horizontal = iota
|
||||||
|
vertical
|
||||||
|
)
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) getCursorWindow(info *CONSOLE_SCREEN_BUFFER_INFO) SMALL_RECT {
|
||||||
|
if h.originMode {
|
||||||
|
sr := h.effectiveSr(info.Window)
|
||||||
|
return SMALL_RECT{
|
||||||
|
Top: sr.top,
|
||||||
|
Bottom: sr.bottom,
|
||||||
|
Left: 0,
|
||||||
|
Right: info.Size.X - 1,
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
return SMALL_RECT{
|
||||||
|
Top: info.Window.Top,
|
||||||
|
Bottom: info.Window.Bottom,
|
||||||
|
Left: 0,
|
||||||
|
Right: info.Size.X - 1,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// setCursorPosition sets the cursor to the specified position, bounded to the screen size
|
||||||
|
func (h *windowsAnsiEventHandler) setCursorPosition(position COORD, window SMALL_RECT) error {
|
||||||
|
position.X = ensureInRange(position.X, window.Left, window.Right)
|
||||||
|
position.Y = ensureInRange(position.Y, window.Top, window.Bottom)
|
||||||
|
err := SetConsoleCursorPosition(h.fd, position)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("Cursor position set: (%d, %d)", position.X, position.Y)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) moveCursorVertical(param int) error {
|
||||||
|
return h.moveCursor(vertical, param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) moveCursorHorizontal(param int) error {
|
||||||
|
return h.moveCursor(horizontal, param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) moveCursor(moveMode int, param int) error {
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
position := info.CursorPosition
|
||||||
|
switch moveMode {
|
||||||
|
case horizontal:
|
||||||
|
position.X += int16(param)
|
||||||
|
case vertical:
|
||||||
|
position.Y += int16(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
if err = h.setCursorPosition(position, h.getCursorWindow(info)); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) moveCursorLine(param int) error {
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
position := info.CursorPosition
|
||||||
|
position.X = 0
|
||||||
|
position.Y += int16(param)
|
||||||
|
|
||||||
|
if err = h.setCursorPosition(position, h.getCursorWindow(info)); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) moveCursorColumn(param int) error {
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
position := info.CursorPosition
|
||||||
|
position.X = int16(param) - 1
|
||||||
|
|
||||||
|
if err = h.setCursorPosition(position, h.getCursorWindow(info)); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,84 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
import "github.com/Azure/go-ansiterm"
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) clearRange(attributes uint16, fromCoord COORD, toCoord COORD) error {
|
||||||
|
// Ignore an invalid (negative area) request
|
||||||
|
if toCoord.Y < fromCoord.Y {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
var err error
|
||||||
|
|
||||||
|
var coordStart = COORD{}
|
||||||
|
var coordEnd = COORD{}
|
||||||
|
|
||||||
|
xCurrent, yCurrent := fromCoord.X, fromCoord.Y
|
||||||
|
xEnd, yEnd := toCoord.X, toCoord.Y
|
||||||
|
|
||||||
|
// Clear any partial initial line
|
||||||
|
if xCurrent > 0 {
|
||||||
|
coordStart.X, coordStart.Y = xCurrent, yCurrent
|
||||||
|
coordEnd.X, coordEnd.Y = xEnd, yCurrent
|
||||||
|
|
||||||
|
err = h.clearRect(attributes, coordStart, coordEnd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
xCurrent = 0
|
||||||
|
yCurrent += 1
|
||||||
|
}
|
||||||
|
|
||||||
|
// Clear intervening rectangular section
|
||||||
|
if yCurrent < yEnd {
|
||||||
|
coordStart.X, coordStart.Y = xCurrent, yCurrent
|
||||||
|
coordEnd.X, coordEnd.Y = xEnd, yEnd-1
|
||||||
|
|
||||||
|
err = h.clearRect(attributes, coordStart, coordEnd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
xCurrent = 0
|
||||||
|
yCurrent = yEnd
|
||||||
|
}
|
||||||
|
|
||||||
|
// Clear remaining partial ending line
|
||||||
|
coordStart.X, coordStart.Y = xCurrent, yCurrent
|
||||||
|
coordEnd.X, coordEnd.Y = xEnd, yEnd
|
||||||
|
|
||||||
|
err = h.clearRect(attributes, coordStart, coordEnd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) clearRect(attributes uint16, fromCoord COORD, toCoord COORD) error {
|
||||||
|
region := SMALL_RECT{Top: fromCoord.Y, Left: fromCoord.X, Bottom: toCoord.Y, Right: toCoord.X}
|
||||||
|
width := toCoord.X - fromCoord.X + 1
|
||||||
|
height := toCoord.Y - fromCoord.Y + 1
|
||||||
|
size := uint32(width) * uint32(height)
|
||||||
|
|
||||||
|
if size <= 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
buffer := make([]CHAR_INFO, size)
|
||||||
|
|
||||||
|
char := CHAR_INFO{ansiterm.FILL_CHARACTER, attributes}
|
||||||
|
for i := 0; i < int(size); i++ {
|
||||||
|
buffer[i] = char
|
||||||
|
}
|
||||||
|
|
||||||
|
err := WriteConsoleOutput(h.fd, buffer, COORD{X: width, Y: height}, COORD{X: 0, Y: 0}, ®ion)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,118 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
// effectiveSr gets the current effective scroll region in buffer coordinates
|
||||||
|
func (h *windowsAnsiEventHandler) effectiveSr(window SMALL_RECT) scrollRegion {
|
||||||
|
top := addInRange(window.Top, h.sr.top, window.Top, window.Bottom)
|
||||||
|
bottom := addInRange(window.Top, h.sr.bottom, window.Top, window.Bottom)
|
||||||
|
if top >= bottom {
|
||||||
|
top = window.Top
|
||||||
|
bottom = window.Bottom
|
||||||
|
}
|
||||||
|
return scrollRegion{top: top, bottom: bottom}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) scrollUp(param int) error {
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
sr := h.effectiveSr(info.Window)
|
||||||
|
return h.scroll(param, sr, info)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) scrollDown(param int) error {
|
||||||
|
return h.scrollUp(-param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) deleteLines(param int) error {
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
start := info.CursorPosition.Y
|
||||||
|
sr := h.effectiveSr(info.Window)
|
||||||
|
// Lines cannot be inserted or deleted outside the scrolling region.
|
||||||
|
if start >= sr.top && start <= sr.bottom {
|
||||||
|
sr.top = start
|
||||||
|
return h.scroll(param, sr, info)
|
||||||
|
} else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) insertLines(param int) error {
|
||||||
|
return h.deleteLines(-param)
|
||||||
|
}
|
||||||
|
|
||||||
|
// scroll scrolls the provided scroll region by param lines. The scroll region is in buffer coordinates.
|
||||||
|
func (h *windowsAnsiEventHandler) scroll(param int, sr scrollRegion, info *CONSOLE_SCREEN_BUFFER_INFO) error {
|
||||||
|
h.logf("scroll: scrollTop: %d, scrollBottom: %d", sr.top, sr.bottom)
|
||||||
|
h.logf("scroll: windowTop: %d, windowBottom: %d", info.Window.Top, info.Window.Bottom)
|
||||||
|
|
||||||
|
// Copy from and clip to the scroll region (full buffer width)
|
||||||
|
scrollRect := SMALL_RECT{
|
||||||
|
Top: sr.top,
|
||||||
|
Bottom: sr.bottom,
|
||||||
|
Left: 0,
|
||||||
|
Right: info.Size.X - 1,
|
||||||
|
}
|
||||||
|
|
||||||
|
// Origin to which area should be copied
|
||||||
|
destOrigin := COORD{
|
||||||
|
X: 0,
|
||||||
|
Y: sr.top - int16(param),
|
||||||
|
}
|
||||||
|
|
||||||
|
char := CHAR_INFO{
|
||||||
|
UnicodeChar: ' ',
|
||||||
|
Attributes: h.attributes,
|
||||||
|
}
|
||||||
|
|
||||||
|
if err := ScrollConsoleScreenBuffer(h.fd, scrollRect, scrollRect, destOrigin, char); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) deleteCharacters(param int) error {
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return h.scrollLine(param, info.CursorPosition, info)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) insertCharacters(param int) error {
|
||||||
|
return h.deleteCharacters(-param)
|
||||||
|
}
|
||||||
|
|
||||||
|
// scrollLine scrolls a line horizontally starting at the provided position by a number of columns.
|
||||||
|
func (h *windowsAnsiEventHandler) scrollLine(columns int, position COORD, info *CONSOLE_SCREEN_BUFFER_INFO) error {
|
||||||
|
// Copy from and clip to the scroll region (full buffer width)
|
||||||
|
scrollRect := SMALL_RECT{
|
||||||
|
Top: position.Y,
|
||||||
|
Bottom: position.Y,
|
||||||
|
Left: position.X,
|
||||||
|
Right: info.Size.X - 1,
|
||||||
|
}
|
||||||
|
|
||||||
|
// Origin to which area should be copied
|
||||||
|
destOrigin := COORD{
|
||||||
|
X: position.X - int16(columns),
|
||||||
|
Y: position.Y,
|
||||||
|
}
|
||||||
|
|
||||||
|
char := CHAR_INFO{
|
||||||
|
UnicodeChar: ' ',
|
||||||
|
Attributes: h.attributes,
|
||||||
|
}
|
||||||
|
|
||||||
|
if err := ScrollConsoleScreenBuffer(h.fd, scrollRect, scrollRect, destOrigin, char); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,9 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
// AddInRange increments a value by the passed quantity while ensuring the values
|
||||||
|
// always remain within the supplied min / max range.
|
||||||
|
func addInRange(n int16, increment int16, min int16, max int16) int16 {
|
||||||
|
return ensureInRange(n+increment, min, max)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,743 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winterm
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"log"
|
||||||
|
"os"
|
||||||
|
"strconv"
|
||||||
|
|
||||||
|
"github.com/Azure/go-ansiterm"
|
||||||
|
)
|
||||||
|
|
||||||
|
type windowsAnsiEventHandler struct {
|
||||||
|
fd uintptr
|
||||||
|
file *os.File
|
||||||
|
infoReset *CONSOLE_SCREEN_BUFFER_INFO
|
||||||
|
sr scrollRegion
|
||||||
|
buffer bytes.Buffer
|
||||||
|
attributes uint16
|
||||||
|
inverted bool
|
||||||
|
wrapNext bool
|
||||||
|
drewMarginByte bool
|
||||||
|
originMode bool
|
||||||
|
marginByte byte
|
||||||
|
curInfo *CONSOLE_SCREEN_BUFFER_INFO
|
||||||
|
curPos COORD
|
||||||
|
logf func(string, ...interface{})
|
||||||
|
}
|
||||||
|
|
||||||
|
type Option func(*windowsAnsiEventHandler)
|
||||||
|
|
||||||
|
func WithLogf(f func(string, ...interface{})) Option {
|
||||||
|
return func(w *windowsAnsiEventHandler) {
|
||||||
|
w.logf = f
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func CreateWinEventHandler(fd uintptr, file *os.File, opts ...Option) ansiterm.AnsiEventHandler {
|
||||||
|
infoReset, err := GetConsoleScreenBufferInfo(fd)
|
||||||
|
if err != nil {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
h := &windowsAnsiEventHandler{
|
||||||
|
fd: fd,
|
||||||
|
file: file,
|
||||||
|
infoReset: infoReset,
|
||||||
|
attributes: infoReset.Attributes,
|
||||||
|
}
|
||||||
|
for _, o := range opts {
|
||||||
|
o(h)
|
||||||
|
}
|
||||||
|
|
||||||
|
if isDebugEnv := os.Getenv(ansiterm.LogEnv); isDebugEnv == "1" {
|
||||||
|
logFile, _ := os.Create("winEventHandler.log")
|
||||||
|
logger := log.New(logFile, "", log.LstdFlags)
|
||||||
|
if h.logf != nil {
|
||||||
|
l := h.logf
|
||||||
|
h.logf = func(s string, v ...interface{}) {
|
||||||
|
l(s, v...)
|
||||||
|
logger.Printf(s, v...)
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
h.logf = logger.Printf
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if h.logf == nil {
|
||||||
|
h.logf = func(string, ...interface{}) {}
|
||||||
|
}
|
||||||
|
|
||||||
|
return h
|
||||||
|
}
|
||||||
|
|
||||||
|
type scrollRegion struct {
|
||||||
|
top int16
|
||||||
|
bottom int16
|
||||||
|
}
|
||||||
|
|
||||||
|
// simulateLF simulates a LF or CR+LF by scrolling if necessary to handle the
|
||||||
|
// current cursor position and scroll region settings, in which case it returns
|
||||||
|
// true. If no special handling is necessary, then it does nothing and returns
|
||||||
|
// false.
|
||||||
|
//
|
||||||
|
// In the false case, the caller should ensure that a carriage return
|
||||||
|
// and line feed are inserted or that the text is otherwise wrapped.
|
||||||
|
func (h *windowsAnsiEventHandler) simulateLF(includeCR bool) (bool, error) {
|
||||||
|
if h.wrapNext {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
h.clearWrap()
|
||||||
|
}
|
||||||
|
pos, info, err := h.getCurrentInfo()
|
||||||
|
if err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
sr := h.effectiveSr(info.Window)
|
||||||
|
if pos.Y == sr.bottom {
|
||||||
|
// Scrolling is necessary. Let Windows automatically scroll if the scrolling region
|
||||||
|
// is the full window.
|
||||||
|
if sr.top == info.Window.Top && sr.bottom == info.Window.Bottom {
|
||||||
|
if includeCR {
|
||||||
|
pos.X = 0
|
||||||
|
h.updatePos(pos)
|
||||||
|
}
|
||||||
|
return false, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// A custom scroll region is active. Scroll the window manually to simulate
|
||||||
|
// the LF.
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
h.logf("Simulating LF inside scroll region")
|
||||||
|
if err := h.scrollUp(1); err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
if includeCR {
|
||||||
|
pos.X = 0
|
||||||
|
if err := SetConsoleCursorPosition(h.fd, pos); err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true, nil
|
||||||
|
|
||||||
|
} else if pos.Y < info.Window.Bottom {
|
||||||
|
// Let Windows handle the LF.
|
||||||
|
pos.Y++
|
||||||
|
if includeCR {
|
||||||
|
pos.X = 0
|
||||||
|
}
|
||||||
|
h.updatePos(pos)
|
||||||
|
return false, nil
|
||||||
|
} else {
|
||||||
|
// The cursor is at the bottom of the screen but outside the scroll
|
||||||
|
// region. Skip the LF.
|
||||||
|
h.logf("Simulating LF outside scroll region")
|
||||||
|
if includeCR {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
pos.X = 0
|
||||||
|
if err := SetConsoleCursorPosition(h.fd, pos); err != nil {
|
||||||
|
return false, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return true, nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// executeLF executes a LF without a CR.
|
||||||
|
func (h *windowsAnsiEventHandler) executeLF() error {
|
||||||
|
handled, err := h.simulateLF(false)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if !handled {
|
||||||
|
// Windows LF will reset the cursor column position. Write the LF
|
||||||
|
// and restore the cursor position.
|
||||||
|
pos, _, err := h.getCurrentInfo()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.buffer.WriteByte(ansiterm.ANSI_LINE_FEED)
|
||||||
|
if pos.X != 0 {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("Resetting cursor position for LF without CR")
|
||||||
|
if err := SetConsoleCursorPosition(h.fd, pos); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) Print(b byte) error {
|
||||||
|
if h.wrapNext {
|
||||||
|
h.buffer.WriteByte(h.marginByte)
|
||||||
|
h.clearWrap()
|
||||||
|
if _, err := h.simulateLF(true); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
pos, info, err := h.getCurrentInfo()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if pos.X == info.Size.X-1 {
|
||||||
|
h.wrapNext = true
|
||||||
|
h.marginByte = b
|
||||||
|
} else {
|
||||||
|
pos.X++
|
||||||
|
h.updatePos(pos)
|
||||||
|
h.buffer.WriteByte(b)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) Execute(b byte) error {
|
||||||
|
switch b {
|
||||||
|
case ansiterm.ANSI_TAB:
|
||||||
|
h.logf("Execute(TAB)")
|
||||||
|
// Move to the next tab stop, but preserve auto-wrap if already set.
|
||||||
|
if !h.wrapNext {
|
||||||
|
pos, info, err := h.getCurrentInfo()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
pos.X = (pos.X + 8) - pos.X%8
|
||||||
|
if pos.X >= info.Size.X {
|
||||||
|
pos.X = info.Size.X - 1
|
||||||
|
}
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if err := SetConsoleCursorPosition(h.fd, pos); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
|
||||||
|
case ansiterm.ANSI_BEL:
|
||||||
|
h.buffer.WriteByte(ansiterm.ANSI_BEL)
|
||||||
|
return nil
|
||||||
|
|
||||||
|
case ansiterm.ANSI_BACKSPACE:
|
||||||
|
if h.wrapNext {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.clearWrap()
|
||||||
|
}
|
||||||
|
pos, _, err := h.getCurrentInfo()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if pos.X > 0 {
|
||||||
|
pos.X--
|
||||||
|
h.updatePos(pos)
|
||||||
|
h.buffer.WriteByte(ansiterm.ANSI_BACKSPACE)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
|
||||||
|
case ansiterm.ANSI_VERTICAL_TAB, ansiterm.ANSI_FORM_FEED:
|
||||||
|
// Treat as true LF.
|
||||||
|
return h.executeLF()
|
||||||
|
|
||||||
|
case ansiterm.ANSI_LINE_FEED:
|
||||||
|
// Simulate a CR and LF for now since there is no way in go-ansiterm
|
||||||
|
// to tell if the LF should include CR (and more things break when it's
|
||||||
|
// missing than when it's incorrectly added).
|
||||||
|
handled, err := h.simulateLF(true)
|
||||||
|
if handled || err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return h.buffer.WriteByte(ansiterm.ANSI_LINE_FEED)
|
||||||
|
|
||||||
|
case ansiterm.ANSI_CARRIAGE_RETURN:
|
||||||
|
if h.wrapNext {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.clearWrap()
|
||||||
|
}
|
||||||
|
pos, _, err := h.getCurrentInfo()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if pos.X != 0 {
|
||||||
|
pos.X = 0
|
||||||
|
h.updatePos(pos)
|
||||||
|
h.buffer.WriteByte(ansiterm.ANSI_CARRIAGE_RETURN)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
|
||||||
|
default:
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CUU(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CUU: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.moveCursorVertical(-param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CUD(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CUD: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.moveCursorVertical(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CUF(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CUF: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.moveCursorHorizontal(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CUB(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CUB: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.moveCursorHorizontal(-param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CNL(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CNL: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.moveCursorLine(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CPL(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CPL: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.moveCursorLine(-param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CHA(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CHA: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.moveCursorColumn(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) VPA(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("VPA: [[%d]]", param)
|
||||||
|
h.clearWrap()
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
window := h.getCursorWindow(info)
|
||||||
|
position := info.CursorPosition
|
||||||
|
position.Y = window.Top + int16(param) - 1
|
||||||
|
return h.setCursorPosition(position, window)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) CUP(row int, col int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("CUP: [[%d %d]]", row, col)
|
||||||
|
h.clearWrap()
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
window := h.getCursorWindow(info)
|
||||||
|
position := COORD{window.Left + int16(col) - 1, window.Top + int16(row) - 1}
|
||||||
|
return h.setCursorPosition(position, window)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) HVP(row int, col int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("HVP: [[%d %d]]", row, col)
|
||||||
|
h.clearWrap()
|
||||||
|
return h.CUP(row, col)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) DECTCEM(visible bool) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("DECTCEM: [%v]", []string{strconv.FormatBool(visible)})
|
||||||
|
h.clearWrap()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) DECOM(enable bool) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("DECOM: [%v]", []string{strconv.FormatBool(enable)})
|
||||||
|
h.clearWrap()
|
||||||
|
h.originMode = enable
|
||||||
|
return h.CUP(1, 1)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) DECCOLM(use132 bool) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("DECCOLM: [%v]", []string{strconv.FormatBool(use132)})
|
||||||
|
h.clearWrap()
|
||||||
|
if err := h.ED(2); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
targetWidth := int16(80)
|
||||||
|
if use132 {
|
||||||
|
targetWidth = 132
|
||||||
|
}
|
||||||
|
if info.Size.X < targetWidth {
|
||||||
|
if err := SetConsoleScreenBufferSize(h.fd, COORD{targetWidth, info.Size.Y}); err != nil {
|
||||||
|
h.logf("set buffer failed: %v", err)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
window := info.Window
|
||||||
|
window.Left = 0
|
||||||
|
window.Right = targetWidth - 1
|
||||||
|
if err := SetConsoleWindowInfo(h.fd, true, window); err != nil {
|
||||||
|
h.logf("set window failed: %v", err)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if info.Size.X > targetWidth {
|
||||||
|
if err := SetConsoleScreenBufferSize(h.fd, COORD{targetWidth, info.Size.Y}); err != nil {
|
||||||
|
h.logf("set buffer failed: %v", err)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return SetConsoleCursorPosition(h.fd, COORD{0, 0})
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) ED(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("ED: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
|
||||||
|
// [J -- Erases from the cursor to the end of the screen, including the cursor position.
|
||||||
|
// [1J -- Erases from the beginning of the screen to the cursor, including the cursor position.
|
||||||
|
// [2J -- Erases the complete display. The cursor does not move.
|
||||||
|
// Notes:
|
||||||
|
// -- Clearing the entire buffer, versus just the Window, works best for Windows Consoles
|
||||||
|
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
var start COORD
|
||||||
|
var end COORD
|
||||||
|
|
||||||
|
switch param {
|
||||||
|
case 0:
|
||||||
|
start = info.CursorPosition
|
||||||
|
end = COORD{info.Size.X - 1, info.Size.Y - 1}
|
||||||
|
|
||||||
|
case 1:
|
||||||
|
start = COORD{0, 0}
|
||||||
|
end = info.CursorPosition
|
||||||
|
|
||||||
|
case 2:
|
||||||
|
start = COORD{0, 0}
|
||||||
|
end = COORD{info.Size.X - 1, info.Size.Y - 1}
|
||||||
|
}
|
||||||
|
|
||||||
|
err = h.clearRange(h.attributes, start, end)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// If the whole buffer was cleared, move the window to the top while preserving
|
||||||
|
// the window-relative cursor position.
|
||||||
|
if param == 2 {
|
||||||
|
pos := info.CursorPosition
|
||||||
|
window := info.Window
|
||||||
|
pos.Y -= window.Top
|
||||||
|
window.Bottom -= window.Top
|
||||||
|
window.Top = 0
|
||||||
|
if err := SetConsoleCursorPosition(h.fd, pos); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if err := SetConsoleWindowInfo(h.fd, true, window); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) EL(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("EL: [%v]", strconv.Itoa(param))
|
||||||
|
h.clearWrap()
|
||||||
|
|
||||||
|
// [K -- Erases from the cursor to the end of the line, including the cursor position.
|
||||||
|
// [1K -- Erases from the beginning of the line to the cursor, including the cursor position.
|
||||||
|
// [2K -- Erases the complete line.
|
||||||
|
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
var start COORD
|
||||||
|
var end COORD
|
||||||
|
|
||||||
|
switch param {
|
||||||
|
case 0:
|
||||||
|
start = info.CursorPosition
|
||||||
|
end = COORD{info.Size.X, info.CursorPosition.Y}
|
||||||
|
|
||||||
|
case 1:
|
||||||
|
start = COORD{0, info.CursorPosition.Y}
|
||||||
|
end = info.CursorPosition
|
||||||
|
|
||||||
|
case 2:
|
||||||
|
start = COORD{0, info.CursorPosition.Y}
|
||||||
|
end = COORD{info.Size.X, info.CursorPosition.Y}
|
||||||
|
}
|
||||||
|
|
||||||
|
err = h.clearRange(h.attributes, start, end)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) IL(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("IL: [%v]", strconv.Itoa(param))
|
||||||
|
h.clearWrap()
|
||||||
|
return h.insertLines(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) DL(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("DL: [%v]", strconv.Itoa(param))
|
||||||
|
h.clearWrap()
|
||||||
|
return h.deleteLines(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) ICH(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("ICH: [%v]", strconv.Itoa(param))
|
||||||
|
h.clearWrap()
|
||||||
|
return h.insertCharacters(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) DCH(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("DCH: [%v]", strconv.Itoa(param))
|
||||||
|
h.clearWrap()
|
||||||
|
return h.deleteCharacters(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) SGR(params []int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
strings := []string{}
|
||||||
|
for _, v := range params {
|
||||||
|
strings = append(strings, strconv.Itoa(v))
|
||||||
|
}
|
||||||
|
|
||||||
|
h.logf("SGR: [%v]", strings)
|
||||||
|
|
||||||
|
if len(params) <= 0 {
|
||||||
|
h.attributes = h.infoReset.Attributes
|
||||||
|
h.inverted = false
|
||||||
|
} else {
|
||||||
|
for _, attr := range params {
|
||||||
|
|
||||||
|
if attr == ansiterm.ANSI_SGR_RESET {
|
||||||
|
h.attributes = h.infoReset.Attributes
|
||||||
|
h.inverted = false
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
|
||||||
|
h.attributes, h.inverted = collectAnsiIntoWindowsAttributes(h.attributes, h.inverted, h.infoReset.Attributes, int16(attr))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
attributes := h.attributes
|
||||||
|
if h.inverted {
|
||||||
|
attributes = invertAttributes(attributes)
|
||||||
|
}
|
||||||
|
err := SetConsoleTextAttribute(h.fd, attributes)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) SU(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("SU: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.scrollUp(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) SD(param int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("SD: [%v]", []string{strconv.Itoa(param)})
|
||||||
|
h.clearWrap()
|
||||||
|
return h.scrollDown(param)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) DA(params []string) error {
|
||||||
|
h.logf("DA: [%v]", params)
|
||||||
|
// DA cannot be implemented because it must send data on the VT100 input stream,
|
||||||
|
// which is not available to go-ansiterm.
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) DECSTBM(top int, bottom int) error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("DECSTBM: [%d, %d]", top, bottom)
|
||||||
|
|
||||||
|
// Windows is 0 indexed, Linux is 1 indexed
|
||||||
|
h.sr.top = int16(top - 1)
|
||||||
|
h.sr.bottom = int16(bottom - 1)
|
||||||
|
|
||||||
|
// This command also moves the cursor to the origin.
|
||||||
|
h.clearWrap()
|
||||||
|
return h.CUP(1, 1)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) RI() error {
|
||||||
|
if err := h.Flush(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.logf("RI: []")
|
||||||
|
h.clearWrap()
|
||||||
|
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
sr := h.effectiveSr(info.Window)
|
||||||
|
if info.CursorPosition.Y == sr.top {
|
||||||
|
return h.scrollDown(1)
|
||||||
|
}
|
||||||
|
|
||||||
|
return h.moveCursorVertical(-1)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) IND() error {
|
||||||
|
h.logf("IND: []")
|
||||||
|
return h.executeLF()
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) Flush() error {
|
||||||
|
h.curInfo = nil
|
||||||
|
if h.buffer.Len() > 0 {
|
||||||
|
h.logf("Flush: [%s]", h.buffer.Bytes())
|
||||||
|
if _, err := h.buffer.WriteTo(h.file); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if h.wrapNext && !h.drewMarginByte {
|
||||||
|
h.logf("Flush: drawing margin byte '%c'", h.marginByte)
|
||||||
|
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
charInfo := []CHAR_INFO{{UnicodeChar: uint16(h.marginByte), Attributes: info.Attributes}}
|
||||||
|
size := COORD{1, 1}
|
||||||
|
position := COORD{0, 0}
|
||||||
|
region := SMALL_RECT{Left: info.CursorPosition.X, Top: info.CursorPosition.Y, Right: info.CursorPosition.X, Bottom: info.CursorPosition.Y}
|
||||||
|
if err := WriteConsoleOutput(h.fd, charInfo, size, position, ®ion); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
h.drewMarginByte = true
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// cacheConsoleInfo ensures that the current console screen information has been queried
|
||||||
|
// since the last call to Flush(). It must be called before accessing h.curInfo or h.curPos.
|
||||||
|
func (h *windowsAnsiEventHandler) getCurrentInfo() (COORD, *CONSOLE_SCREEN_BUFFER_INFO, error) {
|
||||||
|
if h.curInfo == nil {
|
||||||
|
info, err := GetConsoleScreenBufferInfo(h.fd)
|
||||||
|
if err != nil {
|
||||||
|
return COORD{}, nil, err
|
||||||
|
}
|
||||||
|
h.curInfo = info
|
||||||
|
h.curPos = info.CursorPosition
|
||||||
|
}
|
||||||
|
return h.curPos, h.curInfo, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (h *windowsAnsiEventHandler) updatePos(pos COORD) {
|
||||||
|
if h.curInfo == nil {
|
||||||
|
panic("failed to call getCurrentInfo before calling updatePos")
|
||||||
|
}
|
||||||
|
h.curPos = pos
|
||||||
|
}
|
||||||
|
|
||||||
|
// clearWrap clears the state where the cursor is in the margin
|
||||||
|
// waiting for the next character before wrapping the line. This must
|
||||||
|
// be done before most operations that act on the cursor.
|
||||||
|
func (h *windowsAnsiEventHandler) clearWrap() {
|
||||||
|
h.wrapNext = false
|
||||||
|
h.drewMarginByte = false
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1 @@
|
||||||
|
*.exe
|
||||||
|
|
@ -0,0 +1,22 @@
|
||||||
|
The MIT License (MIT)
|
||||||
|
|
||||||
|
Copyright (c) 2015 Microsoft
|
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
|
in the Software without restriction, including without limitation the rights
|
||||||
|
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||||
|
copies of the Software, and to permit persons to whom the Software is
|
||||||
|
furnished to do so, subject to the following conditions:
|
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be included in all
|
||||||
|
copies or substantial portions of the Software.
|
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||||
|
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||||
|
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||||
|
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||||
|
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||||
|
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||||
|
SOFTWARE.
|
||||||
|
|
||||||
|
|
@ -0,0 +1,22 @@
|
||||||
|
# go-winio
|
||||||
|
|
||||||
|
This repository contains utilities for efficiently performing Win32 IO operations in
|
||||||
|
Go. Currently, this is focused on accessing named pipes and other file handles, and
|
||||||
|
for using named pipes as a net transport.
|
||||||
|
|
||||||
|
This code relies on IO completion ports to avoid blocking IO on system threads, allowing Go
|
||||||
|
to reuse the thread to schedule another goroutine. This limits support to Windows Vista and
|
||||||
|
newer operating systems. This is similar to the implementation of network sockets in Go's net
|
||||||
|
package.
|
||||||
|
|
||||||
|
Please see the LICENSE file for licensing information.
|
||||||
|
|
||||||
|
This project has adopted the [Microsoft Open Source Code of
|
||||||
|
Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
|
||||||
|
see the [Code of Conduct
|
||||||
|
FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
|
||||||
|
[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
|
||||||
|
questions or comments.
|
||||||
|
|
||||||
|
Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe
|
||||||
|
for another named pipe implementation.
|
||||||
|
|
@ -0,0 +1,280 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/binary"
|
||||||
|
"errors"
|
||||||
|
"fmt"
|
||||||
|
"io"
|
||||||
|
"io/ioutil"
|
||||||
|
"os"
|
||||||
|
"runtime"
|
||||||
|
"syscall"
|
||||||
|
"unicode/utf16"
|
||||||
|
)
|
||||||
|
|
||||||
|
//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead
|
||||||
|
//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite
|
||||||
|
|
||||||
|
const (
|
||||||
|
BackupData = uint32(iota + 1)
|
||||||
|
BackupEaData
|
||||||
|
BackupSecurity
|
||||||
|
BackupAlternateData
|
||||||
|
BackupLink
|
||||||
|
BackupPropertyData
|
||||||
|
BackupObjectId
|
||||||
|
BackupReparseData
|
||||||
|
BackupSparseBlock
|
||||||
|
BackupTxfsData
|
||||||
|
)
|
||||||
|
|
||||||
|
const (
|
||||||
|
StreamSparseAttributes = uint32(8)
|
||||||
|
)
|
||||||
|
|
||||||
|
const (
|
||||||
|
WRITE_DAC = 0x40000
|
||||||
|
WRITE_OWNER = 0x80000
|
||||||
|
ACCESS_SYSTEM_SECURITY = 0x1000000
|
||||||
|
)
|
||||||
|
|
||||||
|
// BackupHeader represents a backup stream of a file.
|
||||||
|
type BackupHeader struct {
|
||||||
|
Id uint32 // The backup stream ID
|
||||||
|
Attributes uint32 // Stream attributes
|
||||||
|
Size int64 // The size of the stream in bytes
|
||||||
|
Name string // The name of the stream (for BackupAlternateData only).
|
||||||
|
Offset int64 // The offset of the stream in the file (for BackupSparseBlock only).
|
||||||
|
}
|
||||||
|
|
||||||
|
type win32StreamId struct {
|
||||||
|
StreamId uint32
|
||||||
|
Attributes uint32
|
||||||
|
Size uint64
|
||||||
|
NameSize uint32
|
||||||
|
}
|
||||||
|
|
||||||
|
// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series
|
||||||
|
// of BackupHeader values.
|
||||||
|
type BackupStreamReader struct {
|
||||||
|
r io.Reader
|
||||||
|
bytesLeft int64
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewBackupStreamReader produces a BackupStreamReader from any io.Reader.
|
||||||
|
func NewBackupStreamReader(r io.Reader) *BackupStreamReader {
|
||||||
|
return &BackupStreamReader{r, 0}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if
|
||||||
|
// it was not completely read.
|
||||||
|
func (r *BackupStreamReader) Next() (*BackupHeader, error) {
|
||||||
|
if r.bytesLeft > 0 {
|
||||||
|
if s, ok := r.r.(io.Seeker); ok {
|
||||||
|
// Make sure Seek on io.SeekCurrent sometimes succeeds
|
||||||
|
// before trying the actual seek.
|
||||||
|
if _, err := s.Seek(0, io.SeekCurrent); err == nil {
|
||||||
|
if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
r.bytesLeft = 0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if _, err := io.Copy(ioutil.Discard, r); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
var wsi win32StreamId
|
||||||
|
if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
hdr := &BackupHeader{
|
||||||
|
Id: wsi.StreamId,
|
||||||
|
Attributes: wsi.Attributes,
|
||||||
|
Size: int64(wsi.Size),
|
||||||
|
}
|
||||||
|
if wsi.NameSize != 0 {
|
||||||
|
name := make([]uint16, int(wsi.NameSize/2))
|
||||||
|
if err := binary.Read(r.r, binary.LittleEndian, name); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
hdr.Name = syscall.UTF16ToString(name)
|
||||||
|
}
|
||||||
|
if wsi.StreamId == BackupSparseBlock {
|
||||||
|
if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
hdr.Size -= 8
|
||||||
|
}
|
||||||
|
r.bytesLeft = hdr.Size
|
||||||
|
return hdr, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Read reads from the current backup stream.
|
||||||
|
func (r *BackupStreamReader) Read(b []byte) (int, error) {
|
||||||
|
if r.bytesLeft == 0 {
|
||||||
|
return 0, io.EOF
|
||||||
|
}
|
||||||
|
if int64(len(b)) > r.bytesLeft {
|
||||||
|
b = b[:r.bytesLeft]
|
||||||
|
}
|
||||||
|
n, err := r.r.Read(b)
|
||||||
|
r.bytesLeft -= int64(n)
|
||||||
|
if err == io.EOF {
|
||||||
|
err = io.ErrUnexpectedEOF
|
||||||
|
} else if r.bytesLeft == 0 && err == nil {
|
||||||
|
err = io.EOF
|
||||||
|
}
|
||||||
|
return n, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API.
|
||||||
|
type BackupStreamWriter struct {
|
||||||
|
w io.Writer
|
||||||
|
bytesLeft int64
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer.
|
||||||
|
func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter {
|
||||||
|
return &BackupStreamWriter{w, 0}
|
||||||
|
}
|
||||||
|
|
||||||
|
// WriteHeader writes the next backup stream header and prepares for calls to Write().
|
||||||
|
func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error {
|
||||||
|
if w.bytesLeft != 0 {
|
||||||
|
return fmt.Errorf("missing %d bytes", w.bytesLeft)
|
||||||
|
}
|
||||||
|
name := utf16.Encode([]rune(hdr.Name))
|
||||||
|
wsi := win32StreamId{
|
||||||
|
StreamId: hdr.Id,
|
||||||
|
Attributes: hdr.Attributes,
|
||||||
|
Size: uint64(hdr.Size),
|
||||||
|
NameSize: uint32(len(name) * 2),
|
||||||
|
}
|
||||||
|
if hdr.Id == BackupSparseBlock {
|
||||||
|
// Include space for the int64 block offset
|
||||||
|
wsi.Size += 8
|
||||||
|
}
|
||||||
|
if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if len(name) != 0 {
|
||||||
|
if err := binary.Write(w.w, binary.LittleEndian, name); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if hdr.Id == BackupSparseBlock {
|
||||||
|
if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
w.bytesLeft = hdr.Size
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Write writes to the current backup stream.
|
||||||
|
func (w *BackupStreamWriter) Write(b []byte) (int, error) {
|
||||||
|
if w.bytesLeft < int64(len(b)) {
|
||||||
|
return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft)
|
||||||
|
}
|
||||||
|
n, err := w.w.Write(b)
|
||||||
|
w.bytesLeft -= int64(n)
|
||||||
|
return n, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API.
|
||||||
|
type BackupFileReader struct {
|
||||||
|
f *os.File
|
||||||
|
includeSecurity bool
|
||||||
|
ctx uintptr
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true,
|
||||||
|
// Read will attempt to read the security descriptor of the file.
|
||||||
|
func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader {
|
||||||
|
r := &BackupFileReader{f, includeSecurity, 0}
|
||||||
|
return r
|
||||||
|
}
|
||||||
|
|
||||||
|
// Read reads a backup stream from the file by calling the Win32 API BackupRead().
|
||||||
|
func (r *BackupFileReader) Read(b []byte) (int, error) {
|
||||||
|
var bytesRead uint32
|
||||||
|
err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx)
|
||||||
|
if err != nil {
|
||||||
|
return 0, &os.PathError{"BackupRead", r.f.Name(), err}
|
||||||
|
}
|
||||||
|
runtime.KeepAlive(r.f)
|
||||||
|
if bytesRead == 0 {
|
||||||
|
return 0, io.EOF
|
||||||
|
}
|
||||||
|
return int(bytesRead), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Close frees Win32 resources associated with the BackupFileReader. It does not close
|
||||||
|
// the underlying file.
|
||||||
|
func (r *BackupFileReader) Close() error {
|
||||||
|
if r.ctx != 0 {
|
||||||
|
backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx)
|
||||||
|
runtime.KeepAlive(r.f)
|
||||||
|
r.ctx = 0
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API.
|
||||||
|
type BackupFileWriter struct {
|
||||||
|
f *os.File
|
||||||
|
includeSecurity bool
|
||||||
|
ctx uintptr
|
||||||
|
}
|
||||||
|
|
||||||
|
// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true,
|
||||||
|
// Write() will attempt to restore the security descriptor from the stream.
|
||||||
|
func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter {
|
||||||
|
w := &BackupFileWriter{f, includeSecurity, 0}
|
||||||
|
return w
|
||||||
|
}
|
||||||
|
|
||||||
|
// Write restores a portion of the file using the provided backup stream.
|
||||||
|
func (w *BackupFileWriter) Write(b []byte) (int, error) {
|
||||||
|
var bytesWritten uint32
|
||||||
|
err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx)
|
||||||
|
if err != nil {
|
||||||
|
return 0, &os.PathError{"BackupWrite", w.f.Name(), err}
|
||||||
|
}
|
||||||
|
runtime.KeepAlive(w.f)
|
||||||
|
if int(bytesWritten) != len(b) {
|
||||||
|
return int(bytesWritten), errors.New("not all bytes could be written")
|
||||||
|
}
|
||||||
|
return len(b), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Close frees Win32 resources associated with the BackupFileWriter. It does not
|
||||||
|
// close the underlying file.
|
||||||
|
func (w *BackupFileWriter) Close() error {
|
||||||
|
if w.ctx != 0 {
|
||||||
|
backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx)
|
||||||
|
runtime.KeepAlive(w.f)
|
||||||
|
w.ctx = 0
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// OpenForBackup opens a file or directory, potentially skipping access checks if the backup
|
||||||
|
// or restore privileges have been acquired.
|
||||||
|
//
|
||||||
|
// If the file opened was a directory, it cannot be used with Readdir().
|
||||||
|
func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) {
|
||||||
|
winPath, err := syscall.UTF16FromString(path)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0)
|
||||||
|
if err != nil {
|
||||||
|
err = &os.PathError{Op: "open", Path: path, Err: err}
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return os.NewFile(uintptr(h), path), nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,137 @@
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"encoding/binary"
|
||||||
|
"errors"
|
||||||
|
)
|
||||||
|
|
||||||
|
type fileFullEaInformation struct {
|
||||||
|
NextEntryOffset uint32
|
||||||
|
Flags uint8
|
||||||
|
NameLength uint8
|
||||||
|
ValueLength uint16
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
|
||||||
|
|
||||||
|
errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
|
||||||
|
errEaNameTooLarge = errors.New("extended attribute name too large")
|
||||||
|
errEaValueTooLarge = errors.New("extended attribute value too large")
|
||||||
|
)
|
||||||
|
|
||||||
|
// ExtendedAttribute represents a single Windows EA.
|
||||||
|
type ExtendedAttribute struct {
|
||||||
|
Name string
|
||||||
|
Value []byte
|
||||||
|
Flags uint8
|
||||||
|
}
|
||||||
|
|
||||||
|
func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
|
||||||
|
var info fileFullEaInformation
|
||||||
|
err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
|
||||||
|
if err != nil {
|
||||||
|
err = errInvalidEaBuffer
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
nameOffset := fileFullEaInformationSize
|
||||||
|
nameLen := int(info.NameLength)
|
||||||
|
valueOffset := nameOffset + int(info.NameLength) + 1
|
||||||
|
valueLen := int(info.ValueLength)
|
||||||
|
nextOffset := int(info.NextEntryOffset)
|
||||||
|
if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
|
||||||
|
err = errInvalidEaBuffer
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
ea.Name = string(b[nameOffset : nameOffset+nameLen])
|
||||||
|
ea.Value = b[valueOffset : valueOffset+valueLen]
|
||||||
|
ea.Flags = info.Flags
|
||||||
|
if info.NextEntryOffset != 0 {
|
||||||
|
nb = b[info.NextEntryOffset:]
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
|
||||||
|
// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
|
||||||
|
func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
|
||||||
|
for len(b) != 0 {
|
||||||
|
ea, nb, err := parseEa(b)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
eas = append(eas, ea)
|
||||||
|
b = nb
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
|
||||||
|
if int(uint8(len(ea.Name))) != len(ea.Name) {
|
||||||
|
return errEaNameTooLarge
|
||||||
|
}
|
||||||
|
if int(uint16(len(ea.Value))) != len(ea.Value) {
|
||||||
|
return errEaValueTooLarge
|
||||||
|
}
|
||||||
|
entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
|
||||||
|
withPadding := (entrySize + 3) &^ 3
|
||||||
|
nextOffset := uint32(0)
|
||||||
|
if !last {
|
||||||
|
nextOffset = withPadding
|
||||||
|
}
|
||||||
|
info := fileFullEaInformation{
|
||||||
|
NextEntryOffset: nextOffset,
|
||||||
|
Flags: ea.Flags,
|
||||||
|
NameLength: uint8(len(ea.Name)),
|
||||||
|
ValueLength: uint16(len(ea.Value)),
|
||||||
|
}
|
||||||
|
|
||||||
|
err := binary.Write(buf, binary.LittleEndian, &info)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = buf.Write([]byte(ea.Name))
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
err = buf.WriteByte(0)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = buf.Write(ea.Value)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
|
||||||
|
// buffer for use with BackupWrite, ZwSetEaFile, etc.
|
||||||
|
func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
|
||||||
|
var buf bytes.Buffer
|
||||||
|
for i := range eas {
|
||||||
|
last := false
|
||||||
|
if i == len(eas)-1 {
|
||||||
|
last = true
|
||||||
|
}
|
||||||
|
|
||||||
|
err := writeEa(&buf, &eas[i], last)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return buf.Bytes(), nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,307 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"errors"
|
||||||
|
"io"
|
||||||
|
"runtime"
|
||||||
|
"sync"
|
||||||
|
"sync/atomic"
|
||||||
|
"syscall"
|
||||||
|
"time"
|
||||||
|
)
|
||||||
|
|
||||||
|
//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx
|
||||||
|
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
|
||||||
|
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
|
||||||
|
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
|
||||||
|
|
||||||
|
type atomicBool int32
|
||||||
|
|
||||||
|
func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 }
|
||||||
|
func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) }
|
||||||
|
func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) }
|
||||||
|
func (b *atomicBool) swap(new bool) bool {
|
||||||
|
var newInt int32
|
||||||
|
if new {
|
||||||
|
newInt = 1
|
||||||
|
}
|
||||||
|
return atomic.SwapInt32((*int32)(b), newInt) == 1
|
||||||
|
}
|
||||||
|
|
||||||
|
const (
|
||||||
|
cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1
|
||||||
|
cFILE_SKIP_SET_EVENT_ON_HANDLE = 2
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
ErrFileClosed = errors.New("file has already been closed")
|
||||||
|
ErrTimeout = &timeoutError{}
|
||||||
|
)
|
||||||
|
|
||||||
|
type timeoutError struct{}
|
||||||
|
|
||||||
|
func (e *timeoutError) Error() string { return "i/o timeout" }
|
||||||
|
func (e *timeoutError) Timeout() bool { return true }
|
||||||
|
func (e *timeoutError) Temporary() bool { return true }
|
||||||
|
|
||||||
|
type timeoutChan chan struct{}
|
||||||
|
|
||||||
|
var ioInitOnce sync.Once
|
||||||
|
var ioCompletionPort syscall.Handle
|
||||||
|
|
||||||
|
// ioResult contains the result of an asynchronous IO operation
|
||||||
|
type ioResult struct {
|
||||||
|
bytes uint32
|
||||||
|
err error
|
||||||
|
}
|
||||||
|
|
||||||
|
// ioOperation represents an outstanding asynchronous Win32 IO
|
||||||
|
type ioOperation struct {
|
||||||
|
o syscall.Overlapped
|
||||||
|
ch chan ioResult
|
||||||
|
}
|
||||||
|
|
||||||
|
func initIo() {
|
||||||
|
h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff)
|
||||||
|
if err != nil {
|
||||||
|
panic(err)
|
||||||
|
}
|
||||||
|
ioCompletionPort = h
|
||||||
|
go ioCompletionProcessor(h)
|
||||||
|
}
|
||||||
|
|
||||||
|
// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall.
|
||||||
|
// It takes ownership of this handle and will close it if it is garbage collected.
|
||||||
|
type win32File struct {
|
||||||
|
handle syscall.Handle
|
||||||
|
wg sync.WaitGroup
|
||||||
|
wgLock sync.RWMutex
|
||||||
|
closing atomicBool
|
||||||
|
readDeadline deadlineHandler
|
||||||
|
writeDeadline deadlineHandler
|
||||||
|
}
|
||||||
|
|
||||||
|
type deadlineHandler struct {
|
||||||
|
setLock sync.Mutex
|
||||||
|
channel timeoutChan
|
||||||
|
channelLock sync.RWMutex
|
||||||
|
timer *time.Timer
|
||||||
|
timedout atomicBool
|
||||||
|
}
|
||||||
|
|
||||||
|
// makeWin32File makes a new win32File from an existing file handle
|
||||||
|
func makeWin32File(h syscall.Handle) (*win32File, error) {
|
||||||
|
f := &win32File{handle: h}
|
||||||
|
ioInitOnce.Do(initIo)
|
||||||
|
_, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
f.readDeadline.channel = make(timeoutChan)
|
||||||
|
f.writeDeadline.channel = make(timeoutChan)
|
||||||
|
return f, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
|
||||||
|
return makeWin32File(h)
|
||||||
|
}
|
||||||
|
|
||||||
|
// closeHandle closes the resources associated with a Win32 handle
|
||||||
|
func (f *win32File) closeHandle() {
|
||||||
|
f.wgLock.Lock()
|
||||||
|
// Atomically set that we are closing, releasing the resources only once.
|
||||||
|
if !f.closing.swap(true) {
|
||||||
|
f.wgLock.Unlock()
|
||||||
|
// cancel all IO and wait for it to complete
|
||||||
|
cancelIoEx(f.handle, nil)
|
||||||
|
f.wg.Wait()
|
||||||
|
// at this point, no new IO can start
|
||||||
|
syscall.Close(f.handle)
|
||||||
|
f.handle = 0
|
||||||
|
} else {
|
||||||
|
f.wgLock.Unlock()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Close closes a win32File.
|
||||||
|
func (f *win32File) Close() error {
|
||||||
|
f.closeHandle()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// prepareIo prepares for a new IO operation.
|
||||||
|
// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning.
|
||||||
|
func (f *win32File) prepareIo() (*ioOperation, error) {
|
||||||
|
f.wgLock.RLock()
|
||||||
|
if f.closing.isSet() {
|
||||||
|
f.wgLock.RUnlock()
|
||||||
|
return nil, ErrFileClosed
|
||||||
|
}
|
||||||
|
f.wg.Add(1)
|
||||||
|
f.wgLock.RUnlock()
|
||||||
|
c := &ioOperation{}
|
||||||
|
c.ch = make(chan ioResult)
|
||||||
|
return c, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ioCompletionProcessor processes completed async IOs forever
|
||||||
|
func ioCompletionProcessor(h syscall.Handle) {
|
||||||
|
for {
|
||||||
|
var bytes uint32
|
||||||
|
var key uintptr
|
||||||
|
var op *ioOperation
|
||||||
|
err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE)
|
||||||
|
if op == nil {
|
||||||
|
panic(err)
|
||||||
|
}
|
||||||
|
op.ch <- ioResult{bytes, err}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// asyncIo processes the return value from ReadFile or WriteFile, blocking until
|
||||||
|
// the operation has actually completed.
|
||||||
|
func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) {
|
||||||
|
if err != syscall.ERROR_IO_PENDING {
|
||||||
|
return int(bytes), err
|
||||||
|
}
|
||||||
|
|
||||||
|
if f.closing.isSet() {
|
||||||
|
cancelIoEx(f.handle, &c.o)
|
||||||
|
}
|
||||||
|
|
||||||
|
var timeout timeoutChan
|
||||||
|
if d != nil {
|
||||||
|
d.channelLock.Lock()
|
||||||
|
timeout = d.channel
|
||||||
|
d.channelLock.Unlock()
|
||||||
|
}
|
||||||
|
|
||||||
|
var r ioResult
|
||||||
|
select {
|
||||||
|
case r = <-c.ch:
|
||||||
|
err = r.err
|
||||||
|
if err == syscall.ERROR_OPERATION_ABORTED {
|
||||||
|
if f.closing.isSet() {
|
||||||
|
err = ErrFileClosed
|
||||||
|
}
|
||||||
|
}
|
||||||
|
case <-timeout:
|
||||||
|
cancelIoEx(f.handle, &c.o)
|
||||||
|
r = <-c.ch
|
||||||
|
err = r.err
|
||||||
|
if err == syscall.ERROR_OPERATION_ABORTED {
|
||||||
|
err = ErrTimeout
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// runtime.KeepAlive is needed, as c is passed via native
|
||||||
|
// code to ioCompletionProcessor, c must remain alive
|
||||||
|
// until the channel read is complete.
|
||||||
|
runtime.KeepAlive(c)
|
||||||
|
return int(r.bytes), err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Read reads from a file handle.
|
||||||
|
func (f *win32File) Read(b []byte) (int, error) {
|
||||||
|
c, err := f.prepareIo()
|
||||||
|
if err != nil {
|
||||||
|
return 0, err
|
||||||
|
}
|
||||||
|
defer f.wg.Done()
|
||||||
|
|
||||||
|
if f.readDeadline.timedout.isSet() {
|
||||||
|
return 0, ErrTimeout
|
||||||
|
}
|
||||||
|
|
||||||
|
var bytes uint32
|
||||||
|
err = syscall.ReadFile(f.handle, b, &bytes, &c.o)
|
||||||
|
n, err := f.asyncIo(c, &f.readDeadline, bytes, err)
|
||||||
|
runtime.KeepAlive(b)
|
||||||
|
|
||||||
|
// Handle EOF conditions.
|
||||||
|
if err == nil && n == 0 && len(b) != 0 {
|
||||||
|
return 0, io.EOF
|
||||||
|
} else if err == syscall.ERROR_BROKEN_PIPE {
|
||||||
|
return 0, io.EOF
|
||||||
|
} else {
|
||||||
|
return n, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Write writes to a file handle.
|
||||||
|
func (f *win32File) Write(b []byte) (int, error) {
|
||||||
|
c, err := f.prepareIo()
|
||||||
|
if err != nil {
|
||||||
|
return 0, err
|
||||||
|
}
|
||||||
|
defer f.wg.Done()
|
||||||
|
|
||||||
|
if f.writeDeadline.timedout.isSet() {
|
||||||
|
return 0, ErrTimeout
|
||||||
|
}
|
||||||
|
|
||||||
|
var bytes uint32
|
||||||
|
err = syscall.WriteFile(f.handle, b, &bytes, &c.o)
|
||||||
|
n, err := f.asyncIo(c, &f.writeDeadline, bytes, err)
|
||||||
|
runtime.KeepAlive(b)
|
||||||
|
return n, err
|
||||||
|
}
|
||||||
|
|
||||||
|
func (f *win32File) SetReadDeadline(deadline time.Time) error {
|
||||||
|
return f.readDeadline.set(deadline)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (f *win32File) SetWriteDeadline(deadline time.Time) error {
|
||||||
|
return f.writeDeadline.set(deadline)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (f *win32File) Flush() error {
|
||||||
|
return syscall.FlushFileBuffers(f.handle)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (d *deadlineHandler) set(deadline time.Time) error {
|
||||||
|
d.setLock.Lock()
|
||||||
|
defer d.setLock.Unlock()
|
||||||
|
|
||||||
|
if d.timer != nil {
|
||||||
|
if !d.timer.Stop() {
|
||||||
|
<-d.channel
|
||||||
|
}
|
||||||
|
d.timer = nil
|
||||||
|
}
|
||||||
|
d.timedout.setFalse()
|
||||||
|
|
||||||
|
select {
|
||||||
|
case <-d.channel:
|
||||||
|
d.channelLock.Lock()
|
||||||
|
d.channel = make(chan struct{})
|
||||||
|
d.channelLock.Unlock()
|
||||||
|
default:
|
||||||
|
}
|
||||||
|
|
||||||
|
if deadline.IsZero() {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
timeoutIO := func() {
|
||||||
|
d.timedout.setTrue()
|
||||||
|
close(d.channel)
|
||||||
|
}
|
||||||
|
|
||||||
|
now := time.Now()
|
||||||
|
duration := deadline.Sub(now)
|
||||||
|
if deadline.After(now) {
|
||||||
|
// Deadline is in the future, set a timer to wait
|
||||||
|
d.timer = time.AfterFunc(duration, timeoutIO)
|
||||||
|
} else {
|
||||||
|
// Deadline is in the past. Cancel all pending IO now.
|
||||||
|
timeoutIO()
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,61 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"os"
|
||||||
|
"runtime"
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
)
|
||||||
|
|
||||||
|
//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx
|
||||||
|
//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle
|
||||||
|
|
||||||
|
const (
|
||||||
|
fileBasicInfo = 0
|
||||||
|
fileIDInfo = 0x12
|
||||||
|
)
|
||||||
|
|
||||||
|
// FileBasicInfo contains file access time and file attributes information.
|
||||||
|
type FileBasicInfo struct {
|
||||||
|
CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
|
||||||
|
FileAttributes uint32
|
||||||
|
pad uint32 // padding
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetFileBasicInfo retrieves times and attributes for a file.
|
||||||
|
func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) {
|
||||||
|
bi := &FileBasicInfo{}
|
||||||
|
if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
|
||||||
|
return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
|
||||||
|
}
|
||||||
|
runtime.KeepAlive(f)
|
||||||
|
return bi, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// SetFileBasicInfo sets times and attributes for a file.
|
||||||
|
func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error {
|
||||||
|
if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
|
||||||
|
return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err}
|
||||||
|
}
|
||||||
|
runtime.KeepAlive(f)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// FileIDInfo contains the volume serial number and file ID for a file. This pair should be
|
||||||
|
// unique on a system.
|
||||||
|
type FileIDInfo struct {
|
||||||
|
VolumeSerialNumber uint64
|
||||||
|
FileID [16]byte
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetFileID retrieves the unique (volume, file ID) pair for a file.
|
||||||
|
func GetFileID(f *os.File) (*FileIDInfo, error) {
|
||||||
|
fileID := &FileIDInfo{}
|
||||||
|
if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil {
|
||||||
|
return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
|
||||||
|
}
|
||||||
|
runtime.KeepAlive(f)
|
||||||
|
return fileID, nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,421 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"errors"
|
||||||
|
"io"
|
||||||
|
"net"
|
||||||
|
"os"
|
||||||
|
"syscall"
|
||||||
|
"time"
|
||||||
|
"unsafe"
|
||||||
|
)
|
||||||
|
|
||||||
|
//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
|
||||||
|
//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW
|
||||||
|
//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
|
||||||
|
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
|
||||||
|
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
|
||||||
|
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
|
||||||
|
|
||||||
|
const (
|
||||||
|
cERROR_PIPE_BUSY = syscall.Errno(231)
|
||||||
|
cERROR_NO_DATA = syscall.Errno(232)
|
||||||
|
cERROR_PIPE_CONNECTED = syscall.Errno(535)
|
||||||
|
cERROR_SEM_TIMEOUT = syscall.Errno(121)
|
||||||
|
|
||||||
|
cPIPE_ACCESS_DUPLEX = 0x3
|
||||||
|
cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
|
||||||
|
cSECURITY_SQOS_PRESENT = 0x100000
|
||||||
|
cSECURITY_ANONYMOUS = 0
|
||||||
|
|
||||||
|
cPIPE_REJECT_REMOTE_CLIENTS = 0x8
|
||||||
|
|
||||||
|
cPIPE_UNLIMITED_INSTANCES = 255
|
||||||
|
|
||||||
|
cNMPWAIT_USE_DEFAULT_WAIT = 0
|
||||||
|
cNMPWAIT_NOWAIT = 1
|
||||||
|
|
||||||
|
cPIPE_TYPE_MESSAGE = 4
|
||||||
|
|
||||||
|
cPIPE_READMODE_MESSAGE = 2
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
// ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed.
|
||||||
|
// This error should match net.errClosing since docker takes a dependency on its text.
|
||||||
|
ErrPipeListenerClosed = errors.New("use of closed network connection")
|
||||||
|
|
||||||
|
errPipeWriteClosed = errors.New("pipe has been closed for write")
|
||||||
|
)
|
||||||
|
|
||||||
|
type win32Pipe struct {
|
||||||
|
*win32File
|
||||||
|
path string
|
||||||
|
}
|
||||||
|
|
||||||
|
type win32MessageBytePipe struct {
|
||||||
|
win32Pipe
|
||||||
|
writeClosed bool
|
||||||
|
readEOF bool
|
||||||
|
}
|
||||||
|
|
||||||
|
type pipeAddress string
|
||||||
|
|
||||||
|
func (f *win32Pipe) LocalAddr() net.Addr {
|
||||||
|
return pipeAddress(f.path)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (f *win32Pipe) RemoteAddr() net.Addr {
|
||||||
|
return pipeAddress(f.path)
|
||||||
|
}
|
||||||
|
|
||||||
|
func (f *win32Pipe) SetDeadline(t time.Time) error {
|
||||||
|
f.SetReadDeadline(t)
|
||||||
|
f.SetWriteDeadline(t)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CloseWrite closes the write side of a message pipe in byte mode.
|
||||||
|
func (f *win32MessageBytePipe) CloseWrite() error {
|
||||||
|
if f.writeClosed {
|
||||||
|
return errPipeWriteClosed
|
||||||
|
}
|
||||||
|
err := f.win32File.Flush()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
_, err = f.win32File.Write(nil)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
f.writeClosed = true
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since
|
||||||
|
// they are used to implement CloseWrite().
|
||||||
|
func (f *win32MessageBytePipe) Write(b []byte) (int, error) {
|
||||||
|
if f.writeClosed {
|
||||||
|
return 0, errPipeWriteClosed
|
||||||
|
}
|
||||||
|
if len(b) == 0 {
|
||||||
|
return 0, nil
|
||||||
|
}
|
||||||
|
return f.win32File.Write(b)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message
|
||||||
|
// mode pipe will return io.EOF, as will all subsequent reads.
|
||||||
|
func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
|
||||||
|
if f.readEOF {
|
||||||
|
return 0, io.EOF
|
||||||
|
}
|
||||||
|
n, err := f.win32File.Read(b)
|
||||||
|
if err == io.EOF {
|
||||||
|
// If this was the result of a zero-byte read, then
|
||||||
|
// it is possible that the read was due to a zero-size
|
||||||
|
// message. Since we are simulating CloseWrite with a
|
||||||
|
// zero-byte message, ensure that all future Read() calls
|
||||||
|
// also return EOF.
|
||||||
|
f.readEOF = true
|
||||||
|
} else if err == syscall.ERROR_MORE_DATA {
|
||||||
|
// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
|
||||||
|
// and the message still has more bytes. Treat this as a success, since
|
||||||
|
// this package presents all named pipes as byte streams.
|
||||||
|
err = nil
|
||||||
|
}
|
||||||
|
return n, err
|
||||||
|
}
|
||||||
|
|
||||||
|
func (s pipeAddress) Network() string {
|
||||||
|
return "pipe"
|
||||||
|
}
|
||||||
|
|
||||||
|
func (s pipeAddress) String() string {
|
||||||
|
return string(s)
|
||||||
|
}
|
||||||
|
|
||||||
|
// DialPipe connects to a named pipe by path, timing out if the connection
|
||||||
|
// takes longer than the specified duration. If timeout is nil, then we use
|
||||||
|
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
|
||||||
|
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
|
||||||
|
var absTimeout time.Time
|
||||||
|
if timeout != nil {
|
||||||
|
absTimeout = time.Now().Add(*timeout)
|
||||||
|
} else {
|
||||||
|
absTimeout = time.Now().Add(time.Second * 2)
|
||||||
|
}
|
||||||
|
var err error
|
||||||
|
var h syscall.Handle
|
||||||
|
for {
|
||||||
|
h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||||
|
if err != cERROR_PIPE_BUSY {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
if time.Now().After(absTimeout) {
|
||||||
|
return nil, ErrTimeout
|
||||||
|
}
|
||||||
|
|
||||||
|
// Wait 10 msec and try again. This is a rather simplistic
|
||||||
|
// view, as we always try each 10 milliseconds.
|
||||||
|
time.Sleep(time.Millisecond * 10)
|
||||||
|
}
|
||||||
|
if err != nil {
|
||||||
|
return nil, &os.PathError{Op: "open", Path: path, Err: err}
|
||||||
|
}
|
||||||
|
|
||||||
|
var flags uint32
|
||||||
|
err = getNamedPipeInfo(h, &flags, nil, nil, nil)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
f, err := makeWin32File(h)
|
||||||
|
if err != nil {
|
||||||
|
syscall.Close(h)
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// If the pipe is in message mode, return a message byte pipe, which
|
||||||
|
// supports CloseWrite().
|
||||||
|
if flags&cPIPE_TYPE_MESSAGE != 0 {
|
||||||
|
return &win32MessageBytePipe{
|
||||||
|
win32Pipe: win32Pipe{win32File: f, path: path},
|
||||||
|
}, nil
|
||||||
|
}
|
||||||
|
return &win32Pipe{win32File: f, path: path}, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
type acceptResponse struct {
|
||||||
|
f *win32File
|
||||||
|
err error
|
||||||
|
}
|
||||||
|
|
||||||
|
type win32PipeListener struct {
|
||||||
|
firstHandle syscall.Handle
|
||||||
|
path string
|
||||||
|
securityDescriptor []byte
|
||||||
|
config PipeConfig
|
||||||
|
acceptCh chan (chan acceptResponse)
|
||||||
|
closeCh chan int
|
||||||
|
doneCh chan int
|
||||||
|
}
|
||||||
|
|
||||||
|
func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
|
||||||
|
var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
|
||||||
|
if first {
|
||||||
|
flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
|
||||||
|
}
|
||||||
|
|
||||||
|
var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
|
||||||
|
if c.MessageMode {
|
||||||
|
mode |= cPIPE_TYPE_MESSAGE
|
||||||
|
}
|
||||||
|
|
||||||
|
sa := &syscall.SecurityAttributes{}
|
||||||
|
sa.Length = uint32(unsafe.Sizeof(*sa))
|
||||||
|
if securityDescriptor != nil {
|
||||||
|
len := uint32(len(securityDescriptor))
|
||||||
|
sa.SecurityDescriptor = localAlloc(0, len)
|
||||||
|
defer localFree(sa.SecurityDescriptor)
|
||||||
|
copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
|
||||||
|
}
|
||||||
|
h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
|
||||||
|
if err != nil {
|
||||||
|
return 0, &os.PathError{Op: "open", Path: path, Err: err}
|
||||||
|
}
|
||||||
|
return h, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
|
||||||
|
h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
f, err := makeWin32File(h)
|
||||||
|
if err != nil {
|
||||||
|
syscall.Close(h)
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return f, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
|
||||||
|
p, err := l.makeServerPipe()
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Wait for the client to connect.
|
||||||
|
ch := make(chan error)
|
||||||
|
go func(p *win32File) {
|
||||||
|
ch <- connectPipe(p)
|
||||||
|
}(p)
|
||||||
|
|
||||||
|
select {
|
||||||
|
case err = <-ch:
|
||||||
|
if err != nil {
|
||||||
|
p.Close()
|
||||||
|
p = nil
|
||||||
|
}
|
||||||
|
case <-l.closeCh:
|
||||||
|
// Abort the connect request by closing the handle.
|
||||||
|
p.Close()
|
||||||
|
p = nil
|
||||||
|
err = <-ch
|
||||||
|
if err == nil || err == ErrFileClosed {
|
||||||
|
err = ErrPipeListenerClosed
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return p, err
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l *win32PipeListener) listenerRoutine() {
|
||||||
|
closed := false
|
||||||
|
for !closed {
|
||||||
|
select {
|
||||||
|
case <-l.closeCh:
|
||||||
|
closed = true
|
||||||
|
case responseCh := <-l.acceptCh:
|
||||||
|
var (
|
||||||
|
p *win32File
|
||||||
|
err error
|
||||||
|
)
|
||||||
|
for {
|
||||||
|
p, err = l.makeConnectedServerPipe()
|
||||||
|
// If the connection was immediately closed by the client, try
|
||||||
|
// again.
|
||||||
|
if err != cERROR_NO_DATA {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
responseCh <- acceptResponse{p, err}
|
||||||
|
closed = err == ErrPipeListenerClosed
|
||||||
|
}
|
||||||
|
}
|
||||||
|
syscall.Close(l.firstHandle)
|
||||||
|
l.firstHandle = 0
|
||||||
|
// Notify Close() and Accept() callers that the handle has been closed.
|
||||||
|
close(l.doneCh)
|
||||||
|
}
|
||||||
|
|
||||||
|
// PipeConfig contain configuration for the pipe listener.
|
||||||
|
type PipeConfig struct {
|
||||||
|
// SecurityDescriptor contains a Windows security descriptor in SDDL format.
|
||||||
|
SecurityDescriptor string
|
||||||
|
|
||||||
|
// MessageMode determines whether the pipe is in byte or message mode. In either
|
||||||
|
// case the pipe is read in byte mode by default. The only practical difference in
|
||||||
|
// this implementation is that CloseWrite() is only supported for message mode pipes;
|
||||||
|
// CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only
|
||||||
|
// transferred to the reader (and returned as io.EOF in this implementation)
|
||||||
|
// when the pipe is in message mode.
|
||||||
|
MessageMode bool
|
||||||
|
|
||||||
|
// InputBufferSize specifies the size the input buffer, in bytes.
|
||||||
|
InputBufferSize int32
|
||||||
|
|
||||||
|
// OutputBufferSize specifies the size the input buffer, in bytes.
|
||||||
|
OutputBufferSize int32
|
||||||
|
}
|
||||||
|
|
||||||
|
// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe.
|
||||||
|
// The pipe must not already exist.
|
||||||
|
func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
|
||||||
|
var (
|
||||||
|
sd []byte
|
||||||
|
err error
|
||||||
|
)
|
||||||
|
if c == nil {
|
||||||
|
c = &PipeConfig{}
|
||||||
|
}
|
||||||
|
if c.SecurityDescriptor != "" {
|
||||||
|
sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
h, err := makeServerPipeHandle(path, sd, c, true)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
// Create a client handle and connect it. This results in the pipe
|
||||||
|
// instance always existing, so that clients see ERROR_PIPE_BUSY
|
||||||
|
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
|
||||||
|
// up so that no other instances can be used. This would have been
|
||||||
|
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
|
||||||
|
// instead of CreateNamedPipe. (Apparently created named pipes are
|
||||||
|
// considered to be in listening state regardless of whether any
|
||||||
|
// active calls to ConnectNamedPipe are outstanding.)
|
||||||
|
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
|
||||||
|
if err != nil {
|
||||||
|
syscall.Close(h)
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
// Close the client handle. The server side of the instance will
|
||||||
|
// still be busy, leading to ERROR_PIPE_BUSY instead of
|
||||||
|
// ERROR_NOT_FOUND, as long as we don't close the server handle,
|
||||||
|
// or disconnect the client with DisconnectNamedPipe.
|
||||||
|
syscall.Close(h2)
|
||||||
|
l := &win32PipeListener{
|
||||||
|
firstHandle: h,
|
||||||
|
path: path,
|
||||||
|
securityDescriptor: sd,
|
||||||
|
config: *c,
|
||||||
|
acceptCh: make(chan (chan acceptResponse)),
|
||||||
|
closeCh: make(chan int),
|
||||||
|
doneCh: make(chan int),
|
||||||
|
}
|
||||||
|
go l.listenerRoutine()
|
||||||
|
return l, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func connectPipe(p *win32File) error {
|
||||||
|
c, err := p.prepareIo()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
defer p.wg.Done()
|
||||||
|
|
||||||
|
err = connectNamedPipe(p.handle, &c.o)
|
||||||
|
_, err = p.asyncIo(c, nil, 0, err)
|
||||||
|
if err != nil && err != cERROR_PIPE_CONNECTED {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l *win32PipeListener) Accept() (net.Conn, error) {
|
||||||
|
ch := make(chan acceptResponse)
|
||||||
|
select {
|
||||||
|
case l.acceptCh <- ch:
|
||||||
|
response := <-ch
|
||||||
|
err := response.err
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
if l.config.MessageMode {
|
||||||
|
return &win32MessageBytePipe{
|
||||||
|
win32Pipe: win32Pipe{win32File: response.f, path: l.path},
|
||||||
|
}, nil
|
||||||
|
}
|
||||||
|
return &win32Pipe{win32File: response.f, path: l.path}, nil
|
||||||
|
case <-l.doneCh:
|
||||||
|
return nil, ErrPipeListenerClosed
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l *win32PipeListener) Close() error {
|
||||||
|
select {
|
||||||
|
case l.closeCh <- 1:
|
||||||
|
<-l.doneCh
|
||||||
|
case <-l.doneCh:
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (l *win32PipeListener) Addr() net.Addr {
|
||||||
|
return pipeAddress(l.path)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,202 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"encoding/binary"
|
||||||
|
"fmt"
|
||||||
|
"runtime"
|
||||||
|
"sync"
|
||||||
|
"syscall"
|
||||||
|
"unicode/utf16"
|
||||||
|
|
||||||
|
"golang.org/x/sys/windows"
|
||||||
|
)
|
||||||
|
|
||||||
|
//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges
|
||||||
|
//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf
|
||||||
|
//sys revertToSelf() (err error) = advapi32.RevertToSelf
|
||||||
|
//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken
|
||||||
|
//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread
|
||||||
|
//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW
|
||||||
|
//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW
|
||||||
|
//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW
|
||||||
|
|
||||||
|
const (
|
||||||
|
SE_PRIVILEGE_ENABLED = 2
|
||||||
|
|
||||||
|
ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300
|
||||||
|
|
||||||
|
SeBackupPrivilege = "SeBackupPrivilege"
|
||||||
|
SeRestorePrivilege = "SeRestorePrivilege"
|
||||||
|
)
|
||||||
|
|
||||||
|
const (
|
||||||
|
securityAnonymous = iota
|
||||||
|
securityIdentification
|
||||||
|
securityImpersonation
|
||||||
|
securityDelegation
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
privNames = make(map[string]uint64)
|
||||||
|
privNameMutex sync.Mutex
|
||||||
|
)
|
||||||
|
|
||||||
|
// PrivilegeError represents an error enabling privileges.
|
||||||
|
type PrivilegeError struct {
|
||||||
|
privileges []uint64
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *PrivilegeError) Error() string {
|
||||||
|
s := ""
|
||||||
|
if len(e.privileges) > 1 {
|
||||||
|
s = "Could not enable privileges "
|
||||||
|
} else {
|
||||||
|
s = "Could not enable privilege "
|
||||||
|
}
|
||||||
|
for i, p := range e.privileges {
|
||||||
|
if i != 0 {
|
||||||
|
s += ", "
|
||||||
|
}
|
||||||
|
s += `"`
|
||||||
|
s += getPrivilegeName(p)
|
||||||
|
s += `"`
|
||||||
|
}
|
||||||
|
return s
|
||||||
|
}
|
||||||
|
|
||||||
|
// RunWithPrivilege enables a single privilege for a function call.
|
||||||
|
func RunWithPrivilege(name string, fn func() error) error {
|
||||||
|
return RunWithPrivileges([]string{name}, fn)
|
||||||
|
}
|
||||||
|
|
||||||
|
// RunWithPrivileges enables privileges for a function call.
|
||||||
|
func RunWithPrivileges(names []string, fn func() error) error {
|
||||||
|
privileges, err := mapPrivileges(names)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
runtime.LockOSThread()
|
||||||
|
defer runtime.UnlockOSThread()
|
||||||
|
token, err := newThreadToken()
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
defer releaseThreadToken(token)
|
||||||
|
err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return fn()
|
||||||
|
}
|
||||||
|
|
||||||
|
func mapPrivileges(names []string) ([]uint64, error) {
|
||||||
|
var privileges []uint64
|
||||||
|
privNameMutex.Lock()
|
||||||
|
defer privNameMutex.Unlock()
|
||||||
|
for _, name := range names {
|
||||||
|
p, ok := privNames[name]
|
||||||
|
if !ok {
|
||||||
|
err := lookupPrivilegeValue("", name, &p)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
privNames[name] = p
|
||||||
|
}
|
||||||
|
privileges = append(privileges, p)
|
||||||
|
}
|
||||||
|
return privileges, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// EnableProcessPrivileges enables privileges globally for the process.
|
||||||
|
func EnableProcessPrivileges(names []string) error {
|
||||||
|
return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED)
|
||||||
|
}
|
||||||
|
|
||||||
|
// DisableProcessPrivileges disables privileges globally for the process.
|
||||||
|
func DisableProcessPrivileges(names []string) error {
|
||||||
|
return enableDisableProcessPrivilege(names, 0)
|
||||||
|
}
|
||||||
|
|
||||||
|
func enableDisableProcessPrivilege(names []string, action uint32) error {
|
||||||
|
privileges, err := mapPrivileges(names)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
p, _ := windows.GetCurrentProcess()
|
||||||
|
var token windows.Token
|
||||||
|
err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
defer token.Close()
|
||||||
|
return adjustPrivileges(token, privileges, action)
|
||||||
|
}
|
||||||
|
|
||||||
|
func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error {
|
||||||
|
var b bytes.Buffer
|
||||||
|
binary.Write(&b, binary.LittleEndian, uint32(len(privileges)))
|
||||||
|
for _, p := range privileges {
|
||||||
|
binary.Write(&b, binary.LittleEndian, p)
|
||||||
|
binary.Write(&b, binary.LittleEndian, action)
|
||||||
|
}
|
||||||
|
prevState := make([]byte, b.Len())
|
||||||
|
reqSize := uint32(0)
|
||||||
|
success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize)
|
||||||
|
if !success {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if err == ERROR_NOT_ALL_ASSIGNED {
|
||||||
|
return &PrivilegeError{privileges}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func getPrivilegeName(luid uint64) string {
|
||||||
|
var nameBuffer [256]uint16
|
||||||
|
bufSize := uint32(len(nameBuffer))
|
||||||
|
err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Sprintf("<unknown privilege %d>", luid)
|
||||||
|
}
|
||||||
|
|
||||||
|
var displayNameBuffer [256]uint16
|
||||||
|
displayBufSize := uint32(len(displayNameBuffer))
|
||||||
|
var langID uint32
|
||||||
|
err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID)
|
||||||
|
if err != nil {
|
||||||
|
return fmt.Sprintf("<unknown privilege %s>", string(utf16.Decode(nameBuffer[:bufSize])))
|
||||||
|
}
|
||||||
|
|
||||||
|
return string(utf16.Decode(displayNameBuffer[:displayBufSize]))
|
||||||
|
}
|
||||||
|
|
||||||
|
func newThreadToken() (windows.Token, error) {
|
||||||
|
err := impersonateSelf(securityImpersonation)
|
||||||
|
if err != nil {
|
||||||
|
return 0, err
|
||||||
|
}
|
||||||
|
|
||||||
|
var token windows.Token
|
||||||
|
err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token)
|
||||||
|
if err != nil {
|
||||||
|
rerr := revertToSelf()
|
||||||
|
if rerr != nil {
|
||||||
|
panic(rerr)
|
||||||
|
}
|
||||||
|
return 0, err
|
||||||
|
}
|
||||||
|
return token, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func releaseThreadToken(h windows.Token) {
|
||||||
|
err := revertToSelf()
|
||||||
|
if err != nil {
|
||||||
|
panic(err)
|
||||||
|
}
|
||||||
|
h.Close()
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,128 @@
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"bytes"
|
||||||
|
"encoding/binary"
|
||||||
|
"fmt"
|
||||||
|
"strings"
|
||||||
|
"unicode/utf16"
|
||||||
|
"unsafe"
|
||||||
|
)
|
||||||
|
|
||||||
|
const (
|
||||||
|
reparseTagMountPoint = 0xA0000003
|
||||||
|
reparseTagSymlink = 0xA000000C
|
||||||
|
)
|
||||||
|
|
||||||
|
type reparseDataBuffer struct {
|
||||||
|
ReparseTag uint32
|
||||||
|
ReparseDataLength uint16
|
||||||
|
Reserved uint16
|
||||||
|
SubstituteNameOffset uint16
|
||||||
|
SubstituteNameLength uint16
|
||||||
|
PrintNameOffset uint16
|
||||||
|
PrintNameLength uint16
|
||||||
|
}
|
||||||
|
|
||||||
|
// ReparsePoint describes a Win32 symlink or mount point.
|
||||||
|
type ReparsePoint struct {
|
||||||
|
Target string
|
||||||
|
IsMountPoint bool
|
||||||
|
}
|
||||||
|
|
||||||
|
// UnsupportedReparsePointError is returned when trying to decode a non-symlink or
|
||||||
|
// mount point reparse point.
|
||||||
|
type UnsupportedReparsePointError struct {
|
||||||
|
Tag uint32
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *UnsupportedReparsePointError) Error() string {
|
||||||
|
return fmt.Sprintf("unsupported reparse point %x", e.Tag)
|
||||||
|
}
|
||||||
|
|
||||||
|
// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink
|
||||||
|
// or a mount point.
|
||||||
|
func DecodeReparsePoint(b []byte) (*ReparsePoint, error) {
|
||||||
|
tag := binary.LittleEndian.Uint32(b[0:4])
|
||||||
|
return DecodeReparsePointData(tag, b[8:])
|
||||||
|
}
|
||||||
|
|
||||||
|
func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) {
|
||||||
|
isMountPoint := false
|
||||||
|
switch tag {
|
||||||
|
case reparseTagMountPoint:
|
||||||
|
isMountPoint = true
|
||||||
|
case reparseTagSymlink:
|
||||||
|
default:
|
||||||
|
return nil, &UnsupportedReparsePointError{tag}
|
||||||
|
}
|
||||||
|
nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6])
|
||||||
|
if !isMountPoint {
|
||||||
|
nameOffset += 4
|
||||||
|
}
|
||||||
|
nameLength := binary.LittleEndian.Uint16(b[6:8])
|
||||||
|
name := make([]uint16, nameLength/2)
|
||||||
|
err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func isDriveLetter(c byte) bool {
|
||||||
|
return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')
|
||||||
|
}
|
||||||
|
|
||||||
|
// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or
|
||||||
|
// mount point.
|
||||||
|
func EncodeReparsePoint(rp *ReparsePoint) []byte {
|
||||||
|
// Generate an NT path and determine if this is a relative path.
|
||||||
|
var ntTarget string
|
||||||
|
relative := false
|
||||||
|
if strings.HasPrefix(rp.Target, `\\?\`) {
|
||||||
|
ntTarget = `\??\` + rp.Target[4:]
|
||||||
|
} else if strings.HasPrefix(rp.Target, `\\`) {
|
||||||
|
ntTarget = `\??\UNC\` + rp.Target[2:]
|
||||||
|
} else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' {
|
||||||
|
ntTarget = `\??\` + rp.Target
|
||||||
|
} else {
|
||||||
|
ntTarget = rp.Target
|
||||||
|
relative = true
|
||||||
|
}
|
||||||
|
|
||||||
|
// The paths must be NUL-terminated even though they are counted strings.
|
||||||
|
target16 := utf16.Encode([]rune(rp.Target + "\x00"))
|
||||||
|
ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00"))
|
||||||
|
|
||||||
|
size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8
|
||||||
|
size += len(ntTarget16)*2 + len(target16)*2
|
||||||
|
|
||||||
|
tag := uint32(reparseTagMountPoint)
|
||||||
|
if !rp.IsMountPoint {
|
||||||
|
tag = reparseTagSymlink
|
||||||
|
size += 4 // Add room for symlink flags
|
||||||
|
}
|
||||||
|
|
||||||
|
data := reparseDataBuffer{
|
||||||
|
ReparseTag: tag,
|
||||||
|
ReparseDataLength: uint16(size),
|
||||||
|
SubstituteNameOffset: 0,
|
||||||
|
SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2),
|
||||||
|
PrintNameOffset: uint16(len(ntTarget16) * 2),
|
||||||
|
PrintNameLength: uint16((len(target16) - 1) * 2),
|
||||||
|
}
|
||||||
|
|
||||||
|
var b bytes.Buffer
|
||||||
|
binary.Write(&b, binary.LittleEndian, &data)
|
||||||
|
if !rp.IsMountPoint {
|
||||||
|
flags := uint32(0)
|
||||||
|
if relative {
|
||||||
|
flags |= 1
|
||||||
|
}
|
||||||
|
binary.Write(&b, binary.LittleEndian, flags)
|
||||||
|
}
|
||||||
|
|
||||||
|
binary.Write(&b, binary.LittleEndian, ntTarget16)
|
||||||
|
binary.Write(&b, binary.LittleEndian, target16)
|
||||||
|
return b.Bytes()
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,98 @@
|
||||||
|
// +build windows
|
||||||
|
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
)
|
||||||
|
|
||||||
|
//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW
|
||||||
|
//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW
|
||||||
|
//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW
|
||||||
|
//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW
|
||||||
|
//sys localFree(mem uintptr) = LocalFree
|
||||||
|
//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength
|
||||||
|
|
||||||
|
const (
|
||||||
|
cERROR_NONE_MAPPED = syscall.Errno(1332)
|
||||||
|
)
|
||||||
|
|
||||||
|
type AccountLookupError struct {
|
||||||
|
Name string
|
||||||
|
Err error
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *AccountLookupError) Error() string {
|
||||||
|
if e.Name == "" {
|
||||||
|
return "lookup account: empty account name specified"
|
||||||
|
}
|
||||||
|
var s string
|
||||||
|
switch e.Err {
|
||||||
|
case cERROR_NONE_MAPPED:
|
||||||
|
s = "not found"
|
||||||
|
default:
|
||||||
|
s = e.Err.Error()
|
||||||
|
}
|
||||||
|
return "lookup account " + e.Name + ": " + s
|
||||||
|
}
|
||||||
|
|
||||||
|
type SddlConversionError struct {
|
||||||
|
Sddl string
|
||||||
|
Err error
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *SddlConversionError) Error() string {
|
||||||
|
return "convert " + e.Sddl + ": " + e.Err.Error()
|
||||||
|
}
|
||||||
|
|
||||||
|
// LookupSidByName looks up the SID of an account by name
|
||||||
|
func LookupSidByName(name string) (sid string, err error) {
|
||||||
|
if name == "" {
|
||||||
|
return "", &AccountLookupError{name, cERROR_NONE_MAPPED}
|
||||||
|
}
|
||||||
|
|
||||||
|
var sidSize, sidNameUse, refDomainSize uint32
|
||||||
|
err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse)
|
||||||
|
if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER {
|
||||||
|
return "", &AccountLookupError{name, err}
|
||||||
|
}
|
||||||
|
sidBuffer := make([]byte, sidSize)
|
||||||
|
refDomainBuffer := make([]uint16, refDomainSize)
|
||||||
|
err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse)
|
||||||
|
if err != nil {
|
||||||
|
return "", &AccountLookupError{name, err}
|
||||||
|
}
|
||||||
|
var strBuffer *uint16
|
||||||
|
err = convertSidToStringSid(&sidBuffer[0], &strBuffer)
|
||||||
|
if err != nil {
|
||||||
|
return "", &AccountLookupError{name, err}
|
||||||
|
}
|
||||||
|
sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:])
|
||||||
|
localFree(uintptr(unsafe.Pointer(strBuffer)))
|
||||||
|
return sid, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func SddlToSecurityDescriptor(sddl string) ([]byte, error) {
|
||||||
|
var sdBuffer uintptr
|
||||||
|
err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil)
|
||||||
|
if err != nil {
|
||||||
|
return nil, &SddlConversionError{sddl, err}
|
||||||
|
}
|
||||||
|
defer localFree(sdBuffer)
|
||||||
|
sd := make([]byte, getSecurityDescriptorLength(sdBuffer))
|
||||||
|
copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)])
|
||||||
|
return sd, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func SecurityDescriptorToSddl(sd []byte) (string, error) {
|
||||||
|
var sddl *uint16
|
||||||
|
// The returned string length seems to including an aribtrary number of terminating NULs.
|
||||||
|
// Don't use it.
|
||||||
|
err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil)
|
||||||
|
if err != nil {
|
||||||
|
return "", err
|
||||||
|
}
|
||||||
|
defer localFree(uintptr(unsafe.Pointer(sddl)))
|
||||||
|
return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,3 @@
|
||||||
|
package winio
|
||||||
|
|
||||||
|
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go
|
||||||
|
|
@ -0,0 +1,520 @@
|
||||||
|
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
|
||||||
|
|
||||||
|
package winio
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
|
||||||
|
"golang.org/x/sys/windows"
|
||||||
|
)
|
||||||
|
|
||||||
|
var _ unsafe.Pointer
|
||||||
|
|
||||||
|
// Do the interface allocations only once for common
|
||||||
|
// Errno values.
|
||||||
|
const (
|
||||||
|
errnoERROR_IO_PENDING = 997
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||||
|
)
|
||||||
|
|
||||||
|
// errnoErr returns common boxed Errno values, to prevent
|
||||||
|
// allocations at runtime.
|
||||||
|
func errnoErr(e syscall.Errno) error {
|
||||||
|
switch e {
|
||||||
|
case 0:
|
||||||
|
return nil
|
||||||
|
case errnoERROR_IO_PENDING:
|
||||||
|
return errERROR_IO_PENDING
|
||||||
|
}
|
||||||
|
// TODO: add more here, after collecting data on the common
|
||||||
|
// error values see on Windows. (perhaps when running
|
||||||
|
// all.bat?)
|
||||||
|
return e
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||||
|
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
|
||||||
|
|
||||||
|
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
|
||||||
|
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
|
||||||
|
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
|
||||||
|
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
|
||||||
|
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
|
||||||
|
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
|
||||||
|
procCreateFileW = modkernel32.NewProc("CreateFileW")
|
||||||
|
procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW")
|
||||||
|
procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo")
|
||||||
|
procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW")
|
||||||
|
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
|
||||||
|
procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW")
|
||||||
|
procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW")
|
||||||
|
procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
|
||||||
|
procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW")
|
||||||
|
procLocalFree = modkernel32.NewProc("LocalFree")
|
||||||
|
procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength")
|
||||||
|
procGetFileInformationByHandleEx = modkernel32.NewProc("GetFileInformationByHandleEx")
|
||||||
|
procSetFileInformationByHandle = modkernel32.NewProc("SetFileInformationByHandle")
|
||||||
|
procAdjustTokenPrivileges = modadvapi32.NewProc("AdjustTokenPrivileges")
|
||||||
|
procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf")
|
||||||
|
procRevertToSelf = modadvapi32.NewProc("RevertToSelf")
|
||||||
|
procOpenThreadToken = modadvapi32.NewProc("OpenThreadToken")
|
||||||
|
procGetCurrentThread = modkernel32.NewProc("GetCurrentThread")
|
||||||
|
procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW")
|
||||||
|
procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW")
|
||||||
|
procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
|
||||||
|
procBackupRead = modkernel32.NewProc("BackupRead")
|
||||||
|
procBackupWrite = modkernel32.NewProc("BackupWrite")
|
||||||
|
)
|
||||||
|
|
||||||
|
func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) {
|
||||||
|
r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0)
|
||||||
|
newport = syscall.Handle(r0)
|
||||||
|
if newport == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(name)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
|
||||||
|
r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0)
|
||||||
|
handle = syscall.Handle(r0)
|
||||||
|
if handle == syscall.InvalidHandle {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(name)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
|
||||||
|
r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0)
|
||||||
|
handle = syscall.Handle(r0)
|
||||||
|
if handle == syscall.InvalidHandle {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func waitNamedPipe(name string, timeout uint32) (err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(name)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _waitNamedPipe(_p0, timeout)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
|
||||||
|
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0)
|
||||||
|
ptr = uintptr(r0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(accountName)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func convertSidToStringSid(sid *byte, str **uint16) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(str)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func localFree(mem uintptr) {
|
||||||
|
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func getSecurityDescriptorLength(sd uintptr) (len uint32) {
|
||||||
|
r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0)
|
||||||
|
len = uint32(r0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) {
|
||||||
|
var _p0 uint32
|
||||||
|
if releaseAll {
|
||||||
|
_p0 = 1
|
||||||
|
} else {
|
||||||
|
_p0 = 0
|
||||||
|
}
|
||||||
|
r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize)))
|
||||||
|
success = r0 != 0
|
||||||
|
if true {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func impersonateSelf(level uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func revertToSelf() (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) {
|
||||||
|
var _p0 uint32
|
||||||
|
if openAsSelf {
|
||||||
|
_p0 = 1
|
||||||
|
} else {
|
||||||
|
_p0 = 0
|
||||||
|
}
|
||||||
|
r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func getCurrentThread() (h syscall.Handle) {
|
||||||
|
r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0)
|
||||||
|
h = syscall.Handle(r0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(systemName)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
var _p1 *uint16
|
||||||
|
_p1, err = syscall.UTF16PtrFromString(name)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _lookupPrivilegeValue(_p0, _p1, luid)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid)))
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(systemName)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _lookupPrivilegeName(_p0, luid, buffer, size)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, err = syscall.UTF16PtrFromString(systemName)
|
||||||
|
if err != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
|
||||||
|
r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
|
||||||
|
var _p0 *byte
|
||||||
|
if len(b) > 0 {
|
||||||
|
_p0 = &b[0]
|
||||||
|
}
|
||||||
|
var _p1 uint32
|
||||||
|
if abort {
|
||||||
|
_p1 = 1
|
||||||
|
} else {
|
||||||
|
_p1 = 0
|
||||||
|
}
|
||||||
|
var _p2 uint32
|
||||||
|
if processSecurity {
|
||||||
|
_p2 = 1
|
||||||
|
} else {
|
||||||
|
_p2 = 0
|
||||||
|
}
|
||||||
|
r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
|
||||||
|
var _p0 *byte
|
||||||
|
if len(b) > 0 {
|
||||||
|
_p0 = &b[0]
|
||||||
|
}
|
||||||
|
var _p1 uint32
|
||||||
|
if abort {
|
||||||
|
_p1 = 1
|
||||||
|
} else {
|
||||||
|
_p1 = 0
|
||||||
|
}
|
||||||
|
var _p2 uint32
|
||||||
|
if processSecurity {
|
||||||
|
_p2 = 1
|
||||||
|
} else {
|
||||||
|
_p2 = 0
|
||||||
|
}
|
||||||
|
r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
|
||||||
|
if r1 == 0 {
|
||||||
|
if e1 != 0 {
|
||||||
|
err = errnoErr(e1)
|
||||||
|
} else {
|
||||||
|
err = syscall.EINVAL
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1 @@
|
||||||
|
*.exe
|
||||||
|
|
@ -0,0 +1,17 @@
|
||||||
|
{
|
||||||
|
"Vendor": true,
|
||||||
|
"Deadline": "2m",
|
||||||
|
"Sort": [
|
||||||
|
"linter",
|
||||||
|
"severity",
|
||||||
|
"path",
|
||||||
|
"line"
|
||||||
|
],
|
||||||
|
"Skip": [
|
||||||
|
"internal\\schema2"
|
||||||
|
],
|
||||||
|
"EnableGC": true,
|
||||||
|
"Enable": [
|
||||||
|
"gofmt"
|
||||||
|
]
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,21 @@
|
||||||
|
The MIT License (MIT)
|
||||||
|
|
||||||
|
Copyright (c) 2015 Microsoft
|
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
|
in the Software without restriction, including without limitation the rights
|
||||||
|
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||||
|
copies of the Software, and to permit persons to whom the Software is
|
||||||
|
furnished to do so, subject to the following conditions:
|
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be included in all
|
||||||
|
copies or substantial portions of the Software.
|
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||||
|
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||||
|
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||||
|
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||||
|
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||||
|
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||||
|
SOFTWARE.
|
||||||
|
|
@ -0,0 +1,41 @@
|
||||||
|
# hcsshim
|
||||||
|
|
||||||
|
[](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
|
||||||
|
|
||||||
|
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
|
||||||
|
|
||||||
|
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
|
||||||
|
|
||||||
|
## Contributing
|
||||||
|
|
||||||
|
This project welcomes contributions and suggestions. Most contributions require you to agree to a
|
||||||
|
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
|
||||||
|
the rights to use your contribution. For details, visit https://cla.microsoft.com.
|
||||||
|
|
||||||
|
When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
|
||||||
|
a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
|
||||||
|
provided by the bot. You will only need to do this once across all repos using our CLA.
|
||||||
|
|
||||||
|
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
|
||||||
|
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
|
||||||
|
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
|
||||||
|
|
||||||
|
## Dependencies
|
||||||
|
|
||||||
|
This project requires Golang 1.9 or newer to build.
|
||||||
|
|
||||||
|
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
|
||||||
|
|
||||||
|
## Reporting Security Issues
|
||||||
|
|
||||||
|
Security issues and bugs should be reported privately, via email, to the Microsoft Security
|
||||||
|
Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
|
||||||
|
receive a response within 24 hours. If for some reason you do not, please follow up via
|
||||||
|
email to ensure we received your original message. Further information, including the
|
||||||
|
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
|
||||||
|
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
|
||||||
|
|
||||||
|
For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
|
||||||
|
|
||||||
|
---------------
|
||||||
|
Copyright (c) 2018 Microsoft Corp. All rights reserved.
|
||||||
|
|
@ -0,0 +1,29 @@
|
||||||
|
version: 0.1.{build}
|
||||||
|
|
||||||
|
image: Visual Studio 2017
|
||||||
|
|
||||||
|
clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
|
||||||
|
|
||||||
|
environment:
|
||||||
|
GOPATH: c:\gopath
|
||||||
|
PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%GOPATH%\bin;C:\gometalinter-2.0.12-windows-amd64;%PATH%
|
||||||
|
|
||||||
|
stack: go 1.11
|
||||||
|
|
||||||
|
build_script:
|
||||||
|
- appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip
|
||||||
|
- 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL
|
||||||
|
- gometalinter.exe --config .gometalinter.json ./...
|
||||||
|
- go build ./cmd/wclayer
|
||||||
|
- go build ./cmd/runhcs
|
||||||
|
- go build ./cmd/tar2ext4
|
||||||
|
- go test -v ./... -tags admin
|
||||||
|
- go test -c ./test/functional/ -tags functional
|
||||||
|
- go test -c ./test/runhcs/ -tags integration
|
||||||
|
|
||||||
|
artifacts:
|
||||||
|
- path: 'wclayer.exe'
|
||||||
|
- path: 'runhcs.exe'
|
||||||
|
- path: 'tar2ext4.exe'
|
||||||
|
- path: 'functional.test.exe'
|
||||||
|
- path: 'runhcs.test.exe'
|
||||||
|
|
@ -0,0 +1,192 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"os"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/mergemaps"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ContainerProperties holds the properties for a container and the processes running in that container
|
||||||
|
type ContainerProperties = schema1.ContainerProperties
|
||||||
|
|
||||||
|
// MemoryStats holds the memory statistics for a container
|
||||||
|
type MemoryStats = schema1.MemoryStats
|
||||||
|
|
||||||
|
// ProcessorStats holds the processor statistics for a container
|
||||||
|
type ProcessorStats = schema1.ProcessorStats
|
||||||
|
|
||||||
|
// StorageStats holds the storage statistics for a container
|
||||||
|
type StorageStats = schema1.StorageStats
|
||||||
|
|
||||||
|
// NetworkStats holds the network statistics for a container
|
||||||
|
type NetworkStats = schema1.NetworkStats
|
||||||
|
|
||||||
|
// Statistics is the structure returned by a statistics call on a container
|
||||||
|
type Statistics = schema1.Statistics
|
||||||
|
|
||||||
|
// ProcessList is the structure of an item returned by a ProcessList call on a container
|
||||||
|
type ProcessListItem = schema1.ProcessListItem
|
||||||
|
|
||||||
|
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
|
||||||
|
type MappedVirtualDiskController = schema1.MappedVirtualDiskController
|
||||||
|
|
||||||
|
// Type of Request Support in ModifySystem
|
||||||
|
type RequestType = schema1.RequestType
|
||||||
|
|
||||||
|
// Type of Resource Support in ModifySystem
|
||||||
|
type ResourceType = schema1.ResourceType
|
||||||
|
|
||||||
|
// RequestType const
|
||||||
|
const (
|
||||||
|
Add = schema1.Add
|
||||||
|
Remove = schema1.Remove
|
||||||
|
Network = schema1.Network
|
||||||
|
)
|
||||||
|
|
||||||
|
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
|
||||||
|
// Supported resource types are Network and Request Types are Add/Remove
|
||||||
|
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
|
||||||
|
|
||||||
|
type container struct {
|
||||||
|
system *hcs.System
|
||||||
|
}
|
||||||
|
|
||||||
|
// createComputeSystemAdditionalJSON is read from the environment at initialisation
|
||||||
|
// time. It allows an environment variable to define additional JSON which
|
||||||
|
// is merged in the CreateComputeSystem call to HCS.
|
||||||
|
var createContainerAdditionalJSON []byte
|
||||||
|
|
||||||
|
func init() {
|
||||||
|
createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
|
||||||
|
}
|
||||||
|
|
||||||
|
// CreateContainer creates a new container with the given configuration but does not start it.
|
||||||
|
func CreateContainer(id string, c *ContainerConfig) (Container, error) {
|
||||||
|
fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
|
||||||
|
if err != nil {
|
||||||
|
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
system, err := hcs.CreateComputeSystem(id, fullConfig)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return &container{system}, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// OpenContainer opens an existing container by ID.
|
||||||
|
func OpenContainer(id string) (Container, error) {
|
||||||
|
system, err := hcs.OpenComputeSystem(id)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return &container{system}, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetContainers gets a list of the containers on the system that match the query
|
||||||
|
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
|
||||||
|
return hcs.GetComputeSystems(q)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Start synchronously starts the container.
|
||||||
|
func (container *container) Start() error {
|
||||||
|
return convertSystemError(container.system.Start(), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||||
|
func (container *container) Shutdown() error {
|
||||||
|
return convertSystemError(container.system.Shutdown(), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||||
|
func (container *container) Terminate() error {
|
||||||
|
return convertSystemError(container.system.Terminate(), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Waits synchronously waits for the container to shutdown or terminate.
|
||||||
|
func (container *container) Wait() error {
|
||||||
|
return convertSystemError(container.system.Wait(), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||||
|
// returns false if timeout occurs.
|
||||||
|
func (container *container) WaitTimeout(t time.Duration) error {
|
||||||
|
return convertSystemError(container.system.WaitTimeout(t), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Pause pauses the execution of a container.
|
||||||
|
func (container *container) Pause() error {
|
||||||
|
return convertSystemError(container.system.Pause(), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Resume resumes the execution of a container.
|
||||||
|
func (container *container) Resume() error {
|
||||||
|
return convertSystemError(container.system.Resume(), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// HasPendingUpdates returns true if the container has updates pending to install
|
||||||
|
func (container *container) HasPendingUpdates() (bool, error) {
|
||||||
|
return false, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Statistics returns statistics for the container. This is a legacy v1 call
|
||||||
|
func (container *container) Statistics() (Statistics, error) {
|
||||||
|
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
|
||||||
|
if err != nil {
|
||||||
|
return Statistics{}, convertSystemError(err, container)
|
||||||
|
}
|
||||||
|
|
||||||
|
return properties.Statistics, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
|
||||||
|
func (container *container) ProcessList() ([]ProcessListItem, error) {
|
||||||
|
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
|
||||||
|
if err != nil {
|
||||||
|
return nil, convertSystemError(err, container)
|
||||||
|
}
|
||||||
|
|
||||||
|
return properties.ProcessList, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// This is a legacy v1 call
|
||||||
|
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
|
||||||
|
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
|
||||||
|
if err != nil {
|
||||||
|
return nil, convertSystemError(err, container)
|
||||||
|
}
|
||||||
|
|
||||||
|
return properties.MappedVirtualDiskControllers, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CreateProcess launches a new process within the container.
|
||||||
|
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
|
||||||
|
p, err := container.system.CreateProcess(c)
|
||||||
|
if err != nil {
|
||||||
|
return nil, convertSystemError(err, container)
|
||||||
|
}
|
||||||
|
return &process{p}, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// OpenProcess gets an interface to an existing process within the container.
|
||||||
|
func (container *container) OpenProcess(pid int) (Process, error) {
|
||||||
|
p, err := container.system.OpenProcess(pid)
|
||||||
|
if err != nil {
|
||||||
|
return nil, convertSystemError(err, container)
|
||||||
|
}
|
||||||
|
return &process{p}, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||||
|
func (container *container) Close() error {
|
||||||
|
return convertSystemError(container.system.Close(), container)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Modify the System
|
||||||
|
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
|
||||||
|
return convertSystemError(container.system.Modify(config), container)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,257 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"syscall"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hns"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hcs"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
|
||||||
|
ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
|
||||||
|
|
||||||
|
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||||
|
ErrElementNotFound = hcs.ErrElementNotFound
|
||||||
|
|
||||||
|
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||||
|
ErrNotSupported = hcs.ErrNotSupported
|
||||||
|
|
||||||
|
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||||
|
// decimal -2147024883 / hex 0x8007000d
|
||||||
|
ErrInvalidData = hcs.ErrInvalidData
|
||||||
|
|
||||||
|
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||||
|
ErrHandleClose = hcs.ErrHandleClose
|
||||||
|
|
||||||
|
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||||
|
ErrAlreadyClosed = hcs.ErrAlreadyClosed
|
||||||
|
|
||||||
|
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||||
|
ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
|
||||||
|
|
||||||
|
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||||
|
ErrInvalidProcessState = hcs.ErrInvalidProcessState
|
||||||
|
|
||||||
|
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||||
|
ErrTimeout = hcs.ErrTimeout
|
||||||
|
|
||||||
|
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||||
|
// a different expected notification
|
||||||
|
ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
|
||||||
|
|
||||||
|
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||||
|
// is lost while waiting for a notification
|
||||||
|
ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
|
||||||
|
|
||||||
|
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||||
|
ErrUnexpectedValue = hcs.ErrUnexpectedValue
|
||||||
|
|
||||||
|
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||||
|
ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
|
||||||
|
|
||||||
|
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||||
|
ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
|
||||||
|
|
||||||
|
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||||
|
ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
|
||||||
|
|
||||||
|
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||||
|
ErrProcNotFound = hcs.ErrProcNotFound
|
||||||
|
|
||||||
|
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||||
|
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||||
|
ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
|
||||||
|
|
||||||
|
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||||
|
ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
|
||||||
|
|
||||||
|
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||||
|
ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
|
||||||
|
|
||||||
|
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||||
|
ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
|
||||||
|
)
|
||||||
|
|
||||||
|
type EndpointNotFoundError = hns.EndpointNotFoundError
|
||||||
|
type NetworkNotFoundError = hns.NetworkNotFoundError
|
||||||
|
|
||||||
|
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||||
|
type ProcessError struct {
|
||||||
|
Process *process
|
||||||
|
Operation string
|
||||||
|
ExtraInfo string
|
||||||
|
Err error
|
||||||
|
Events []hcs.ErrorEvent
|
||||||
|
}
|
||||||
|
|
||||||
|
// ContainerError is an error encountered in HCS during an operation on a Container object
|
||||||
|
type ContainerError struct {
|
||||||
|
Container *container
|
||||||
|
Operation string
|
||||||
|
ExtraInfo string
|
||||||
|
Err error
|
||||||
|
Events []hcs.ErrorEvent
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *ContainerError) Error() string {
|
||||||
|
if e == nil {
|
||||||
|
return "<nil>"
|
||||||
|
}
|
||||||
|
|
||||||
|
if e.Container == nil {
|
||||||
|
return "unexpected nil container for error: " + e.Err.Error()
|
||||||
|
}
|
||||||
|
|
||||||
|
s := "container " + e.Container.system.ID()
|
||||||
|
|
||||||
|
if e.Operation != "" {
|
||||||
|
s += " encountered an error during " + e.Operation
|
||||||
|
}
|
||||||
|
|
||||||
|
switch e.Err.(type) {
|
||||||
|
case nil:
|
||||||
|
break
|
||||||
|
case syscall.Errno:
|
||||||
|
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||||
|
default:
|
||||||
|
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||||
|
}
|
||||||
|
|
||||||
|
for _, ev := range e.Events {
|
||||||
|
s += "\n" + ev.String()
|
||||||
|
}
|
||||||
|
|
||||||
|
if e.ExtraInfo != "" {
|
||||||
|
s += " extra info: " + e.ExtraInfo
|
||||||
|
}
|
||||||
|
|
||||||
|
return s
|
||||||
|
}
|
||||||
|
|
||||||
|
func makeContainerError(container *container, operation string, extraInfo string, err error) error {
|
||||||
|
// Don't double wrap errors
|
||||||
|
if _, ok := err.(*ContainerError); ok {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err}
|
||||||
|
return containerError
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *ProcessError) Error() string {
|
||||||
|
if e == nil {
|
||||||
|
return "<nil>"
|
||||||
|
}
|
||||||
|
|
||||||
|
if e.Process == nil {
|
||||||
|
return "Unexpected nil process for error: " + e.Err.Error()
|
||||||
|
}
|
||||||
|
|
||||||
|
s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
|
||||||
|
if e.Operation != "" {
|
||||||
|
s += " encountered an error during " + e.Operation
|
||||||
|
}
|
||||||
|
|
||||||
|
switch e.Err.(type) {
|
||||||
|
case nil:
|
||||||
|
break
|
||||||
|
case syscall.Errno:
|
||||||
|
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
|
||||||
|
default:
|
||||||
|
s += fmt.Sprintf(": %s", e.Err.Error())
|
||||||
|
}
|
||||||
|
|
||||||
|
for _, ev := range e.Events {
|
||||||
|
s += "\n" + ev.String()
|
||||||
|
}
|
||||||
|
|
||||||
|
return s
|
||||||
|
}
|
||||||
|
|
||||||
|
func makeProcessError(process *process, operation string, extraInfo string, err error) error {
|
||||||
|
// Don't double wrap errors
|
||||||
|
if _, ok := err.(*ProcessError); ok {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err}
|
||||||
|
return processError
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsNotExist checks if an error is caused by the Container or Process not existing.
|
||||||
|
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||||
|
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||||
|
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||||
|
func IsNotExist(err error) bool {
|
||||||
|
if _, ok := err.(EndpointNotFoundError); ok {
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
if _, ok := err.(NetworkNotFoundError); ok {
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
return hcs.IsNotExist(getInnerError(err))
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||||
|
// already closed by a call to the Close() method.
|
||||||
|
func IsAlreadyClosed(err error) bool {
|
||||||
|
return hcs.IsAlreadyClosed(getInnerError(err))
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsPending returns a boolean indicating whether the error is that
|
||||||
|
// the requested operation is being completed in the background.
|
||||||
|
func IsPending(err error) bool {
|
||||||
|
return hcs.IsPending(getInnerError(err))
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||||
|
// a timeout waiting for the operation to complete.
|
||||||
|
func IsTimeout(err error) bool {
|
||||||
|
return hcs.IsTimeout(getInnerError(err))
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||||
|
// a Container or Process being already stopped.
|
||||||
|
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||||
|
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||||
|
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||||
|
func IsAlreadyStopped(err error) bool {
|
||||||
|
return hcs.IsAlreadyStopped(getInnerError(err))
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||||
|
// unsupported platform requests
|
||||||
|
// Note: Currently Unsupported platform requests can be mean either
|
||||||
|
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||||
|
// is thrown from the Platform
|
||||||
|
func IsNotSupported(err error) bool {
|
||||||
|
return hcs.IsNotSupported(getInnerError(err))
|
||||||
|
}
|
||||||
|
|
||||||
|
func getInnerError(err error) error {
|
||||||
|
switch pe := err.(type) {
|
||||||
|
case nil:
|
||||||
|
return nil
|
||||||
|
case *ContainerError:
|
||||||
|
err = pe.Err
|
||||||
|
case *ProcessError:
|
||||||
|
err = pe.Err
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
func convertSystemError(err error, c *container) error {
|
||||||
|
if serr, ok := err.(*hcs.SystemError); ok {
|
||||||
|
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
func convertProcessError(err error, p *process) error {
|
||||||
|
if perr, ok := err.(*hcs.ProcessError); ok {
|
||||||
|
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,12 @@
|
||||||
|
# Requirements so far:
|
||||||
|
# dockerd running
|
||||||
|
# - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar
|
||||||
|
# - image alpine (linux) docker pull --platform=linux alpine
|
||||||
|
|
||||||
|
|
||||||
|
# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true"
|
||||||
|
#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please"
|
||||||
|
|
||||||
|
#pushd uvm
|
||||||
|
go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./...
|
||||||
|
#popd
|
||||||
|
|
@ -0,0 +1,28 @@
|
||||||
|
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||||
|
// containers and Hyper-V containers.
|
||||||
|
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||||
|
)
|
||||||
|
|
||||||
|
//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
|
||||||
|
|
||||||
|
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
|
||||||
|
|
||||||
|
const (
|
||||||
|
// Specific user-visible exit codes
|
||||||
|
WaitErrExecFailed = 32767
|
||||||
|
|
||||||
|
ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
|
||||||
|
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
|
||||||
|
WSAEINVAL = syscall.Errno(10022)
|
||||||
|
|
||||||
|
// Timeout on wait calls
|
||||||
|
TimeoutInfinite = 0xFFFFFFFF
|
||||||
|
)
|
||||||
|
|
||||||
|
type HcsError = hcserror.HcsError
|
||||||
|
|
@ -0,0 +1,94 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hns"
|
||||||
|
)
|
||||||
|
|
||||||
|
// HNSEndpoint represents a network endpoint in HNS
|
||||||
|
type HNSEndpoint = hns.HNSEndpoint
|
||||||
|
|
||||||
|
// Namespace represents a Compartment.
|
||||||
|
type Namespace = hns.Namespace
|
||||||
|
|
||||||
|
//SystemType represents the type of the system on which actions are done
|
||||||
|
type SystemType string
|
||||||
|
|
||||||
|
// SystemType const
|
||||||
|
const (
|
||||||
|
ContainerType SystemType = "Container"
|
||||||
|
VirtualMachineType SystemType = "VirtualMachine"
|
||||||
|
HostType SystemType = "Host"
|
||||||
|
)
|
||||||
|
|
||||||
|
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||||
|
// Supported resource types are Network and Request Types are Add/Remove
|
||||||
|
type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
|
||||||
|
|
||||||
|
// EndpointResquestResponse is object to get the endpoint request response
|
||||||
|
type EndpointResquestResponse = hns.EndpointResquestResponse
|
||||||
|
|
||||||
|
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||||
|
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||||
|
return hns.HNSEndpointRequest(method, path, request)
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||||
|
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||||
|
return hns.HNSListEndpointRequest()
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
|
||||||
|
func HotAttachEndpoint(containerID string, endpointID string) error {
|
||||||
|
return modifyNetworkEndpoint(containerID, endpointID, Add)
|
||||||
|
}
|
||||||
|
|
||||||
|
// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
|
||||||
|
func HotDetachEndpoint(containerID string, endpointID string) error {
|
||||||
|
return modifyNetworkEndpoint(containerID, endpointID, Remove)
|
||||||
|
}
|
||||||
|
|
||||||
|
// ModifyContainer corresponding to the container id, by sending a request
|
||||||
|
func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
|
||||||
|
container, err := OpenContainer(id)
|
||||||
|
if err != nil {
|
||||||
|
if IsNotExist(err) {
|
||||||
|
return ErrComputeSystemDoesNotExist
|
||||||
|
}
|
||||||
|
return getInnerError(err)
|
||||||
|
}
|
||||||
|
defer container.Close()
|
||||||
|
err = container.Modify(request)
|
||||||
|
if err != nil {
|
||||||
|
if IsNotSupported(err) {
|
||||||
|
return ErrPlatformNotSupported
|
||||||
|
}
|
||||||
|
return getInnerError(err)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
|
||||||
|
requestMessage := &ResourceModificationRequestResponse{
|
||||||
|
Resource: Network,
|
||||||
|
Request: request,
|
||||||
|
Data: endpointID,
|
||||||
|
}
|
||||||
|
err := modifyContainer(containerID, requestMessage)
|
||||||
|
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSEndpointByID get the Endpoint by ID
|
||||||
|
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||||
|
return hns.GetHNSEndpointByID(endpointID)
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||||
|
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||||
|
return hns.GetHNSEndpointByName(endpointName)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,16 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hns"
|
||||||
|
)
|
||||||
|
|
||||||
|
type HNSGlobals = hns.HNSGlobals
|
||||||
|
type HNSVersion = hns.HNSVersion
|
||||||
|
|
||||||
|
var (
|
||||||
|
HNSVersion1803 = hns.HNSVersion1803
|
||||||
|
)
|
||||||
|
|
||||||
|
func GetHNSGlobals() (*HNSGlobals, error) {
|
||||||
|
return hns.GetHNSGlobals()
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,36 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hns"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Subnet is assoicated with a network and represents a list
|
||||||
|
// of subnets available to the network
|
||||||
|
type Subnet = hns.Subnet
|
||||||
|
|
||||||
|
// MacPool is assoicated with a network and represents a list
|
||||||
|
// of macaddresses available to the network
|
||||||
|
type MacPool = hns.MacPool
|
||||||
|
|
||||||
|
// HNSNetwork represents a network in HNS
|
||||||
|
type HNSNetwork = hns.HNSNetwork
|
||||||
|
|
||||||
|
// HNSNetworkRequest makes a call into HNS to update/query a single network
|
||||||
|
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
|
||||||
|
return hns.HNSNetworkRequest(method, path, request)
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSListNetworkRequest makes a HNS call to query the list of available networks
|
||||||
|
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
|
||||||
|
return hns.HNSListNetworkRequest(method, path, request)
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSNetworkByID
|
||||||
|
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
|
||||||
|
return hns.GetHNSNetworkByID(networkID)
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSNetworkName filtered by Name
|
||||||
|
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
|
||||||
|
return hns.GetHNSNetworkByName(networkName)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,57 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hns"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Type of Request Support in ModifySystem
|
||||||
|
type PolicyType = hns.PolicyType
|
||||||
|
|
||||||
|
// RequestType const
|
||||||
|
const (
|
||||||
|
Nat = hns.Nat
|
||||||
|
ACL = hns.ACL
|
||||||
|
PA = hns.PA
|
||||||
|
VLAN = hns.VLAN
|
||||||
|
VSID = hns.VSID
|
||||||
|
VNet = hns.VNet
|
||||||
|
L2Driver = hns.L2Driver
|
||||||
|
Isolation = hns.Isolation
|
||||||
|
QOS = hns.QOS
|
||||||
|
OutboundNat = hns.OutboundNat
|
||||||
|
ExternalLoadBalancer = hns.ExternalLoadBalancer
|
||||||
|
Route = hns.Route
|
||||||
|
)
|
||||||
|
|
||||||
|
type NatPolicy = hns.NatPolicy
|
||||||
|
|
||||||
|
type QosPolicy = hns.QosPolicy
|
||||||
|
|
||||||
|
type IsolationPolicy = hns.IsolationPolicy
|
||||||
|
|
||||||
|
type VlanPolicy = hns.VlanPolicy
|
||||||
|
|
||||||
|
type VsidPolicy = hns.VsidPolicy
|
||||||
|
|
||||||
|
type PaPolicy = hns.PaPolicy
|
||||||
|
|
||||||
|
type OutboundNatPolicy = hns.OutboundNatPolicy
|
||||||
|
|
||||||
|
type ActionType = hns.ActionType
|
||||||
|
type DirectionType = hns.DirectionType
|
||||||
|
type RuleType = hns.RuleType
|
||||||
|
|
||||||
|
const (
|
||||||
|
Allow = hns.Allow
|
||||||
|
Block = hns.Block
|
||||||
|
|
||||||
|
In = hns.In
|
||||||
|
Out = hns.Out
|
||||||
|
|
||||||
|
Host = hns.Host
|
||||||
|
Switch = hns.Switch
|
||||||
|
)
|
||||||
|
|
||||||
|
type ACLPolicy = hns.ACLPolicy
|
||||||
|
|
||||||
|
type Policy = hns.Policy
|
||||||
|
|
@ -0,0 +1,47 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hns"
|
||||||
|
)
|
||||||
|
|
||||||
|
// RoutePolicy is a structure defining schema for Route based Policy
|
||||||
|
type RoutePolicy = hns.RoutePolicy
|
||||||
|
|
||||||
|
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
|
||||||
|
type ELBPolicy = hns.ELBPolicy
|
||||||
|
|
||||||
|
// LBPolicy is a structure defining schema for LoadBalancing based Policy
|
||||||
|
type LBPolicy = hns.LBPolicy
|
||||||
|
|
||||||
|
// PolicyList is a structure defining schema for Policy list request
|
||||||
|
type PolicyList = hns.PolicyList
|
||||||
|
|
||||||
|
// HNSPolicyListRequest makes a call into HNS to update/query a single network
|
||||||
|
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||||
|
return hns.HNSPolicyListRequest(method, path, request)
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSListPolicyListRequest gets all the policy list
|
||||||
|
func HNSListPolicyListRequest() ([]PolicyList, error) {
|
||||||
|
return hns.HNSListPolicyListRequest()
|
||||||
|
}
|
||||||
|
|
||||||
|
// PolicyListRequest makes a HNS call to modify/query a network policy list
|
||||||
|
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||||
|
return hns.PolicyListRequest(method, path, request)
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetPolicyListByID get the policy list by ID
|
||||||
|
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
|
||||||
|
return hns.GetPolicyListByID(policyListID)
|
||||||
|
}
|
||||||
|
|
||||||
|
// AddLoadBalancer policy list for the specified endpoints
|
||||||
|
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||||
|
return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||||
|
}
|
||||||
|
|
||||||
|
// AddRoute adds route policy list for the specified endpoints
|
||||||
|
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
|
||||||
|
return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,13 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hns"
|
||||||
|
)
|
||||||
|
|
||||||
|
type HNSSupportedFeatures = hns.HNSSupportedFeatures
|
||||||
|
|
||||||
|
type HNSAclFeatures = hns.HNSAclFeatures
|
||||||
|
|
||||||
|
func GetHNSSupportedFeatures() HNSSupportedFeatures {
|
||||||
|
return hns.GetHNSSupportedFeatures()
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,114 @@
|
||||||
|
package hcsshim
|
||||||
|
|
||||||
|
import (
|
||||||
|
"io"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ProcessConfig is used as both the input of Container.CreateProcess
|
||||||
|
// and to convert the parameters to JSON for passing onto the HCS
|
||||||
|
type ProcessConfig = schema1.ProcessConfig
|
||||||
|
|
||||||
|
type Layer = schema1.Layer
|
||||||
|
type MappedDir = schema1.MappedDir
|
||||||
|
type MappedPipe = schema1.MappedPipe
|
||||||
|
type HvRuntime = schema1.HvRuntime
|
||||||
|
type MappedVirtualDisk = schema1.MappedVirtualDisk
|
||||||
|
|
||||||
|
// AssignedDevice represents a device that has been directly assigned to a container
|
||||||
|
//
|
||||||
|
// NOTE: Support added in RS5
|
||||||
|
type AssignedDevice = schema1.AssignedDevice
|
||||||
|
|
||||||
|
// ContainerConfig is used as both the input of CreateContainer
|
||||||
|
// and to convert the parameters to JSON for passing onto the HCS
|
||||||
|
type ContainerConfig = schema1.ContainerConfig
|
||||||
|
|
||||||
|
type ComputeSystemQuery = schema1.ComputeSystemQuery
|
||||||
|
|
||||||
|
// Container represents a created (but not necessarily running) container.
|
||||||
|
type Container interface {
|
||||||
|
// Start synchronously starts the container.
|
||||||
|
Start() error
|
||||||
|
|
||||||
|
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
|
||||||
|
Shutdown() error
|
||||||
|
|
||||||
|
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
|
||||||
|
Terminate() error
|
||||||
|
|
||||||
|
// Waits synchronously waits for the container to shutdown or terminate.
|
||||||
|
Wait() error
|
||||||
|
|
||||||
|
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
|
||||||
|
// returns false if timeout occurs.
|
||||||
|
WaitTimeout(time.Duration) error
|
||||||
|
|
||||||
|
// Pause pauses the execution of a container.
|
||||||
|
Pause() error
|
||||||
|
|
||||||
|
// Resume resumes the execution of a container.
|
||||||
|
Resume() error
|
||||||
|
|
||||||
|
// HasPendingUpdates returns true if the container has updates pending to install.
|
||||||
|
HasPendingUpdates() (bool, error)
|
||||||
|
|
||||||
|
// Statistics returns statistics for a container.
|
||||||
|
Statistics() (Statistics, error)
|
||||||
|
|
||||||
|
// ProcessList returns details for the processes in a container.
|
||||||
|
ProcessList() ([]ProcessListItem, error)
|
||||||
|
|
||||||
|
// MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller
|
||||||
|
MappedVirtualDisks() (map[int]MappedVirtualDiskController, error)
|
||||||
|
|
||||||
|
// CreateProcess launches a new process within the container.
|
||||||
|
CreateProcess(c *ProcessConfig) (Process, error)
|
||||||
|
|
||||||
|
// OpenProcess gets an interface to an existing process within the container.
|
||||||
|
OpenProcess(pid int) (Process, error)
|
||||||
|
|
||||||
|
// Close cleans up any state associated with the container but does not terminate or wait for it.
|
||||||
|
Close() error
|
||||||
|
|
||||||
|
// Modify the System
|
||||||
|
Modify(config *ResourceModificationRequestResponse) error
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process represents a running or exited process.
|
||||||
|
type Process interface {
|
||||||
|
// Pid returns the process ID of the process within the container.
|
||||||
|
Pid() int
|
||||||
|
|
||||||
|
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||||
|
Kill() error
|
||||||
|
|
||||||
|
// Wait waits for the process to exit.
|
||||||
|
Wait() error
|
||||||
|
|
||||||
|
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||||
|
// false if timeout occurs.
|
||||||
|
WaitTimeout(time.Duration) error
|
||||||
|
|
||||||
|
// ExitCode returns the exit code of the process. The process must have
|
||||||
|
// already terminated.
|
||||||
|
ExitCode() (int, error)
|
||||||
|
|
||||||
|
// ResizeConsole resizes the console of the process.
|
||||||
|
ResizeConsole(width, height uint16) error
|
||||||
|
|
||||||
|
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||||
|
// these pipes does not close the underlying pipes; it should be possible to
|
||||||
|
// call this multiple times to get multiple interfaces.
|
||||||
|
Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error)
|
||||||
|
|
||||||
|
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||||
|
// notified on the read side that there is no more data in stdin.
|
||||||
|
CloseStdin() error
|
||||||
|
|
||||||
|
// Close cleans up any state associated with the process but does not kill
|
||||||
|
// or wait on it.
|
||||||
|
Close() error
|
||||||
|
}
|
||||||
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
100
vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go
generated
vendored
Normal file
|
|
@ -0,0 +1,100 @@
|
||||||
|
package guestrequest
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Arguably, many of these (at least CombinedLayers) should have been generated
|
||||||
|
// by swagger.
|
||||||
|
//
|
||||||
|
// This will also change package name due to an inbound breaking change.
|
||||||
|
|
||||||
|
// This class is used by a modify request to add or remove a combined layers
|
||||||
|
// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
|
||||||
|
// using the specified layers as the parent content. Ignores property ScratchPath
|
||||||
|
// since the container path is already the scratch path. For linux, the GCS unions
|
||||||
|
// the specified layers and ScratchPath together, placing the resulting union
|
||||||
|
// filesystem at ContainerRootPath.
|
||||||
|
type CombinedLayers struct {
|
||||||
|
ContainerRootPath string `json:"ContainerRootPath,omitempty"`
|
||||||
|
Layers []hcsschema.Layer `json:"Layers,omitempty"`
|
||||||
|
ScratchPath string `json:"ScratchPath,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Defines the schema for hosted settings passed to GCS and/or OpenGCS
|
||||||
|
|
||||||
|
// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
|
||||||
|
type LCOWMappedVirtualDisk struct {
|
||||||
|
MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
|
||||||
|
Lun uint8 `json:"Lun,omitempty"`
|
||||||
|
Controller uint8 `json:"Controller,omitempty"`
|
||||||
|
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type WCOWMappedVirtualDisk struct {
|
||||||
|
ContainerPath string `json:"ContainerPath,omitempty"`
|
||||||
|
Lun int32 `json:"Lun,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type LCOWMappedDirectory struct {
|
||||||
|
MountPath string `json:"MountPath,omitempty"`
|
||||||
|
Port int32 `json:"Port,omitempty"`
|
||||||
|
ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
|
||||||
|
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Read-only layers over VPMem
|
||||||
|
type LCOWMappedVPMemDevice struct {
|
||||||
|
DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
|
||||||
|
MountPath string `json:"MountPath,omitempty"` // /tmp/pN
|
||||||
|
}
|
||||||
|
|
||||||
|
type LCOWNetworkAdapter struct {
|
||||||
|
NamespaceID string `json:",omitempty"`
|
||||||
|
ID string `json:",omitempty"`
|
||||||
|
MacAddress string `json:",omitempty"`
|
||||||
|
IPAddress string `json:",omitempty"`
|
||||||
|
PrefixLength uint8 `json:",omitempty"`
|
||||||
|
GatewayAddress string `json:",omitempty"`
|
||||||
|
DNSSuffix string `json:",omitempty"`
|
||||||
|
DNSServerList string `json:",omitempty"`
|
||||||
|
EnableLowMetric bool `json:",omitempty"`
|
||||||
|
EncapOverhead uint16 `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type ResourceType string
|
||||||
|
|
||||||
|
const (
|
||||||
|
// These are constants for v2 schema modify guest requests.
|
||||||
|
ResourceTypeMappedDirectory ResourceType = "MappedDirectory"
|
||||||
|
ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
|
||||||
|
ResourceTypeNetwork ResourceType = "Network"
|
||||||
|
ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace"
|
||||||
|
ResourceTypeCombinedLayers ResourceType = "CombinedLayers"
|
||||||
|
ResourceTypeVPMemDevice ResourceType = "VPMemDevice"
|
||||||
|
)
|
||||||
|
|
||||||
|
// GuestRequest is for modify commands passed to the guest.
|
||||||
|
type GuestRequest struct {
|
||||||
|
RequestType string `json:"RequestType,omitempty"`
|
||||||
|
ResourceType ResourceType `json:"ResourceType,omitempty"`
|
||||||
|
Settings interface{} `json:"Settings,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type NetworkModifyRequest struct {
|
||||||
|
AdapterId string `json:"AdapterId,omitempty"`
|
||||||
|
RequestType string `json:"RequestType,omitempty"`
|
||||||
|
Settings interface{} `json:"Settings,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type RS4NetworkModifyRequest struct {
|
||||||
|
AdapterInstanceId string `json:"AdapterInstanceId,omitempty"`
|
||||||
|
RequestType string `json:"RequestType,omitempty"`
|
||||||
|
Settings interface{} `json:"Settings,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// SignalProcessOptions is the options passed to either WCOW or LCOW
|
||||||
|
// to signal a given process.
|
||||||
|
type SignalProcessOptions struct {
|
||||||
|
Signal int `json:,omitempty`
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,69 @@
|
||||||
|
package guid
|
||||||
|
|
||||||
|
import (
|
||||||
|
"crypto/rand"
|
||||||
|
"encoding/json"
|
||||||
|
"fmt"
|
||||||
|
"io"
|
||||||
|
"strconv"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
var _ = (json.Marshaler)(&GUID{})
|
||||||
|
var _ = (json.Unmarshaler)(&GUID{})
|
||||||
|
|
||||||
|
type GUID [16]byte
|
||||||
|
|
||||||
|
func New() GUID {
|
||||||
|
g := GUID{}
|
||||||
|
_, err := io.ReadFull(rand.Reader, g[:])
|
||||||
|
if err != nil {
|
||||||
|
panic(err)
|
||||||
|
}
|
||||||
|
return g
|
||||||
|
}
|
||||||
|
|
||||||
|
func (g GUID) String() string {
|
||||||
|
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
|
||||||
|
}
|
||||||
|
|
||||||
|
func FromString(s string) GUID {
|
||||||
|
if len(s) != 36 {
|
||||||
|
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
|
||||||
|
}
|
||||||
|
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
|
||||||
|
panic("invalid GUID format")
|
||||||
|
}
|
||||||
|
indexOrder := [16]int{
|
||||||
|
0, 2, 4, 6,
|
||||||
|
9, 11,
|
||||||
|
14, 16,
|
||||||
|
19, 21,
|
||||||
|
24, 26, 28, 30, 32, 34,
|
||||||
|
}
|
||||||
|
byteOrder := [16]int{
|
||||||
|
3, 2, 1, 0,
|
||||||
|
5, 4,
|
||||||
|
7, 6,
|
||||||
|
8, 9,
|
||||||
|
10, 11, 12, 13, 14, 15,
|
||||||
|
}
|
||||||
|
var g GUID
|
||||||
|
for i, x := range indexOrder {
|
||||||
|
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
|
||||||
|
if err != nil {
|
||||||
|
panic(err)
|
||||||
|
}
|
||||||
|
g[byteOrder[i]] = byte(b)
|
||||||
|
}
|
||||||
|
return g
|
||||||
|
}
|
||||||
|
|
||||||
|
func (g GUID) MarshalJSON() ([]byte, error) {
|
||||||
|
return json.Marshal(g.String())
|
||||||
|
}
|
||||||
|
|
||||||
|
func (g *GUID) UnmarshalJSON(data []byte) error {
|
||||||
|
*g = FromString(strings.Trim(string(data), "\""))
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,104 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"sync"
|
||||||
|
"syscall"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/interop"
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
nextCallback uintptr
|
||||||
|
callbackMap = map[uintptr]*notifcationWatcherContext{}
|
||||||
|
callbackMapLock = sync.RWMutex{}
|
||||||
|
|
||||||
|
notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
|
||||||
|
|
||||||
|
// Notifications for HCS_SYSTEM handles
|
||||||
|
hcsNotificationSystemExited hcsNotification = 0x00000001
|
||||||
|
hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002
|
||||||
|
hcsNotificationSystemStartCompleted hcsNotification = 0x00000003
|
||||||
|
hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004
|
||||||
|
hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005
|
||||||
|
hcsNotificationSystemCrashReport hcsNotification = 0x00000006
|
||||||
|
hcsNotificationSystemSiloJobCreated hcsNotification = 0x00000007
|
||||||
|
hcsNotificationSystemSaveCompleted hcsNotification = 0x00000008
|
||||||
|
hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009
|
||||||
|
hcsNotificationSystemShutdownFailed hcsNotification = 0x0000000A
|
||||||
|
hcsNotificationSystemGetPropertiesCompleted hcsNotification = 0x0000000B
|
||||||
|
hcsNotificationSystemModifyCompleted hcsNotification = 0x0000000C
|
||||||
|
hcsNotificationSystemCrashInitiated hcsNotification = 0x0000000D
|
||||||
|
hcsNotificationSystemGuestConnectionClosed hcsNotification = 0x0000000E
|
||||||
|
|
||||||
|
// Notifications for HCS_PROCESS handles
|
||||||
|
hcsNotificationProcessExited hcsNotification = 0x00010000
|
||||||
|
|
||||||
|
// Common notifications
|
||||||
|
hcsNotificationInvalid hcsNotification = 0x00000000
|
||||||
|
hcsNotificationServiceDisconnect hcsNotification = 0x01000000
|
||||||
|
)
|
||||||
|
|
||||||
|
type hcsNotification uint32
|
||||||
|
type notificationChannel chan error
|
||||||
|
|
||||||
|
type notifcationWatcherContext struct {
|
||||||
|
channels notificationChannels
|
||||||
|
handle hcsCallback
|
||||||
|
}
|
||||||
|
|
||||||
|
type notificationChannels map[hcsNotification]notificationChannel
|
||||||
|
|
||||||
|
func newChannels() notificationChannels {
|
||||||
|
channels := make(notificationChannels)
|
||||||
|
|
||||||
|
channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
|
||||||
|
channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
|
||||||
|
|
||||||
|
return channels
|
||||||
|
}
|
||||||
|
|
||||||
|
func closeChannels(channels notificationChannels) {
|
||||||
|
for _, c := range channels {
|
||||||
|
close(c)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
|
||||||
|
var result error
|
||||||
|
if int32(notificationStatus) < 0 {
|
||||||
|
result = interop.Win32FromHresult(notificationStatus)
|
||||||
|
}
|
||||||
|
|
||||||
|
callbackMapLock.RLock()
|
||||||
|
context := callbackMap[callbackNumber]
|
||||||
|
callbackMapLock.RUnlock()
|
||||||
|
|
||||||
|
if context == nil {
|
||||||
|
return 0
|
||||||
|
}
|
||||||
|
|
||||||
|
if channel, ok := context.channels[notificationType]; ok {
|
||||||
|
channel <- result
|
||||||
|
} else {
|
||||||
|
logrus.WithFields(logrus.Fields{
|
||||||
|
"notification-type": notificationType,
|
||||||
|
}).Warn("Received a callback of an unsupported type")
|
||||||
|
}
|
||||||
|
|
||||||
|
return 0
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,7 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import "C"
|
||||||
|
|
||||||
|
// This import is needed to make the library compile as CGO because HCSSHIM
|
||||||
|
// only works with CGO due to callbacks from HCS comming back from a C thread
|
||||||
|
// which is not supported without CGO. See https://github.com/golang/go/issues/10973
|
||||||
|
|
@ -0,0 +1,287 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"errors"
|
||||||
|
"fmt"
|
||||||
|
"syscall"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/interop"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
|
||||||
|
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
|
||||||
|
|
||||||
|
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||||
|
ErrElementNotFound = syscall.Errno(0x490)
|
||||||
|
|
||||||
|
// ErrElementNotFound is an error encountered when the object being referenced does not exist
|
||||||
|
ErrNotSupported = syscall.Errno(0x32)
|
||||||
|
|
||||||
|
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
|
||||||
|
// decimal -2147024883 / hex 0x8007000d
|
||||||
|
ErrInvalidData = syscall.Errno(0xd)
|
||||||
|
|
||||||
|
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
|
||||||
|
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
|
||||||
|
|
||||||
|
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
|
||||||
|
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
|
||||||
|
|
||||||
|
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
|
||||||
|
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
|
||||||
|
|
||||||
|
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
|
||||||
|
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
|
||||||
|
|
||||||
|
// ErrTimeout is an error encountered when waiting on a notification times out
|
||||||
|
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
|
||||||
|
|
||||||
|
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
|
||||||
|
// a different expected notification
|
||||||
|
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
|
||||||
|
|
||||||
|
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
|
||||||
|
// is lost while waiting for a notification
|
||||||
|
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
|
||||||
|
|
||||||
|
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
|
||||||
|
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
|
||||||
|
|
||||||
|
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
|
||||||
|
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
|
||||||
|
|
||||||
|
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
|
||||||
|
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
|
||||||
|
|
||||||
|
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
|
||||||
|
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
|
||||||
|
|
||||||
|
// ErrProcNotFound is an error encountered when the the process cannot be found
|
||||||
|
ErrProcNotFound = syscall.Errno(0x7f)
|
||||||
|
|
||||||
|
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
|
||||||
|
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
|
||||||
|
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
|
||||||
|
|
||||||
|
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
|
||||||
|
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
|
||||||
|
|
||||||
|
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
|
||||||
|
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
|
||||||
|
|
||||||
|
// ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly
|
||||||
|
ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106)
|
||||||
|
|
||||||
|
// ErrNotSupported is an error encountered when hcs doesn't support the request
|
||||||
|
ErrPlatformNotSupported = errors.New("unsupported platform request")
|
||||||
|
)
|
||||||
|
|
||||||
|
type ErrorEvent struct {
|
||||||
|
Message string `json:"Message,omitempty"` // Fully formated error message
|
||||||
|
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
|
||||||
|
Provider string `json:"Provider,omitempty"`
|
||||||
|
EventID uint16 `json:"EventId,omitempty"`
|
||||||
|
Flags uint32 `json:"Flags,omitempty"`
|
||||||
|
Source string `json:"Source,omitempty"`
|
||||||
|
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
|
||||||
|
}
|
||||||
|
|
||||||
|
type hcsResult struct {
|
||||||
|
Error int32
|
||||||
|
ErrorMessage string
|
||||||
|
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ev *ErrorEvent) String() string {
|
||||||
|
evs := "[Event Detail: " + ev.Message
|
||||||
|
if ev.StackTrace != "" {
|
||||||
|
evs += " Stack Trace: " + ev.StackTrace
|
||||||
|
}
|
||||||
|
if ev.Provider != "" {
|
||||||
|
evs += " Provider: " + ev.Provider
|
||||||
|
}
|
||||||
|
if ev.EventID != 0 {
|
||||||
|
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
|
||||||
|
}
|
||||||
|
if ev.Flags != 0 {
|
||||||
|
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
|
||||||
|
}
|
||||||
|
if ev.Source != "" {
|
||||||
|
evs += " Source: " + ev.Source
|
||||||
|
}
|
||||||
|
evs += "]"
|
||||||
|
return evs
|
||||||
|
}
|
||||||
|
|
||||||
|
func processHcsResult(resultp *uint16) []ErrorEvent {
|
||||||
|
if resultp != nil {
|
||||||
|
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
|
||||||
|
logrus.WithField(logfields.JSON, resultj).
|
||||||
|
Debug("HCS Result")
|
||||||
|
result := &hcsResult{}
|
||||||
|
if err := json.Unmarshal([]byte(resultj), result); err != nil {
|
||||||
|
logrus.WithFields(logrus.Fields{
|
||||||
|
logfields.JSON: resultj,
|
||||||
|
logrus.ErrorKey: err,
|
||||||
|
}).Warning("Could not unmarshal HCS result")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return result.ErrorEvents
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
type HcsError struct {
|
||||||
|
Op string
|
||||||
|
Err error
|
||||||
|
Events []ErrorEvent
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *HcsError) Error() string {
|
||||||
|
s := e.Op + ": " + e.Err.Error()
|
||||||
|
for _, ev := range e.Events {
|
||||||
|
s += "\n" + ev.String()
|
||||||
|
}
|
||||||
|
return s
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProcessError is an error encountered in HCS during an operation on a Process object
|
||||||
|
type ProcessError struct {
|
||||||
|
SystemID string
|
||||||
|
Pid int
|
||||||
|
Op string
|
||||||
|
Err error
|
||||||
|
Events []ErrorEvent
|
||||||
|
}
|
||||||
|
|
||||||
|
// SystemError is an error encountered in HCS during an operation on a Container object
|
||||||
|
type SystemError struct {
|
||||||
|
ID string
|
||||||
|
Op string
|
||||||
|
Err error
|
||||||
|
Extra string
|
||||||
|
Events []ErrorEvent
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *SystemError) Error() string {
|
||||||
|
s := e.Op + " " + e.ID + ": " + e.Err.Error()
|
||||||
|
for _, ev := range e.Events {
|
||||||
|
s += "\n" + ev.String()
|
||||||
|
}
|
||||||
|
if e.Extra != "" {
|
||||||
|
s += "\n(extra info: " + e.Extra + ")"
|
||||||
|
}
|
||||||
|
return s
|
||||||
|
}
|
||||||
|
|
||||||
|
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
|
||||||
|
// Don't double wrap errors
|
||||||
|
if _, ok := err.(*SystemError); ok {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return &SystemError{
|
||||||
|
ID: system.ID(),
|
||||||
|
Op: op,
|
||||||
|
Extra: extra,
|
||||||
|
Err: err,
|
||||||
|
Events: events,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *ProcessError) Error() string {
|
||||||
|
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
|
||||||
|
for _, ev := range e.Events {
|
||||||
|
s += "\n" + ev.String()
|
||||||
|
}
|
||||||
|
return s
|
||||||
|
}
|
||||||
|
|
||||||
|
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
|
||||||
|
// Don't double wrap errors
|
||||||
|
if _, ok := err.(*ProcessError); ok {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return &ProcessError{
|
||||||
|
Pid: process.Pid(),
|
||||||
|
SystemID: process.SystemID(),
|
||||||
|
Op: op,
|
||||||
|
Err: err,
|
||||||
|
Events: events,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsNotExist checks if an error is caused by the Container or Process not existing.
|
||||||
|
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||||
|
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||||
|
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||||
|
func IsNotExist(err error) bool {
|
||||||
|
err = getInnerError(err)
|
||||||
|
return err == ErrComputeSystemDoesNotExist ||
|
||||||
|
err == ErrElementNotFound ||
|
||||||
|
err == ErrProcNotFound
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
|
||||||
|
// already closed by a call to the Close() method.
|
||||||
|
func IsAlreadyClosed(err error) bool {
|
||||||
|
err = getInnerError(err)
|
||||||
|
return err == ErrAlreadyClosed
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsPending returns a boolean indicating whether the error is that
|
||||||
|
// the requested operation is being completed in the background.
|
||||||
|
func IsPending(err error) bool {
|
||||||
|
err = getInnerError(err)
|
||||||
|
return err == ErrVmcomputeOperationPending
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsTimeout returns a boolean indicating whether the error is caused by
|
||||||
|
// a timeout waiting for the operation to complete.
|
||||||
|
func IsTimeout(err error) bool {
|
||||||
|
err = getInnerError(err)
|
||||||
|
return err == ErrTimeout
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
|
||||||
|
// a Container or Process being already stopped.
|
||||||
|
// Note: Currently, ErrElementNotFound can mean that a Process has either
|
||||||
|
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
|
||||||
|
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
|
||||||
|
func IsAlreadyStopped(err error) bool {
|
||||||
|
err = getInnerError(err)
|
||||||
|
return err == ErrVmcomputeAlreadyStopped ||
|
||||||
|
err == ErrElementNotFound ||
|
||||||
|
err == ErrProcNotFound
|
||||||
|
}
|
||||||
|
|
||||||
|
// IsNotSupported returns a boolean indicating whether the error is caused by
|
||||||
|
// unsupported platform requests
|
||||||
|
// Note: Currently Unsupported platform requests can be mean either
|
||||||
|
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
|
||||||
|
// is thrown from the Platform
|
||||||
|
func IsNotSupported(err error) bool {
|
||||||
|
err = getInnerError(err)
|
||||||
|
// If Platform doesn't recognize or support the request sent, below errors are seen
|
||||||
|
return err == ErrVmcomputeInvalidJSON ||
|
||||||
|
err == ErrInvalidData ||
|
||||||
|
err == ErrNotSupported ||
|
||||||
|
err == ErrVmcomputeUnknownMessage
|
||||||
|
}
|
||||||
|
|
||||||
|
func getInnerError(err error) error {
|
||||||
|
switch pe := err.(type) {
|
||||||
|
case nil:
|
||||||
|
return nil
|
||||||
|
case *HcsError:
|
||||||
|
err = pe.Err
|
||||||
|
case *SystemError:
|
||||||
|
err = pe.Err
|
||||||
|
case *ProcessError:
|
||||||
|
err = pe.Err
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,48 @@
|
||||||
|
// Shim for the Host Compute Service (HCS) to manage Windows Server
|
||||||
|
// containers and Hyper-V containers.
|
||||||
|
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
)
|
||||||
|
|
||||||
|
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
|
||||||
|
|
||||||
|
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
|
||||||
|
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
|
||||||
|
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
|
||||||
|
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
|
||||||
|
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
|
||||||
|
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
|
||||||
|
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
|
||||||
|
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
|
||||||
|
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
|
||||||
|
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
|
||||||
|
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
|
||||||
|
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
|
||||||
|
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
|
||||||
|
|
||||||
|
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
|
||||||
|
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
|
||||||
|
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
|
||||||
|
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||||
|
//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
|
||||||
|
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
|
||||||
|
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
|
||||||
|
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
|
||||||
|
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
|
||||||
|
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
|
||||||
|
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
|
||||||
|
|
||||||
|
type hcsSystem syscall.Handle
|
||||||
|
type hcsProcess syscall.Handle
|
||||||
|
type hcsCallback syscall.Handle
|
||||||
|
|
||||||
|
type hcsProcessInformation struct {
|
||||||
|
ProcessId uint32
|
||||||
|
Reserved uint32
|
||||||
|
StdInput syscall.Handle
|
||||||
|
StdOutput syscall.Handle
|
||||||
|
StdError syscall.Handle
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,20 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import "github.com/sirupsen/logrus"
|
||||||
|
|
||||||
|
func logOperationBegin(ctx logrus.Fields, msg string) {
|
||||||
|
logrus.WithFields(ctx).Debug(msg)
|
||||||
|
}
|
||||||
|
|
||||||
|
func logOperationEnd(ctx logrus.Fields, msg string, err error) {
|
||||||
|
// Copy the log and fields first.
|
||||||
|
log := logrus.WithFields(ctx)
|
||||||
|
if err == nil {
|
||||||
|
log.Debug(msg)
|
||||||
|
} else {
|
||||||
|
// Edit only the copied field data to avoid race conditions on the
|
||||||
|
// write.
|
||||||
|
log.Data[logrus.ErrorKey] = err
|
||||||
|
log.Error(msg)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,459 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"io"
|
||||||
|
"sync"
|
||||||
|
"syscall"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/guestrequest"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/interop"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ContainerError is an error encountered in HCS
|
||||||
|
type Process struct {
|
||||||
|
handleLock sync.RWMutex
|
||||||
|
handle hcsProcess
|
||||||
|
processID int
|
||||||
|
system *System
|
||||||
|
cachedPipes *cachedPipes
|
||||||
|
callbackNumber uintptr
|
||||||
|
|
||||||
|
logctx logrus.Fields
|
||||||
|
}
|
||||||
|
|
||||||
|
func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
|
||||||
|
return &Process{
|
||||||
|
handle: process,
|
||||||
|
processID: processID,
|
||||||
|
system: computeSystem,
|
||||||
|
logctx: logrus.Fields{
|
||||||
|
logfields.ContainerID: computeSystem.ID(),
|
||||||
|
logfields.ProcessID: processID,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
type cachedPipes struct {
|
||||||
|
stdIn syscall.Handle
|
||||||
|
stdOut syscall.Handle
|
||||||
|
stdErr syscall.Handle
|
||||||
|
}
|
||||||
|
|
||||||
|
type processModifyRequest struct {
|
||||||
|
Operation string
|
||||||
|
ConsoleSize *consoleSize `json:",omitempty"`
|
||||||
|
CloseHandle *closeHandle `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type consoleSize struct {
|
||||||
|
Height uint16
|
||||||
|
Width uint16
|
||||||
|
}
|
||||||
|
|
||||||
|
type closeHandle struct {
|
||||||
|
Handle string
|
||||||
|
}
|
||||||
|
|
||||||
|
type ProcessStatus struct {
|
||||||
|
ProcessID uint32
|
||||||
|
Exited bool
|
||||||
|
ExitCode uint32
|
||||||
|
LastWaitResult int32
|
||||||
|
}
|
||||||
|
|
||||||
|
const (
|
||||||
|
stdIn string = "StdIn"
|
||||||
|
stdOut string = "StdOut"
|
||||||
|
stdErr string = "StdErr"
|
||||||
|
)
|
||||||
|
|
||||||
|
const (
|
||||||
|
modifyConsoleSize string = "ConsoleSize"
|
||||||
|
modifyCloseHandle string = "CloseHandle"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Pid returns the process ID of the process within the container.
|
||||||
|
func (process *Process) Pid() int {
|
||||||
|
return process.processID
|
||||||
|
}
|
||||||
|
|
||||||
|
// SystemID returns the ID of the process's compute system.
|
||||||
|
func (process *Process) SystemID() string {
|
||||||
|
return process.system.ID()
|
||||||
|
}
|
||||||
|
|
||||||
|
func (process *Process) logOperationBegin(operation string) {
|
||||||
|
logOperationBegin(
|
||||||
|
process.logctx,
|
||||||
|
operation+" - Begin Operation")
|
||||||
|
}
|
||||||
|
|
||||||
|
func (process *Process) logOperationEnd(operation string, err error) {
|
||||||
|
var result string
|
||||||
|
if err == nil {
|
||||||
|
result = "Success"
|
||||||
|
} else {
|
||||||
|
result = "Error"
|
||||||
|
}
|
||||||
|
|
||||||
|
logOperationEnd(
|
||||||
|
process.logctx,
|
||||||
|
operation+" - End Operation - "+result,
|
||||||
|
err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Signal signals the process with `options`.
|
||||||
|
func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
|
||||||
|
process.handleLock.RLock()
|
||||||
|
defer process.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::Process::Signal"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if process.handle == 0 {
|
||||||
|
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
optionsb, err := json.Marshal(options)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
optionsStr := string(optionsb)
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(process.logctx, func() {
|
||||||
|
err = hcsSignalProcess(process.handle, optionsStr, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return makeProcessError(process, operation, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Kill signals the process to terminate but does not wait for it to finish terminating.
|
||||||
|
func (process *Process) Kill() (err error) {
|
||||||
|
process.handleLock.RLock()
|
||||||
|
defer process.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::Process::Kill"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if process.handle == 0 {
|
||||||
|
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(process.logctx, func() {
|
||||||
|
err = hcsTerminateProcess(process.handle, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return makeProcessError(process, operation, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Wait waits for the process to exit.
|
||||||
|
func (process *Process) Wait() (err error) {
|
||||||
|
operation := "hcsshim::Process::Wait"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
|
||||||
|
if err != nil {
|
||||||
|
return makeProcessError(process, operation, err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
|
||||||
|
// false if timeout occurs.
|
||||||
|
func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
|
||||||
|
operation := "hcssshim::Process::WaitTimeout"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
|
||||||
|
if err != nil {
|
||||||
|
return makeProcessError(process, operation, err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ResizeConsole resizes the console of the process.
|
||||||
|
func (process *Process) ResizeConsole(width, height uint16) (err error) {
|
||||||
|
process.handleLock.RLock()
|
||||||
|
defer process.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::Process::ResizeConsole"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if process.handle == 0 {
|
||||||
|
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
modifyRequest := processModifyRequest{
|
||||||
|
Operation: modifyConsoleSize,
|
||||||
|
ConsoleSize: &consoleSize{
|
||||||
|
Height: height,
|
||||||
|
Width: width,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
modifyRequestStr := string(modifyRequestb)
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return makeProcessError(process, operation, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (process *Process) Properties() (_ *ProcessStatus, err error) {
|
||||||
|
process.handleLock.RLock()
|
||||||
|
defer process.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::Process::Properties"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if process.handle == 0 {
|
||||||
|
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
resultp *uint16
|
||||||
|
propertiesp *uint16
|
||||||
|
)
|
||||||
|
syscallWatcher(process.logctx, func() {
|
||||||
|
err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return nil, makeProcessError(process, operation, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
if propertiesp == nil {
|
||||||
|
return nil, ErrUnexpectedValue
|
||||||
|
}
|
||||||
|
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||||
|
|
||||||
|
properties := &ProcessStatus{}
|
||||||
|
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||||
|
return nil, makeProcessError(process, operation, err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return properties, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ExitCode returns the exit code of the process. The process must have
|
||||||
|
// already terminated.
|
||||||
|
func (process *Process) ExitCode() (_ int, err error) {
|
||||||
|
operation := "hcsshim::Process::ExitCode"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
properties, err := process.Properties()
|
||||||
|
if err != nil {
|
||||||
|
return 0, makeProcessError(process, operation, err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
if properties.Exited == false {
|
||||||
|
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
if properties.LastWaitResult != 0 {
|
||||||
|
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return int(properties.ExitCode), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
|
||||||
|
// these pipes does not close the underlying pipes; it should be possible to
|
||||||
|
// call this multiple times to get multiple interfaces.
|
||||||
|
func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
|
||||||
|
process.handleLock.RLock()
|
||||||
|
defer process.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::Process::Stdio"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if process.handle == 0 {
|
||||||
|
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
var stdIn, stdOut, stdErr syscall.Handle
|
||||||
|
|
||||||
|
if process.cachedPipes == nil {
|
||||||
|
var (
|
||||||
|
processInfo hcsProcessInformation
|
||||||
|
resultp *uint16
|
||||||
|
)
|
||||||
|
err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return nil, nil, nil, makeProcessError(process, operation, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
|
||||||
|
} else {
|
||||||
|
// Use cached pipes
|
||||||
|
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
|
||||||
|
|
||||||
|
// Invalidate the cache
|
||||||
|
process.cachedPipes = nil
|
||||||
|
}
|
||||||
|
|
||||||
|
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
|
||||||
|
if err != nil {
|
||||||
|
return nil, nil, nil, makeProcessError(process, operation, err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return pipes[0], pipes[1], pipes[2], nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CloseStdin closes the write side of the stdin pipe so that the process is
|
||||||
|
// notified on the read side that there is no more data in stdin.
|
||||||
|
func (process *Process) CloseStdin() (err error) {
|
||||||
|
process.handleLock.RLock()
|
||||||
|
defer process.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::Process::CloseStdin"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if process.handle == 0 {
|
||||||
|
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
modifyRequest := processModifyRequest{
|
||||||
|
Operation: modifyCloseHandle,
|
||||||
|
CloseHandle: &closeHandle{
|
||||||
|
Handle: stdIn,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
modifyRequestb, err := json.Marshal(modifyRequest)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
modifyRequestStr := string(modifyRequestb)
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return makeProcessError(process, operation, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Close cleans up any state associated with the process but does not kill
|
||||||
|
// or wait on it.
|
||||||
|
func (process *Process) Close() (err error) {
|
||||||
|
process.handleLock.Lock()
|
||||||
|
defer process.handleLock.Unlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::Process::Close"
|
||||||
|
process.logOperationBegin(operation)
|
||||||
|
defer func() { process.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
// Don't double free this
|
||||||
|
if process.handle == 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
if err = process.unregisterCallback(); err != nil {
|
||||||
|
return makeProcessError(process, operation, err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
if err = hcsCloseProcess(process.handle); err != nil {
|
||||||
|
return makeProcessError(process, operation, err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
process.handle = 0
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (process *Process) registerCallback() error {
|
||||||
|
context := ¬ifcationWatcherContext{
|
||||||
|
channels: newChannels(),
|
||||||
|
}
|
||||||
|
|
||||||
|
callbackMapLock.Lock()
|
||||||
|
callbackNumber := nextCallback
|
||||||
|
nextCallback++
|
||||||
|
callbackMap[callbackNumber] = context
|
||||||
|
callbackMapLock.Unlock()
|
||||||
|
|
||||||
|
var callbackHandle hcsCallback
|
||||||
|
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
context.handle = callbackHandle
|
||||||
|
process.callbackNumber = callbackNumber
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (process *Process) unregisterCallback() error {
|
||||||
|
callbackNumber := process.callbackNumber
|
||||||
|
|
||||||
|
callbackMapLock.RLock()
|
||||||
|
context := callbackMap[callbackNumber]
|
||||||
|
callbackMapLock.RUnlock()
|
||||||
|
|
||||||
|
if context == nil {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
handle := context.handle
|
||||||
|
|
||||||
|
if handle == 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// hcsUnregisterProcessCallback has its own syncronization
|
||||||
|
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||||
|
err := hcsUnregisterProcessCallback(handle)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
closeChannels(context.channels)
|
||||||
|
|
||||||
|
callbackMapLock.Lock()
|
||||||
|
callbackMap[callbackNumber] = nil
|
||||||
|
callbackMapLock.Unlock()
|
||||||
|
|
||||||
|
handle = 0
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,685 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"os"
|
||||||
|
"strconv"
|
||||||
|
"sync"
|
||||||
|
"syscall"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/interop"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/schema1"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
// currentContainerStarts is used to limit the number of concurrent container
|
||||||
|
// starts.
|
||||||
|
var currentContainerStarts containerStarts
|
||||||
|
|
||||||
|
type containerStarts struct {
|
||||||
|
maxParallel int
|
||||||
|
inProgress int
|
||||||
|
sync.Mutex
|
||||||
|
}
|
||||||
|
|
||||||
|
func init() {
|
||||||
|
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
|
||||||
|
if len(mpsS) > 0 {
|
||||||
|
mpsI, err := strconv.Atoi(mpsS)
|
||||||
|
if err != nil || mpsI < 0 {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
currentContainerStarts.maxParallel = mpsI
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
type System struct {
|
||||||
|
handleLock sync.RWMutex
|
||||||
|
handle hcsSystem
|
||||||
|
id string
|
||||||
|
callbackNumber uintptr
|
||||||
|
|
||||||
|
logctx logrus.Fields
|
||||||
|
}
|
||||||
|
|
||||||
|
func newSystem(id string) *System {
|
||||||
|
return &System{
|
||||||
|
id: id,
|
||||||
|
logctx: logrus.Fields{
|
||||||
|
logfields.ContainerID: id,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (computeSystem *System) logOperationBegin(operation string) {
|
||||||
|
logOperationBegin(
|
||||||
|
computeSystem.logctx,
|
||||||
|
operation+" - Begin Operation")
|
||||||
|
}
|
||||||
|
|
||||||
|
func (computeSystem *System) logOperationEnd(operation string, err error) {
|
||||||
|
var result string
|
||||||
|
if err == nil {
|
||||||
|
result = "Success"
|
||||||
|
} else {
|
||||||
|
result = "Error"
|
||||||
|
}
|
||||||
|
|
||||||
|
logOperationEnd(
|
||||||
|
computeSystem.logctx,
|
||||||
|
operation+" - End Operation - "+result,
|
||||||
|
err)
|
||||||
|
}
|
||||||
|
|
||||||
|
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
|
||||||
|
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
|
||||||
|
operation := "hcsshim::CreateComputeSystem"
|
||||||
|
|
||||||
|
computeSystem := newSystem(id)
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
hcsDocument := string(hcsDocumentB)
|
||||||
|
|
||||||
|
logrus.WithFields(computeSystem.logctx).
|
||||||
|
WithField(logfields.JSON, hcsDocument).
|
||||||
|
Debug("HCS ComputeSystem Document")
|
||||||
|
|
||||||
|
var (
|
||||||
|
resultp *uint16
|
||||||
|
identity syscall.Handle
|
||||||
|
createError error
|
||||||
|
)
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
|
||||||
|
})
|
||||||
|
|
||||||
|
if createError == nil || IsPending(createError) {
|
||||||
|
if err = computeSystem.registerCallback(); err != nil {
|
||||||
|
// Terminate the compute system if it still exists. We're okay to
|
||||||
|
// ignore a failure here.
|
||||||
|
computeSystem.Terminate()
|
||||||
|
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
|
||||||
|
if err != nil {
|
||||||
|
if err == ErrTimeout {
|
||||||
|
// Terminate the compute system if it still exists. We're okay to
|
||||||
|
// ignore a failure here.
|
||||||
|
computeSystem.Terminate()
|
||||||
|
}
|
||||||
|
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return computeSystem, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// OpenComputeSystem opens an existing compute system by ID.
|
||||||
|
func OpenComputeSystem(id string) (_ *System, err error) {
|
||||||
|
operation := "hcsshim::OpenComputeSystem"
|
||||||
|
|
||||||
|
computeSystem := newSystem(id)
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() {
|
||||||
|
if IsNotExist(err) {
|
||||||
|
computeSystem.logOperationEnd(operation, nil)
|
||||||
|
} else {
|
||||||
|
computeSystem.logOperationEnd(operation, err)
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
|
var (
|
||||||
|
handle hcsSystem
|
||||||
|
resultp *uint16
|
||||||
|
)
|
||||||
|
err = hcsOpenComputeSystem(id, &handle, &resultp)
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, operation, "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
computeSystem.handle = handle
|
||||||
|
|
||||||
|
if err = computeSystem.registerCallback(); err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, operation, "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return computeSystem, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetComputeSystems gets a list of the compute systems on the system that match the query
|
||||||
|
func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
|
||||||
|
operation := "hcsshim::GetComputeSystems"
|
||||||
|
fields := logrus.Fields{}
|
||||||
|
logOperationBegin(
|
||||||
|
fields,
|
||||||
|
operation+" - Begin Operation")
|
||||||
|
|
||||||
|
defer func() {
|
||||||
|
var result string
|
||||||
|
if err == nil {
|
||||||
|
result = "Success"
|
||||||
|
} else {
|
||||||
|
result = "Error"
|
||||||
|
}
|
||||||
|
|
||||||
|
logOperationEnd(
|
||||||
|
fields,
|
||||||
|
operation+" - End Operation - "+result,
|
||||||
|
err)
|
||||||
|
}()
|
||||||
|
|
||||||
|
queryb, err := json.Marshal(q)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
query := string(queryb)
|
||||||
|
|
||||||
|
logrus.WithFields(fields).
|
||||||
|
WithField(logfields.JSON, query).
|
||||||
|
Debug("HCS ComputeSystem Query")
|
||||||
|
|
||||||
|
var (
|
||||||
|
resultp *uint16
|
||||||
|
computeSystemsp *uint16
|
||||||
|
)
|
||||||
|
|
||||||
|
syscallWatcher(fields, func() {
|
||||||
|
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return nil, &HcsError{Op: operation, Err: err, Events: events}
|
||||||
|
}
|
||||||
|
|
||||||
|
if computeSystemsp == nil {
|
||||||
|
return nil, ErrUnexpectedValue
|
||||||
|
}
|
||||||
|
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
|
||||||
|
computeSystems := []schema1.ContainerProperties{}
|
||||||
|
if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return computeSystems, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Start synchronously starts the computeSystem.
|
||||||
|
func (computeSystem *System) Start() (err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Start"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
// This is a very simple backoff-retry loop to limit the number
|
||||||
|
// of parallel container starts if environment variable
|
||||||
|
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
|
||||||
|
// It should generally only be used as a workaround to various
|
||||||
|
// platform issues that exist between RS1 and RS4 as of Aug 2018
|
||||||
|
if currentContainerStarts.maxParallel > 0 {
|
||||||
|
for {
|
||||||
|
currentContainerStarts.Lock()
|
||||||
|
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
|
||||||
|
currentContainerStarts.inProgress++
|
||||||
|
currentContainerStarts.Unlock()
|
||||||
|
break
|
||||||
|
}
|
||||||
|
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
|
||||||
|
currentContainerStarts.Unlock()
|
||||||
|
time.Sleep(100 * time.Millisecond)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// Make sure we decrement the count when we are done.
|
||||||
|
defer func() {
|
||||||
|
currentContainerStarts.Lock()
|
||||||
|
currentContainerStarts.inProgress--
|
||||||
|
currentContainerStarts.Unlock()
|
||||||
|
}()
|
||||||
|
}
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
|
||||||
|
})
|
||||||
|
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Start", "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// ID returns the compute system's identifier.
|
||||||
|
func (computeSystem *System) ID() string {
|
||||||
|
return computeSystem.id
|
||||||
|
}
|
||||||
|
|
||||||
|
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
|
||||||
|
// it may not actually be shut down until Wait() succeeds.
|
||||||
|
func (computeSystem *System) Shutdown() (err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Shutdown"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() {
|
||||||
|
if IsAlreadyStopped(err) {
|
||||||
|
computeSystem.logOperationEnd(operation, nil)
|
||||||
|
} else {
|
||||||
|
computeSystem.logOperationEnd(operation, err)
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Shutdown", "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
|
||||||
|
// it may not actually be shut down until Wait() succeeds.
|
||||||
|
func (computeSystem *System) Terminate() (err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Terminate"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() {
|
||||||
|
if IsPending(err) {
|
||||||
|
computeSystem.logOperationEnd(operation, nil)
|
||||||
|
} else {
|
||||||
|
computeSystem.logOperationEnd(operation, err)
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil && err != ErrVmcomputeAlreadyStopped {
|
||||||
|
return makeSystemError(computeSystem, "Terminate", "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Wait synchronously waits for the compute system to shutdown or terminate.
|
||||||
|
func (computeSystem *System) Wait() (err error) {
|
||||||
|
operation := "hcsshim::ComputeSystem::Wait"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Wait", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// WaitExpectedError synchronously waits for the compute system to shutdown or
|
||||||
|
// terminate, and ignores the passed error if it occurs.
|
||||||
|
func (computeSystem *System) WaitExpectedError(expected error) (err error) {
|
||||||
|
operation := "hcsshim::ComputeSystem::WaitExpectedError"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
|
||||||
|
if err != nil && getInnerError(err) != expected {
|
||||||
|
return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
|
||||||
|
// If the timeout expires, IsTimeout(err) == true
|
||||||
|
func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
|
||||||
|
operation := "hcsshim::ComputeSystem::WaitTimeout"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Properties"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
queryj, err := json.Marshal(schema1.PropertyQuery{types})
|
||||||
|
if err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
logrus.WithFields(computeSystem.logctx).
|
||||||
|
WithField(logfields.JSON, queryj).
|
||||||
|
Debug("HCS ComputeSystem Properties Query")
|
||||||
|
|
||||||
|
var resultp, propertiesp *uint16
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
if propertiesp == nil {
|
||||||
|
return nil, ErrUnexpectedValue
|
||||||
|
}
|
||||||
|
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
|
||||||
|
properties := &schema1.ContainerProperties{}
|
||||||
|
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return properties, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
|
||||||
|
func (computeSystem *System) Pause() (err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Pause"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
|
||||||
|
})
|
||||||
|
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Pause", "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
|
||||||
|
func (computeSystem *System) Resume() (err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Resume"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
|
||||||
|
})
|
||||||
|
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Resume", "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// CreateProcess launches a new process within the computeSystem.
|
||||||
|
func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::CreateProcess"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
var (
|
||||||
|
processInfo hcsProcessInformation
|
||||||
|
processHandle hcsProcess
|
||||||
|
resultp *uint16
|
||||||
|
)
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
configurationb, err := json.Marshal(c)
|
||||||
|
if err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
configuration := string(configurationb)
|
||||||
|
|
||||||
|
logrus.WithFields(computeSystem.logctx).
|
||||||
|
WithField(logfields.JSON, configuration).
|
||||||
|
Debug("HCS ComputeSystem Process Document")
|
||||||
|
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
logrus.WithFields(computeSystem.logctx).
|
||||||
|
WithField(logfields.ProcessID, processInfo.ProcessId).
|
||||||
|
Debug("HCS ComputeSystem CreateProcess PID")
|
||||||
|
|
||||||
|
process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
|
||||||
|
process.cachedPipes = &cachedPipes{
|
||||||
|
stdIn: processInfo.StdInput,
|
||||||
|
stdOut: processInfo.StdOutput,
|
||||||
|
stdErr: processInfo.StdError,
|
||||||
|
}
|
||||||
|
|
||||||
|
if err = process.registerCallback(); err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return process, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// OpenProcess gets an interface to an existing process within the computeSystem.
|
||||||
|
func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
// Add PID for the context of this operation
|
||||||
|
computeSystem.logctx[logfields.ProcessID] = pid
|
||||||
|
defer delete(computeSystem.logctx, logfields.ProcessID)
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::OpenProcess"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
var (
|
||||||
|
processHandle hcsProcess
|
||||||
|
resultp *uint16
|
||||||
|
)
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
process := newProcess(processHandle, pid, computeSystem)
|
||||||
|
if err = process.registerCallback(); err != nil {
|
||||||
|
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
return process, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
|
||||||
|
func (computeSystem *System) Close() (err error) {
|
||||||
|
computeSystem.handleLock.Lock()
|
||||||
|
defer computeSystem.handleLock.Unlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Close"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
// Don't double free this
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
if err = computeSystem.unregisterCallback(); err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsCloseComputeSystem(computeSystem.handle)
|
||||||
|
})
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Close", "", err, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
computeSystem.handle = 0
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (computeSystem *System) registerCallback() error {
|
||||||
|
context := ¬ifcationWatcherContext{
|
||||||
|
channels: newChannels(),
|
||||||
|
}
|
||||||
|
|
||||||
|
callbackMapLock.Lock()
|
||||||
|
callbackNumber := nextCallback
|
||||||
|
nextCallback++
|
||||||
|
callbackMap[callbackNumber] = context
|
||||||
|
callbackMapLock.Unlock()
|
||||||
|
|
||||||
|
var callbackHandle hcsCallback
|
||||||
|
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
context.handle = callbackHandle
|
||||||
|
computeSystem.callbackNumber = callbackNumber
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func (computeSystem *System) unregisterCallback() error {
|
||||||
|
callbackNumber := computeSystem.callbackNumber
|
||||||
|
|
||||||
|
callbackMapLock.RLock()
|
||||||
|
context := callbackMap[callbackNumber]
|
||||||
|
callbackMapLock.RUnlock()
|
||||||
|
|
||||||
|
if context == nil {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
handle := context.handle
|
||||||
|
|
||||||
|
if handle == 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// hcsUnregisterComputeSystemCallback has its own syncronization
|
||||||
|
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
|
||||||
|
err := hcsUnregisterComputeSystemCallback(handle)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
closeChannels(context.channels)
|
||||||
|
|
||||||
|
callbackMapLock.Lock()
|
||||||
|
callbackMap[callbackNumber] = nil
|
||||||
|
callbackMapLock.Unlock()
|
||||||
|
|
||||||
|
handle = 0
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Modify the System by sending a request to HCS
|
||||||
|
func (computeSystem *System) Modify(config interface{}) (err error) {
|
||||||
|
computeSystem.handleLock.RLock()
|
||||||
|
defer computeSystem.handleLock.RUnlock()
|
||||||
|
|
||||||
|
operation := "hcsshim::ComputeSystem::Modify"
|
||||||
|
computeSystem.logOperationBegin(operation)
|
||||||
|
defer func() { computeSystem.logOperationEnd(operation, err) }()
|
||||||
|
|
||||||
|
if computeSystem.handle == 0 {
|
||||||
|
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
|
||||||
|
}
|
||||||
|
|
||||||
|
requestJSON, err := json.Marshal(config)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
requestString := string(requestJSON)
|
||||||
|
|
||||||
|
logrus.WithFields(computeSystem.logctx).
|
||||||
|
WithField(logfields.JSON, requestString).
|
||||||
|
Debug("HCS ComputeSystem Modify Document")
|
||||||
|
|
||||||
|
var resultp *uint16
|
||||||
|
syscallWatcher(computeSystem.logctx, func() {
|
||||||
|
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
|
||||||
|
})
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if err != nil {
|
||||||
|
return makeSystemError(computeSystem, "Modify", requestString, err, events)
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,33 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"io"
|
||||||
|
"syscall"
|
||||||
|
|
||||||
|
"github.com/Microsoft/go-winio"
|
||||||
|
)
|
||||||
|
|
||||||
|
// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
|
||||||
|
// if there is an error.
|
||||||
|
func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
|
||||||
|
fs := make([]io.ReadWriteCloser, len(hs))
|
||||||
|
for i, h := range hs {
|
||||||
|
if h != syscall.Handle(0) {
|
||||||
|
if err == nil {
|
||||||
|
fs[i], err = winio.MakeOpenFile(h)
|
||||||
|
}
|
||||||
|
if err != nil {
|
||||||
|
syscall.Close(h)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if err != nil {
|
||||||
|
for _, f := range fs {
|
||||||
|
if f != nil {
|
||||||
|
f.Close()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return fs, nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,63 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
|
||||||
|
events := processHcsResult(resultp)
|
||||||
|
if IsPending(err) {
|
||||||
|
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
|
||||||
|
}
|
||||||
|
|
||||||
|
return events, err
|
||||||
|
}
|
||||||
|
|
||||||
|
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
|
||||||
|
callbackMapLock.RLock()
|
||||||
|
channels := callbackMap[callbackNumber].channels
|
||||||
|
callbackMapLock.RUnlock()
|
||||||
|
|
||||||
|
expectedChannel := channels[expectedNotification]
|
||||||
|
if expectedChannel == nil {
|
||||||
|
logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
|
||||||
|
return ErrInvalidNotificationType
|
||||||
|
}
|
||||||
|
|
||||||
|
var c <-chan time.Time
|
||||||
|
if timeout != nil {
|
||||||
|
timer := time.NewTimer(*timeout)
|
||||||
|
c = timer.C
|
||||||
|
defer timer.Stop()
|
||||||
|
}
|
||||||
|
|
||||||
|
select {
|
||||||
|
case err, ok := <-expectedChannel:
|
||||||
|
if !ok {
|
||||||
|
return ErrHandleClose
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
case err, ok := <-channels[hcsNotificationSystemExited]:
|
||||||
|
if !ok {
|
||||||
|
return ErrHandleClose
|
||||||
|
}
|
||||||
|
// If the expected notification is hcsNotificationSystemExited which of the two selects
|
||||||
|
// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
|
||||||
|
if channels[hcsNotificationSystemExited] == expectedChannel {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return ErrUnexpectedContainerExit
|
||||||
|
case _, ok := <-channels[hcsNotificationServiceDisconnect]:
|
||||||
|
if !ok {
|
||||||
|
return ErrHandleClose
|
||||||
|
}
|
||||||
|
// hcsNotificationServiceDisconnect should never be an expected notification
|
||||||
|
// it does not need the same handling as hcsNotificationSystemExited
|
||||||
|
return ErrUnexpectedProcessAbort
|
||||||
|
case <-c:
|
||||||
|
return ErrTimeout
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,41 @@
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"context"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/logfields"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/timeout"
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
// syscallWatcher is used as a very simple goroutine around calls into
|
||||||
|
// the platform. In some cases, we have seen HCS APIs not returning due to
|
||||||
|
// various bugs, and the goroutine making the syscall ends up not returning,
|
||||||
|
// prior to its async callback. By spinning up a syscallWatcher, it allows
|
||||||
|
// us to at least log a warning if a syscall doesn't complete in a reasonable
|
||||||
|
// amount of time.
|
||||||
|
//
|
||||||
|
// Usage is:
|
||||||
|
//
|
||||||
|
// syscallWatcher(logContext, func() {
|
||||||
|
// err = <syscall>(args...)
|
||||||
|
// })
|
||||||
|
//
|
||||||
|
|
||||||
|
func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
|
||||||
|
ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
|
||||||
|
defer cancel()
|
||||||
|
go watchFunc(ctx, logContext)
|
||||||
|
syscallLambda()
|
||||||
|
}
|
||||||
|
|
||||||
|
func watchFunc(ctx context.Context, logContext logrus.Fields) {
|
||||||
|
select {
|
||||||
|
case <-ctx.Done():
|
||||||
|
if ctx.Err() != context.Canceled {
|
||||||
|
logrus.WithFields(logContext).
|
||||||
|
WithField(logfields.Timeout, timeout.SyscallWatcher).
|
||||||
|
Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
533
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
533
vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go
generated
vendored
Normal file
|
|
@ -0,0 +1,533 @@
|
||||||
|
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||||
|
|
||||||
|
package hcs
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
|
||||||
|
"golang.org/x/sys/windows"
|
||||||
|
)
|
||||||
|
|
||||||
|
var _ unsafe.Pointer
|
||||||
|
|
||||||
|
// Do the interface allocations only once for common
|
||||||
|
// Errno values.
|
||||||
|
const (
|
||||||
|
errnoERROR_IO_PENDING = 997
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||||
|
)
|
||||||
|
|
||||||
|
// errnoErr returns common boxed Errno values, to prevent
|
||||||
|
// allocations at runtime.
|
||||||
|
func errnoErr(e syscall.Errno) error {
|
||||||
|
switch e {
|
||||||
|
case 0:
|
||||||
|
return nil
|
||||||
|
case errnoERROR_IO_PENDING:
|
||||||
|
return errERROR_IO_PENDING
|
||||||
|
}
|
||||||
|
// TODO: add more here, after collecting data on the common
|
||||||
|
// error values see on Windows. (perhaps when running
|
||||||
|
// all.bat?)
|
||||||
|
return e
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||||
|
|
||||||
|
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
|
||||||
|
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
|
||||||
|
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
|
||||||
|
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
|
||||||
|
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
|
||||||
|
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
|
||||||
|
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
|
||||||
|
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
|
||||||
|
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
|
||||||
|
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
|
||||||
|
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
|
||||||
|
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
|
||||||
|
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
|
||||||
|
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
|
||||||
|
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
|
||||||
|
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
|
||||||
|
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
|
||||||
|
|
||||||
|
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
|
||||||
|
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
|
||||||
|
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
|
||||||
|
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
|
||||||
|
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
|
||||||
|
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
|
||||||
|
)
|
||||||
|
|
||||||
|
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(query)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
var _p1 *uint16
|
||||||
|
_p1, hr = syscall.UTF16PtrFromString(configuration)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(id)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsOpenComputeSystem(_p0, computeSystem, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
|
||||||
|
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsStartComputeSystem(computeSystem, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsStartComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsPauseComputeSystem(computeSystem, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsResumeComputeSystem(computeSystem, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(configuration)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsModifyComputeSystem(computeSystem, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||||
|
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
|
||||||
|
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(processParameters)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsCreateProcess.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsOpenProcess.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsCloseProcess(process hcsProcess) (hr error) {
|
||||||
|
if hr = procHcsCloseProcess.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(options)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsSignalProcess(process, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsTerminateProcess.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsGetProcessInfo.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsGetProcessProperties.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(settings)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsModifyProcess(process, _p0, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsModifyProcess.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return _hcsGetServiceProperties(_p0, properties, result)
|
||||||
|
}
|
||||||
|
|
||||||
|
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
|
||||||
|
if hr = procHcsGetServiceProperties.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
|
||||||
|
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
|
||||||
|
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,47 @@
|
||||||
|
package hcserror
|
||||||
|
|
||||||
|
import (
|
||||||
|
"fmt"
|
||||||
|
"syscall"
|
||||||
|
)
|
||||||
|
|
||||||
|
const ERROR_GEN_FAILURE = syscall.Errno(31)
|
||||||
|
|
||||||
|
type HcsError struct {
|
||||||
|
title string
|
||||||
|
rest string
|
||||||
|
Err error
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e *HcsError) Error() string {
|
||||||
|
s := e.title
|
||||||
|
if len(s) > 0 && s[len(s)-1] != ' ' {
|
||||||
|
s += " "
|
||||||
|
}
|
||||||
|
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
|
||||||
|
if e.rest != "" {
|
||||||
|
if e.rest[0] != ' ' {
|
||||||
|
s += " "
|
||||||
|
}
|
||||||
|
s += e.rest
|
||||||
|
}
|
||||||
|
return s
|
||||||
|
}
|
||||||
|
|
||||||
|
func New(err error, title, rest string) error {
|
||||||
|
// Pass through DLL errors directly since they do not originate from HCS.
|
||||||
|
if _, ok := err.(*syscall.DLLError); ok {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return &HcsError{title, rest, err}
|
||||||
|
}
|
||||||
|
|
||||||
|
func Win32FromError(err error) uint32 {
|
||||||
|
if herr, ok := err.(*HcsError); ok {
|
||||||
|
return Win32FromError(herr.Err)
|
||||||
|
}
|
||||||
|
if code, ok := err.(syscall.Errno); ok {
|
||||||
|
return uint32(code)
|
||||||
|
}
|
||||||
|
return uint32(ERROR_GEN_FAILURE)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,23 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import "fmt"
|
||||||
|
|
||||||
|
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
|
||||||
|
|
||||||
|
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
|
||||||
|
|
||||||
|
type EndpointNotFoundError struct {
|
||||||
|
EndpointName string
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e EndpointNotFoundError) Error() string {
|
||||||
|
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
|
||||||
|
}
|
||||||
|
|
||||||
|
type NetworkNotFoundError struct {
|
||||||
|
NetworkName string
|
||||||
|
}
|
||||||
|
|
||||||
|
func (e NetworkNotFoundError) Error() string {
|
||||||
|
return fmt.Sprintf("Network %s not found", e.NetworkName)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,262 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"net"
|
||||||
|
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
// HNSEndpoint represents a network endpoint in HNS
|
||||||
|
type HNSEndpoint struct {
|
||||||
|
Id string `json:"ID,omitempty"`
|
||||||
|
Name string `json:",omitempty"`
|
||||||
|
VirtualNetwork string `json:",omitempty"`
|
||||||
|
VirtualNetworkName string `json:",omitempty"`
|
||||||
|
Policies []json.RawMessage `json:",omitempty"`
|
||||||
|
MacAddress string `json:",omitempty"`
|
||||||
|
IPAddress net.IP `json:",omitempty"`
|
||||||
|
DNSSuffix string `json:",omitempty"`
|
||||||
|
DNSServerList string `json:",omitempty"`
|
||||||
|
GatewayAddress string `json:",omitempty"`
|
||||||
|
EnableInternalDNS bool `json:",omitempty"`
|
||||||
|
DisableICC bool `json:",omitempty"`
|
||||||
|
PrefixLength uint8 `json:",omitempty"`
|
||||||
|
IsRemoteEndpoint bool `json:",omitempty"`
|
||||||
|
EnableLowMetric bool `json:",omitempty"`
|
||||||
|
Namespace *Namespace `json:",omitempty"`
|
||||||
|
EncapOverhead uint16 `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
//SystemType represents the type of the system on which actions are done
|
||||||
|
type SystemType string
|
||||||
|
|
||||||
|
// SystemType const
|
||||||
|
const (
|
||||||
|
ContainerType SystemType = "Container"
|
||||||
|
VirtualMachineType SystemType = "VirtualMachine"
|
||||||
|
HostType SystemType = "Host"
|
||||||
|
)
|
||||||
|
|
||||||
|
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
|
||||||
|
// Supported resource types are Network and Request Types are Add/Remove
|
||||||
|
type EndpointAttachDetachRequest struct {
|
||||||
|
ContainerID string `json:"ContainerId,omitempty"`
|
||||||
|
SystemType SystemType `json:"SystemType"`
|
||||||
|
CompartmentID uint16 `json:"CompartmentId,omitempty"`
|
||||||
|
VirtualNICName string `json:"VirtualNicName,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// EndpointResquestResponse is object to get the endpoint request response
|
||||||
|
type EndpointResquestResponse struct {
|
||||||
|
Success bool
|
||||||
|
Error string
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
|
||||||
|
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
|
||||||
|
endpoint := &HNSEndpoint{}
|
||||||
|
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return endpoint, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
|
||||||
|
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
|
||||||
|
var endpoint []HNSEndpoint
|
||||||
|
err := hnsCall("GET", "/endpoints/", "", &endpoint)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return endpoint, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSEndpointByID get the Endpoint by ID
|
||||||
|
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
|
||||||
|
return HNSEndpointRequest("GET", endpointID, "")
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSEndpointByName gets the endpoint filtered by Name
|
||||||
|
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
|
||||||
|
hnsResponse, err := HNSListEndpointRequest()
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
for _, hnsEndpoint := range hnsResponse {
|
||||||
|
if hnsEndpoint.Name == endpointName {
|
||||||
|
return &hnsEndpoint, nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil, EndpointNotFoundError{EndpointName: endpointName}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
|
||||||
|
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
|
||||||
|
operation := "Create"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(endpoint)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return HNSEndpointRequest("POST", "", string(jsonString))
|
||||||
|
}
|
||||||
|
|
||||||
|
// Delete Endpoint by sending EndpointRequest to HNS
|
||||||
|
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
|
||||||
|
operation := "Delete"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
|
||||||
|
return HNSEndpointRequest("DELETE", endpoint.Id, "")
|
||||||
|
}
|
||||||
|
|
||||||
|
// Update Endpoint
|
||||||
|
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
|
||||||
|
operation := "Update"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
jsonString, err := json.Marshal(endpoint)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
|
||||||
|
|
||||||
|
return endpoint, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
|
||||||
|
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
|
||||||
|
operation := "ApplyACLPolicy"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
|
||||||
|
for _, policy := range policies {
|
||||||
|
if policy == nil {
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
jsonString, err := json.Marshal(policy)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
endpoint.Policies = append(endpoint.Policies, jsonString)
|
||||||
|
}
|
||||||
|
|
||||||
|
_, err := endpoint.Update()
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// ContainerAttach attaches an endpoint to container
|
||||||
|
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
|
||||||
|
operation := "ContainerAttach"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
|
||||||
|
requestMessage := &EndpointAttachDetachRequest{
|
||||||
|
ContainerID: containerID,
|
||||||
|
CompartmentID: compartmentID,
|
||||||
|
SystemType: ContainerType,
|
||||||
|
}
|
||||||
|
response := &EndpointResquestResponse{}
|
||||||
|
jsonString, err := json.Marshal(requestMessage)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||||
|
}
|
||||||
|
|
||||||
|
// ContainerDetach detaches an endpoint from container
|
||||||
|
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
|
||||||
|
operation := "ContainerDetach"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
|
||||||
|
requestMessage := &EndpointAttachDetachRequest{
|
||||||
|
ContainerID: containerID,
|
||||||
|
SystemType: ContainerType,
|
||||||
|
}
|
||||||
|
response := &EndpointResquestResponse{}
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(requestMessage)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||||
|
}
|
||||||
|
|
||||||
|
// HostAttach attaches a nic on the host
|
||||||
|
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
|
||||||
|
operation := "HostAttach"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
requestMessage := &EndpointAttachDetachRequest{
|
||||||
|
CompartmentID: compartmentID,
|
||||||
|
SystemType: HostType,
|
||||||
|
}
|
||||||
|
response := &EndpointResquestResponse{}
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(requestMessage)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
// HostDetach detaches a nic on the host
|
||||||
|
func (endpoint *HNSEndpoint) HostDetach() error {
|
||||||
|
operation := "HostDetach"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
requestMessage := &EndpointAttachDetachRequest{
|
||||||
|
SystemType: HostType,
|
||||||
|
}
|
||||||
|
response := &EndpointResquestResponse{}
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(requestMessage)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||||
|
}
|
||||||
|
|
||||||
|
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
|
||||||
|
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
|
||||||
|
operation := "VirtualMachineNicAttach"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
requestMessage := &EndpointAttachDetachRequest{
|
||||||
|
VirtualNICName: virtualMachineNICName,
|
||||||
|
SystemType: VirtualMachineType,
|
||||||
|
}
|
||||||
|
response := &EndpointResquestResponse{}
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(requestMessage)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
|
||||||
|
}
|
||||||
|
|
||||||
|
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
|
||||||
|
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
|
||||||
|
operation := "VirtualMachineNicDetach"
|
||||||
|
title := "hcsshim::HNSEndpoint::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", endpoint.Id)
|
||||||
|
|
||||||
|
requestMessage := &EndpointAttachDetachRequest{
|
||||||
|
SystemType: VirtualMachineType,
|
||||||
|
}
|
||||||
|
response := &EndpointResquestResponse{}
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(requestMessage)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,42 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"fmt"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/hcserror"
|
||||||
|
"github.com/Microsoft/hcsshim/internal/interop"
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
func hnsCall(method, path, request string, returnResponse interface{}) error {
|
||||||
|
var responseBuffer *uint16
|
||||||
|
logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
|
||||||
|
|
||||||
|
err := _hnsCall(method, path, request, &responseBuffer)
|
||||||
|
if err != nil {
|
||||||
|
return hcserror.New(err, "hnsCall ", "")
|
||||||
|
}
|
||||||
|
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
|
||||||
|
|
||||||
|
hnsresponse := &hnsResponse{}
|
||||||
|
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
if !hnsresponse.Success {
|
||||||
|
return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(hnsresponse.Output) == 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
logrus.Debugf("Network Response : %s", hnsresponse.Output)
|
||||||
|
err = json.Unmarshal(hnsresponse.Output, returnResponse)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,28 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
type HNSGlobals struct {
|
||||||
|
Version HNSVersion `json:"Version"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type HNSVersion struct {
|
||||||
|
Major int `json:"Major"`
|
||||||
|
Minor int `json:"Minor"`
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
|
||||||
|
)
|
||||||
|
|
||||||
|
func GetHNSGlobals() (*HNSGlobals, error) {
|
||||||
|
var version HNSVersion
|
||||||
|
err := hnsCall("GET", "/globals/version", "", &version)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
globals := &HNSGlobals{
|
||||||
|
Version: version,
|
||||||
|
}
|
||||||
|
|
||||||
|
return globals, nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,141 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"net"
|
||||||
|
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
// Subnet is assoicated with a network and represents a list
|
||||||
|
// of subnets available to the network
|
||||||
|
type Subnet struct {
|
||||||
|
AddressPrefix string `json:",omitempty"`
|
||||||
|
GatewayAddress string `json:",omitempty"`
|
||||||
|
Policies []json.RawMessage `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// MacPool is assoicated with a network and represents a list
|
||||||
|
// of macaddresses available to the network
|
||||||
|
type MacPool struct {
|
||||||
|
StartMacAddress string `json:",omitempty"`
|
||||||
|
EndMacAddress string `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSNetwork represents a network in HNS
|
||||||
|
type HNSNetwork struct {
|
||||||
|
Id string `json:"ID,omitempty"`
|
||||||
|
Name string `json:",omitempty"`
|
||||||
|
Type string `json:",omitempty"`
|
||||||
|
NetworkAdapterName string `json:",omitempty"`
|
||||||
|
SourceMac string `json:",omitempty"`
|
||||||
|
Policies []json.RawMessage `json:",omitempty"`
|
||||||
|
MacPools []MacPool `json:",omitempty"`
|
||||||
|
Subnets []Subnet `json:",omitempty"`
|
||||||
|
DNSSuffix string `json:",omitempty"`
|
||||||
|
DNSServerList string `json:",omitempty"`
|
||||||
|
DNSServerCompartment uint32 `json:",omitempty"`
|
||||||
|
ManagementIP string `json:",omitempty"`
|
||||||
|
AutomaticDNS bool `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type hnsNetworkResponse struct {
|
||||||
|
Success bool
|
||||||
|
Error string
|
||||||
|
Output HNSNetwork
|
||||||
|
}
|
||||||
|
|
||||||
|
type hnsResponse struct {
|
||||||
|
Success bool
|
||||||
|
Error string
|
||||||
|
Output json.RawMessage
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSNetworkRequest makes a call into HNS to update/query a single network
|
||||||
|
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
|
||||||
|
var network HNSNetwork
|
||||||
|
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return &network, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSListNetworkRequest makes a HNS call to query the list of available networks
|
||||||
|
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
|
||||||
|
var network []HNSNetwork
|
||||||
|
err := hnsCall(method, "/networks/"+path, request, &network)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return network, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSNetworkByID
|
||||||
|
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
|
||||||
|
return HNSNetworkRequest("GET", networkID, "")
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetHNSNetworkName filtered by Name
|
||||||
|
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
|
||||||
|
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
for _, hnsnetwork := range hsnnetworks {
|
||||||
|
if hnsnetwork.Name == networkName {
|
||||||
|
return &hnsnetwork, nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil, NetworkNotFoundError{NetworkName: networkName}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Create Network by sending NetworkRequest to HNS.
|
||||||
|
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
|
||||||
|
operation := "Create"
|
||||||
|
title := "hcsshim::HNSNetwork::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", network.Id)
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(network)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return HNSNetworkRequest("POST", "", string(jsonString))
|
||||||
|
}
|
||||||
|
|
||||||
|
// Delete Network by sending NetworkRequest to HNS
|
||||||
|
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
|
||||||
|
operation := "Delete"
|
||||||
|
title := "hcsshim::HNSNetwork::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", network.Id)
|
||||||
|
|
||||||
|
return HNSNetworkRequest("DELETE", network.Id, "")
|
||||||
|
}
|
||||||
|
|
||||||
|
// Creates an endpoint on the Network.
|
||||||
|
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
|
||||||
|
return &HNSEndpoint{
|
||||||
|
VirtualNetwork: network.Id,
|
||||||
|
IPAddress: ipAddress,
|
||||||
|
MacAddress: string(macAddress),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||||
|
operation := "CreateEndpoint"
|
||||||
|
title := "hcsshim::HNSNetwork::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
|
||||||
|
|
||||||
|
endpoint.VirtualNetwork = network.Id
|
||||||
|
return endpoint.Create()
|
||||||
|
}
|
||||||
|
|
||||||
|
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
|
||||||
|
operation := "CreateRemoteEndpoint"
|
||||||
|
title := "hcsshim::HNSNetwork::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", network.Id)
|
||||||
|
endpoint.IsRemoteEndpoint = true
|
||||||
|
return network.CreateEndpoint(endpoint)
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,98 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
// Type of Request Support in ModifySystem
|
||||||
|
type PolicyType string
|
||||||
|
|
||||||
|
// RequestType const
|
||||||
|
const (
|
||||||
|
Nat PolicyType = "NAT"
|
||||||
|
ACL PolicyType = "ACL"
|
||||||
|
PA PolicyType = "PA"
|
||||||
|
VLAN PolicyType = "VLAN"
|
||||||
|
VSID PolicyType = "VSID"
|
||||||
|
VNet PolicyType = "VNET"
|
||||||
|
L2Driver PolicyType = "L2Driver"
|
||||||
|
Isolation PolicyType = "Isolation"
|
||||||
|
QOS PolicyType = "QOS"
|
||||||
|
OutboundNat PolicyType = "OutBoundNAT"
|
||||||
|
ExternalLoadBalancer PolicyType = "ELB"
|
||||||
|
Route PolicyType = "ROUTE"
|
||||||
|
)
|
||||||
|
|
||||||
|
type NatPolicy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
Protocol string
|
||||||
|
InternalPort uint16
|
||||||
|
ExternalPort uint16
|
||||||
|
}
|
||||||
|
|
||||||
|
type QosPolicy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
MaximumOutgoingBandwidthInBytes uint64
|
||||||
|
}
|
||||||
|
|
||||||
|
type IsolationPolicy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
VLAN uint
|
||||||
|
VSID uint
|
||||||
|
InDefaultIsolation bool
|
||||||
|
}
|
||||||
|
|
||||||
|
type VlanPolicy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
VLAN uint
|
||||||
|
}
|
||||||
|
|
||||||
|
type VsidPolicy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
VSID uint
|
||||||
|
}
|
||||||
|
|
||||||
|
type PaPolicy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
PA string `json:"PA"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type OutboundNatPolicy struct {
|
||||||
|
Policy
|
||||||
|
VIP string `json:"VIP,omitempty"`
|
||||||
|
Exceptions []string `json:"ExceptionList,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type ActionType string
|
||||||
|
type DirectionType string
|
||||||
|
type RuleType string
|
||||||
|
|
||||||
|
const (
|
||||||
|
Allow ActionType = "Allow"
|
||||||
|
Block ActionType = "Block"
|
||||||
|
|
||||||
|
In DirectionType = "In"
|
||||||
|
Out DirectionType = "Out"
|
||||||
|
|
||||||
|
Host RuleType = "Host"
|
||||||
|
Switch RuleType = "Switch"
|
||||||
|
)
|
||||||
|
|
||||||
|
type ACLPolicy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
Id string `json:"Id,omitempty"`
|
||||||
|
Protocol uint16
|
||||||
|
Protocols string `json:"Protocols,omitempty"`
|
||||||
|
InternalPort uint16
|
||||||
|
Action ActionType
|
||||||
|
Direction DirectionType
|
||||||
|
LocalAddresses string
|
||||||
|
RemoteAddresses string
|
||||||
|
LocalPorts string `json:"LocalPorts,omitempty"`
|
||||||
|
LocalPort uint16
|
||||||
|
RemotePorts string `json:"RemotePorts,omitempty"`
|
||||||
|
RemotePort uint16
|
||||||
|
RuleType RuleType `json:"RuleType,omitempty"`
|
||||||
|
Priority uint16
|
||||||
|
ServiceName string
|
||||||
|
}
|
||||||
|
|
||||||
|
type Policy struct {
|
||||||
|
Type PolicyType `json:"Type"`
|
||||||
|
}
|
||||||
201
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
generated
vendored
Normal file
201
vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go
generated
vendored
Normal file
|
|
@ -0,0 +1,201 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
// RoutePolicy is a structure defining schema for Route based Policy
|
||||||
|
type RoutePolicy struct {
|
||||||
|
Policy
|
||||||
|
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
|
||||||
|
NextHop string `json:"NextHop,omitempty"`
|
||||||
|
EncapEnabled bool `json:"NeedEncap,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
|
||||||
|
type ELBPolicy struct {
|
||||||
|
LBPolicy
|
||||||
|
SourceVIP string `json:"SourceVIP,omitempty"`
|
||||||
|
VIPs []string `json:"VIPs,omitempty"`
|
||||||
|
ILB bool `json:"ILB,omitempty"`
|
||||||
|
DSR bool `json:"IsDSR,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// LBPolicy is a structure defining schema for LoadBalancing based Policy
|
||||||
|
type LBPolicy struct {
|
||||||
|
Policy
|
||||||
|
Protocol uint16 `json:"Protocol,omitempty"`
|
||||||
|
InternalPort uint16
|
||||||
|
ExternalPort uint16
|
||||||
|
}
|
||||||
|
|
||||||
|
// PolicyList is a structure defining schema for Policy list request
|
||||||
|
type PolicyList struct {
|
||||||
|
ID string `json:"ID,omitempty"`
|
||||||
|
EndpointReferences []string `json:"References,omitempty"`
|
||||||
|
Policies []json.RawMessage `json:"Policies,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSPolicyListRequest makes a call into HNS to update/query a single network
|
||||||
|
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||||
|
var policy PolicyList
|
||||||
|
err := hnsCall(method, "/policylists/"+path, request, &policy)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return &policy, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// HNSListPolicyListRequest gets all the policy list
|
||||||
|
func HNSListPolicyListRequest() ([]PolicyList, error) {
|
||||||
|
var plist []PolicyList
|
||||||
|
err := hnsCall("GET", "/policylists/", "", &plist)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return plist, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// PolicyListRequest makes a HNS call to modify/query a network policy list
|
||||||
|
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
|
||||||
|
policylist := &PolicyList{}
|
||||||
|
err := hnsCall(method, "/policylists/"+path, request, &policylist)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return policylist, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// GetPolicyListByID get the policy list by ID
|
||||||
|
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
|
||||||
|
return PolicyListRequest("GET", policyListID, "")
|
||||||
|
}
|
||||||
|
|
||||||
|
// Create PolicyList by sending PolicyListRequest to HNS.
|
||||||
|
func (policylist *PolicyList) Create() (*PolicyList, error) {
|
||||||
|
operation := "Create"
|
||||||
|
title := "hcsshim::PolicyList::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||||
|
jsonString, err := json.Marshal(policylist)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return PolicyListRequest("POST", "", string(jsonString))
|
||||||
|
}
|
||||||
|
|
||||||
|
// Delete deletes PolicyList
|
||||||
|
func (policylist *PolicyList) Delete() (*PolicyList, error) {
|
||||||
|
operation := "Delete"
|
||||||
|
title := "hcsshim::PolicyList::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s", policylist.ID)
|
||||||
|
|
||||||
|
return PolicyListRequest("DELETE", policylist.ID, "")
|
||||||
|
}
|
||||||
|
|
||||||
|
// AddEndpoint add an endpoint to a Policy List
|
||||||
|
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||||
|
operation := "AddEndpoint"
|
||||||
|
title := "hcsshim::PolicyList::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||||
|
|
||||||
|
_, err := policylist.Delete()
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Add Endpoint to the Existing List
|
||||||
|
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||||
|
|
||||||
|
return policylist.Create()
|
||||||
|
}
|
||||||
|
|
||||||
|
// RemoveEndpoint removes an endpoint from the Policy List
|
||||||
|
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
|
||||||
|
operation := "RemoveEndpoint"
|
||||||
|
title := "hcsshim::PolicyList::" + operation
|
||||||
|
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
|
||||||
|
|
||||||
|
_, err := policylist.Delete()
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
elementToRemove := "/endpoints/" + endpoint.Id
|
||||||
|
|
||||||
|
var references []string
|
||||||
|
|
||||||
|
for _, endpointReference := range policylist.EndpointReferences {
|
||||||
|
if endpointReference == elementToRemove {
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
references = append(references, endpointReference)
|
||||||
|
}
|
||||||
|
policylist.EndpointReferences = references
|
||||||
|
return policylist.Create()
|
||||||
|
}
|
||||||
|
|
||||||
|
// AddLoadBalancer policy list for the specified endpoints
|
||||||
|
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
|
||||||
|
operation := "AddLoadBalancer"
|
||||||
|
title := "hcsshim::PolicyList::" + operation
|
||||||
|
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
|
||||||
|
|
||||||
|
policylist := &PolicyList{}
|
||||||
|
|
||||||
|
elbPolicy := &ELBPolicy{
|
||||||
|
SourceVIP: sourceVIP,
|
||||||
|
ILB: isILB,
|
||||||
|
}
|
||||||
|
|
||||||
|
if len(vip) > 0 {
|
||||||
|
elbPolicy.VIPs = []string{vip}
|
||||||
|
}
|
||||||
|
elbPolicy.Type = ExternalLoadBalancer
|
||||||
|
elbPolicy.Protocol = protocol
|
||||||
|
elbPolicy.InternalPort = internalPort
|
||||||
|
elbPolicy.ExternalPort = externalPort
|
||||||
|
|
||||||
|
for _, endpoint := range endpoints {
|
||||||
|
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||||
|
}
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(elbPolicy)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
policylist.Policies = append(policylist.Policies, jsonString)
|
||||||
|
return policylist.Create()
|
||||||
|
}
|
||||||
|
|
||||||
|
// AddRoute adds route policy list for the specified endpoints
|
||||||
|
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
|
||||||
|
operation := "AddRoute"
|
||||||
|
title := "hcsshim::PolicyList::" + operation
|
||||||
|
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
|
||||||
|
|
||||||
|
policylist := &PolicyList{}
|
||||||
|
|
||||||
|
rPolicy := &RoutePolicy{
|
||||||
|
DestinationPrefix: destinationPrefix,
|
||||||
|
NextHop: nextHop,
|
||||||
|
EncapEnabled: encapEnabled,
|
||||||
|
}
|
||||||
|
rPolicy.Type = Route
|
||||||
|
|
||||||
|
for _, endpoint := range endpoints {
|
||||||
|
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
|
||||||
|
}
|
||||||
|
|
||||||
|
jsonString, err := json.Marshal(rPolicy)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
policylist.Policies = append(policylist.Policies, jsonString)
|
||||||
|
return policylist.Create()
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,49 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"github.com/sirupsen/logrus"
|
||||||
|
)
|
||||||
|
|
||||||
|
type HNSSupportedFeatures struct {
|
||||||
|
Acl HNSAclFeatures `json:"ACL"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type HNSAclFeatures struct {
|
||||||
|
AclAddressLists bool `json:"AclAddressLists"`
|
||||||
|
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
|
||||||
|
AclPortRanges bool `json:"AclPortRanges"`
|
||||||
|
AclRuleId bool `json:"AclRuleId"`
|
||||||
|
}
|
||||||
|
|
||||||
|
func GetHNSSupportedFeatures() HNSSupportedFeatures {
|
||||||
|
var hnsFeatures HNSSupportedFeatures
|
||||||
|
|
||||||
|
globals, err := GetHNSGlobals()
|
||||||
|
if err != nil {
|
||||||
|
// Expected on pre-1803 builds, all features will be false/unsupported
|
||||||
|
logrus.Debugf("Unable to obtain HNS globals: %s", err)
|
||||||
|
return hnsFeatures
|
||||||
|
}
|
||||||
|
|
||||||
|
hnsFeatures.Acl = HNSAclFeatures{
|
||||||
|
AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||||
|
AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||||
|
AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||||
|
AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803),
|
||||||
|
}
|
||||||
|
|
||||||
|
return hnsFeatures
|
||||||
|
}
|
||||||
|
|
||||||
|
func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
|
||||||
|
if currentVersion.Major < minVersionSupported.Major {
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
if currentVersion.Major > minVersionSupported.Major {
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
if currentVersion.Minor < minVersionSupported.Minor {
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,110 @@
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"fmt"
|
||||||
|
"os"
|
||||||
|
"path"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
type namespaceRequest struct {
|
||||||
|
IsDefault bool `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type namespaceEndpointRequest struct {
|
||||||
|
ID string `json:"Id"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type NamespaceResource struct {
|
||||||
|
Type string
|
||||||
|
Data json.RawMessage
|
||||||
|
}
|
||||||
|
|
||||||
|
type namespaceResourceRequest struct {
|
||||||
|
Type string
|
||||||
|
Data interface{}
|
||||||
|
}
|
||||||
|
|
||||||
|
type Namespace struct {
|
||||||
|
ID string
|
||||||
|
IsDefault bool `json:",omitempty"`
|
||||||
|
ResourceList []NamespaceResource `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
|
||||||
|
var err error
|
||||||
|
hnspath := "/namespaces/"
|
||||||
|
if id != nil {
|
||||||
|
hnspath = path.Join(hnspath, *id)
|
||||||
|
}
|
||||||
|
if subpath != "" {
|
||||||
|
hnspath = path.Join(hnspath, subpath)
|
||||||
|
}
|
||||||
|
var reqJSON []byte
|
||||||
|
if request != nil {
|
||||||
|
if reqJSON, err = json.Marshal(request); err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
}
|
||||||
|
var ns Namespace
|
||||||
|
err = hnsCall(method, hnspath, string(reqJSON), &ns)
|
||||||
|
if err != nil {
|
||||||
|
if strings.Contains(err.Error(), "Element not found.") {
|
||||||
|
return nil, os.ErrNotExist
|
||||||
|
}
|
||||||
|
return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
|
||||||
|
}
|
||||||
|
return &ns, err
|
||||||
|
}
|
||||||
|
|
||||||
|
func CreateNamespace() (string, error) {
|
||||||
|
req := namespaceRequest{}
|
||||||
|
ns, err := issueNamespaceRequest(nil, "POST", "", &req)
|
||||||
|
if err != nil {
|
||||||
|
return "", err
|
||||||
|
}
|
||||||
|
return ns.ID, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func RemoveNamespace(id string) error {
|
||||||
|
_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
func GetNamespaceEndpoints(id string) ([]string, error) {
|
||||||
|
ns, err := issueNamespaceRequest(&id, "GET", "", nil)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
var endpoints []string
|
||||||
|
for _, rsrc := range ns.ResourceList {
|
||||||
|
if rsrc.Type == "Endpoint" {
|
||||||
|
var endpoint namespaceEndpointRequest
|
||||||
|
err = json.Unmarshal(rsrc.Data, &endpoint)
|
||||||
|
if err != nil {
|
||||||
|
return nil, fmt.Errorf("unmarshal endpoint: %s", err)
|
||||||
|
}
|
||||||
|
endpoints = append(endpoints, endpoint.ID)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return endpoints, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func AddNamespaceEndpoint(id string, endpointID string) error {
|
||||||
|
resource := namespaceResourceRequest{
|
||||||
|
Type: "Endpoint",
|
||||||
|
Data: namespaceEndpointRequest{endpointID},
|
||||||
|
}
|
||||||
|
_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
func RemoveNamespaceEndpoint(id string, endpointID string) error {
|
||||||
|
resource := namespaceResourceRequest{
|
||||||
|
Type: "Endpoint",
|
||||||
|
Data: namespaceEndpointRequest{endpointID},
|
||||||
|
}
|
||||||
|
_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
|
||||||
|
return err
|
||||||
|
}
|
||||||
76
vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
generated
vendored
Normal file
76
vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go
generated
vendored
Normal file
|
|
@ -0,0 +1,76 @@
|
||||||
|
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||||
|
|
||||||
|
package hns
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
|
||||||
|
"golang.org/x/sys/windows"
|
||||||
|
)
|
||||||
|
|
||||||
|
var _ unsafe.Pointer
|
||||||
|
|
||||||
|
// Do the interface allocations only once for common
|
||||||
|
// Errno values.
|
||||||
|
const (
|
||||||
|
errnoERROR_IO_PENDING = 997
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||||
|
)
|
||||||
|
|
||||||
|
// errnoErr returns common boxed Errno values, to prevent
|
||||||
|
// allocations at runtime.
|
||||||
|
func errnoErr(e syscall.Errno) error {
|
||||||
|
switch e {
|
||||||
|
case 0:
|
||||||
|
return nil
|
||||||
|
case errnoERROR_IO_PENDING:
|
||||||
|
return errERROR_IO_PENDING
|
||||||
|
}
|
||||||
|
// TODO: add more here, after collecting data on the common
|
||||||
|
// error values see on Windows. (perhaps when running
|
||||||
|
// all.bat?)
|
||||||
|
return e
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
|
||||||
|
|
||||||
|
procHNSCall = modvmcompute.NewProc("HNSCall")
|
||||||
|
)
|
||||||
|
|
||||||
|
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
|
||||||
|
var _p0 *uint16
|
||||||
|
_p0, hr = syscall.UTF16PtrFromString(method)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
var _p1 *uint16
|
||||||
|
_p1, hr = syscall.UTF16PtrFromString(path)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
var _p2 *uint16
|
||||||
|
_p2, hr = syscall.UTF16PtrFromString(object)
|
||||||
|
if hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
return __hnsCall(_p0, _p1, _p2, response)
|
||||||
|
}
|
||||||
|
|
||||||
|
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
|
||||||
|
if hr = procHNSCall.Find(); hr != nil {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
|
||||||
|
if int32(r0) < 0 {
|
||||||
|
if r0&0x1fff0000 == 0x00070000 {
|
||||||
|
r0 &= 0xffff
|
||||||
|
}
|
||||||
|
hr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,27 @@
|
||||||
|
package interop
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
)
|
||||||
|
|
||||||
|
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go
|
||||||
|
|
||||||
|
//sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree
|
||||||
|
|
||||||
|
func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
|
||||||
|
str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
|
||||||
|
coTaskMemFree(unsafe.Pointer(buffer))
|
||||||
|
return str
|
||||||
|
}
|
||||||
|
|
||||||
|
func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
|
||||||
|
return []byte(ConvertAndFreeCoTaskMemString(buffer))
|
||||||
|
}
|
||||||
|
|
||||||
|
func Win32FromHresult(hr uintptr) syscall.Errno {
|
||||||
|
if hr&0x1fff0000 == 0x00070000 {
|
||||||
|
return syscall.Errno(hr & 0xffff)
|
||||||
|
}
|
||||||
|
return syscall.Errno(hr)
|
||||||
|
}
|
||||||
48
vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
generated
vendored
Normal file
48
vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go
generated
vendored
Normal file
|
|
@ -0,0 +1,48 @@
|
||||||
|
// Code generated mksyscall_windows.exe DO NOT EDIT
|
||||||
|
|
||||||
|
package interop
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
|
||||||
|
"golang.org/x/sys/windows"
|
||||||
|
)
|
||||||
|
|
||||||
|
var _ unsafe.Pointer
|
||||||
|
|
||||||
|
// Do the interface allocations only once for common
|
||||||
|
// Errno values.
|
||||||
|
const (
|
||||||
|
errnoERROR_IO_PENDING = 997
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||||
|
)
|
||||||
|
|
||||||
|
// errnoErr returns common boxed Errno values, to prevent
|
||||||
|
// allocations at runtime.
|
||||||
|
func errnoErr(e syscall.Errno) error {
|
||||||
|
switch e {
|
||||||
|
case 0:
|
||||||
|
return nil
|
||||||
|
case errnoERROR_IO_PENDING:
|
||||||
|
return errERROR_IO_PENDING
|
||||||
|
}
|
||||||
|
// TODO: add more here, after collecting data on the common
|
||||||
|
// error values see on Windows. (perhaps when running
|
||||||
|
// all.bat?)
|
||||||
|
return e
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
modapi_ms_win_core_com_l1_1_0 = windows.NewLazySystemDLL("api-ms-win-core-com-l1-1-0.dll")
|
||||||
|
|
||||||
|
procCoTaskMemFree = modapi_ms_win_core_com_l1_1_0.NewProc("CoTaskMemFree")
|
||||||
|
)
|
||||||
|
|
||||||
|
func coTaskMemFree(buffer unsafe.Pointer) {
|
||||||
|
syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,32 @@
|
||||||
|
package logfields
|
||||||
|
|
||||||
|
const (
|
||||||
|
// Identifiers
|
||||||
|
|
||||||
|
ContainerID = "cid"
|
||||||
|
UVMID = "uvm-id"
|
||||||
|
ProcessID = "pid"
|
||||||
|
|
||||||
|
// Common Misc
|
||||||
|
|
||||||
|
// Timeout represents an operation timeout.
|
||||||
|
Timeout = "timeout"
|
||||||
|
JSON = "json"
|
||||||
|
|
||||||
|
// Keys/values
|
||||||
|
|
||||||
|
Field = "field"
|
||||||
|
OCIAnnotation = "oci-annotation"
|
||||||
|
Value = "value"
|
||||||
|
|
||||||
|
// Golang type's
|
||||||
|
|
||||||
|
ExpectedType = "expected-type"
|
||||||
|
Bool = "bool"
|
||||||
|
Uint32 = "uint32"
|
||||||
|
Uint64 = "uint64"
|
||||||
|
|
||||||
|
// runhcs
|
||||||
|
|
||||||
|
VMShimOperation = "vmshim-op"
|
||||||
|
)
|
||||||
|
|
@ -0,0 +1,24 @@
|
||||||
|
package longpath
|
||||||
|
|
||||||
|
import (
|
||||||
|
"path/filepath"
|
||||||
|
"strings"
|
||||||
|
)
|
||||||
|
|
||||||
|
// LongAbs makes a path absolute and returns it in NT long path form.
|
||||||
|
func LongAbs(path string) (string, error) {
|
||||||
|
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
|
||||||
|
return path, nil
|
||||||
|
}
|
||||||
|
if !filepath.IsAbs(path) {
|
||||||
|
absPath, err := filepath.Abs(path)
|
||||||
|
if err != nil {
|
||||||
|
return "", err
|
||||||
|
}
|
||||||
|
path = absPath
|
||||||
|
}
|
||||||
|
if strings.HasPrefix(path, `\\`) {
|
||||||
|
return `\\?\UNC\` + path[2:], nil
|
||||||
|
}
|
||||||
|
return `\\?\` + path, nil
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,52 @@
|
||||||
|
package mergemaps
|
||||||
|
|
||||||
|
import "encoding/json"
|
||||||
|
|
||||||
|
// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
|
||||||
|
// in ToMap are overwritten. Values in fromMap are added to ToMap.
|
||||||
|
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
|
||||||
|
func Merge(fromMap, ToMap interface{}) interface{} {
|
||||||
|
switch fromMap := fromMap.(type) {
|
||||||
|
case map[string]interface{}:
|
||||||
|
ToMap, ok := ToMap.(map[string]interface{})
|
||||||
|
if !ok {
|
||||||
|
return fromMap
|
||||||
|
}
|
||||||
|
for keyToMap, valueToMap := range ToMap {
|
||||||
|
if valueFromMap, ok := fromMap[keyToMap]; ok {
|
||||||
|
fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
|
||||||
|
} else {
|
||||||
|
fromMap[keyToMap] = valueToMap
|
||||||
|
}
|
||||||
|
}
|
||||||
|
case nil:
|
||||||
|
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
|
||||||
|
ToMap, ok := ToMap.(map[string]interface{})
|
||||||
|
if ok {
|
||||||
|
return ToMap
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return fromMap
|
||||||
|
}
|
||||||
|
|
||||||
|
// MergeJSON merges the contents of a JSON string into an object representation,
|
||||||
|
// returning a new object suitable for translating to JSON.
|
||||||
|
func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
|
||||||
|
if len(additionalJSON) == 0 {
|
||||||
|
return object, nil
|
||||||
|
}
|
||||||
|
objectJSON, err := json.Marshal(object)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
var objectMap, newMap map[string]interface{}
|
||||||
|
err = json.Unmarshal(objectJSON, &objectMap)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
err = json.Unmarshal(additionalJSON, &newMap)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return Merge(newMap, objectMap), nil
|
||||||
|
}
|
||||||
431
vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go
generated
vendored
Normal file
431
vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go
generated
vendored
Normal file
|
|
@ -0,0 +1,431 @@
|
||||||
|
package safefile
|
||||||
|
|
||||||
|
import (
|
||||||
|
"errors"
|
||||||
|
"io"
|
||||||
|
"os"
|
||||||
|
"path/filepath"
|
||||||
|
"strings"
|
||||||
|
"syscall"
|
||||||
|
"unicode/utf16"
|
||||||
|
"unsafe"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/longpath"
|
||||||
|
|
||||||
|
winio "github.com/Microsoft/go-winio"
|
||||||
|
)
|
||||||
|
|
||||||
|
//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
|
||||||
|
|
||||||
|
//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
|
||||||
|
//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
|
||||||
|
//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
|
||||||
|
//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
|
||||||
|
//sys localFree(ptr uintptr) = kernel32.LocalFree
|
||||||
|
|
||||||
|
type ioStatusBlock struct {
|
||||||
|
Status, Information uintptr
|
||||||
|
}
|
||||||
|
|
||||||
|
type objectAttributes struct {
|
||||||
|
Length uintptr
|
||||||
|
RootDirectory uintptr
|
||||||
|
ObjectName uintptr
|
||||||
|
Attributes uintptr
|
||||||
|
SecurityDescriptor uintptr
|
||||||
|
SecurityQoS uintptr
|
||||||
|
}
|
||||||
|
|
||||||
|
type unicodeString struct {
|
||||||
|
Length uint16
|
||||||
|
MaximumLength uint16
|
||||||
|
Buffer uintptr
|
||||||
|
}
|
||||||
|
|
||||||
|
type fileLinkInformation struct {
|
||||||
|
ReplaceIfExists bool
|
||||||
|
RootDirectory uintptr
|
||||||
|
FileNameLength uint32
|
||||||
|
FileName [1]uint16
|
||||||
|
}
|
||||||
|
|
||||||
|
type fileDispositionInformationEx struct {
|
||||||
|
Flags uintptr
|
||||||
|
}
|
||||||
|
|
||||||
|
const (
|
||||||
|
_FileLinkInformation = 11
|
||||||
|
_FileDispositionInformationEx = 64
|
||||||
|
|
||||||
|
FILE_READ_ATTRIBUTES = 0x0080
|
||||||
|
FILE_WRITE_ATTRIBUTES = 0x0100
|
||||||
|
DELETE = 0x10000
|
||||||
|
|
||||||
|
FILE_OPEN = 1
|
||||||
|
FILE_CREATE = 2
|
||||||
|
|
||||||
|
FILE_DIRECTORY_FILE = 0x00000001
|
||||||
|
FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
|
||||||
|
FILE_DELETE_ON_CLOSE = 0x00001000
|
||||||
|
FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
|
||||||
|
FILE_OPEN_REPARSE_POINT = 0x00200000
|
||||||
|
|
||||||
|
FILE_DISPOSITION_DELETE = 0x00000001
|
||||||
|
|
||||||
|
_OBJ_DONT_REPARSE = 0x1000
|
||||||
|
|
||||||
|
_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
|
||||||
|
)
|
||||||
|
|
||||||
|
func OpenRoot(path string) (*os.File, error) {
|
||||||
|
longpath, err := longpath.LongAbs(path)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
|
||||||
|
}
|
||||||
|
|
||||||
|
func ntRelativePath(path string) ([]uint16, error) {
|
||||||
|
path = filepath.Clean(path)
|
||||||
|
if strings.Contains(path, ":") {
|
||||||
|
// Since alternate data streams must follow the file they
|
||||||
|
// are attached to, finding one here (out of order) is invalid.
|
||||||
|
return nil, errors.New("path contains invalid character `:`")
|
||||||
|
}
|
||||||
|
fspath := filepath.FromSlash(path)
|
||||||
|
if len(fspath) > 0 && fspath[0] == '\\' {
|
||||||
|
return nil, errors.New("expected relative path")
|
||||||
|
}
|
||||||
|
|
||||||
|
path16 := utf16.Encode(([]rune)(fspath))
|
||||||
|
if len(path16) > 32767 {
|
||||||
|
return nil, syscall.ENAMETOOLONG
|
||||||
|
}
|
||||||
|
|
||||||
|
return path16, nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// openRelativeInternal opens a relative path from the given root, failing if
|
||||||
|
// any of the intermediate path components are reparse points.
|
||||||
|
func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
|
||||||
|
var (
|
||||||
|
h uintptr
|
||||||
|
iosb ioStatusBlock
|
||||||
|
oa objectAttributes
|
||||||
|
)
|
||||||
|
|
||||||
|
path16, err := ntRelativePath(path)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
if root == nil || root.Fd() == 0 {
|
||||||
|
return nil, errors.New("missing root directory")
|
||||||
|
}
|
||||||
|
|
||||||
|
upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
|
||||||
|
defer localFree(upathBuffer)
|
||||||
|
|
||||||
|
upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
|
||||||
|
upath.Length = uint16(len(path16) * 2)
|
||||||
|
upath.MaximumLength = upath.Length
|
||||||
|
upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
|
||||||
|
copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
|
||||||
|
|
||||||
|
oa.Length = unsafe.Sizeof(oa)
|
||||||
|
oa.ObjectName = upathBuffer
|
||||||
|
oa.RootDirectory = uintptr(root.Fd())
|
||||||
|
oa.Attributes = _OBJ_DONT_REPARSE
|
||||||
|
status := ntCreateFile(
|
||||||
|
&h,
|
||||||
|
accessMask|syscall.SYNCHRONIZE,
|
||||||
|
&oa,
|
||||||
|
&iosb,
|
||||||
|
nil,
|
||||||
|
0,
|
||||||
|
shareFlags,
|
||||||
|
createDisposition,
|
||||||
|
FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
|
||||||
|
nil,
|
||||||
|
0,
|
||||||
|
)
|
||||||
|
if status != 0 {
|
||||||
|
return nil, rtlNtStatusToDosError(status)
|
||||||
|
}
|
||||||
|
|
||||||
|
fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
|
||||||
|
if err != nil {
|
||||||
|
syscall.Close(syscall.Handle(h))
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
|
return os.NewFile(h, fullPath), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// OpenRelative opens a relative path from the given root, failing if
|
||||||
|
// any of the intermediate path components are reparse points.
|
||||||
|
func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
|
||||||
|
f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
|
||||||
|
if err != nil {
|
||||||
|
err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
|
||||||
|
}
|
||||||
|
return f, err
|
||||||
|
}
|
||||||
|
|
||||||
|
// LinkRelative creates a hard link from oldname to newname (relative to oldroot
|
||||||
|
// and newroot), failing if any of the intermediate path components are reparse
|
||||||
|
// points.
|
||||||
|
func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
|
||||||
|
// Open the old file.
|
||||||
|
oldf, err := openRelativeInternal(
|
||||||
|
oldname,
|
||||||
|
oldroot,
|
||||||
|
syscall.FILE_WRITE_ATTRIBUTES,
|
||||||
|
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||||
|
FILE_OPEN,
|
||||||
|
0,
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
|
||||||
|
}
|
||||||
|
defer oldf.Close()
|
||||||
|
|
||||||
|
// Open the parent of the new file.
|
||||||
|
var parent *os.File
|
||||||
|
parentPath := filepath.Dir(newname)
|
||||||
|
if parentPath != "." {
|
||||||
|
parent, err = openRelativeInternal(
|
||||||
|
parentPath,
|
||||||
|
newroot,
|
||||||
|
syscall.GENERIC_READ,
|
||||||
|
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||||
|
FILE_OPEN,
|
||||||
|
FILE_DIRECTORY_FILE)
|
||||||
|
if err != nil {
|
||||||
|
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
|
||||||
|
}
|
||||||
|
defer parent.Close()
|
||||||
|
|
||||||
|
fi, err := winio.GetFileBasicInfo(parent)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
|
||||||
|
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
|
||||||
|
}
|
||||||
|
|
||||||
|
} else {
|
||||||
|
parent = newroot
|
||||||
|
}
|
||||||
|
|
||||||
|
// Issue an NT call to create the link. This will be safe because NT will
|
||||||
|
// not open any more directories to create the link, so it cannot walk any
|
||||||
|
// more reparse points.
|
||||||
|
newbase := filepath.Base(newname)
|
||||||
|
newbase16, err := ntRelativePath(newbase)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
|
||||||
|
linkinfoBuffer := localAlloc(0, size)
|
||||||
|
defer localFree(linkinfoBuffer)
|
||||||
|
linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
|
||||||
|
linkinfo.RootDirectory = parent.Fd()
|
||||||
|
linkinfo.FileNameLength = uint32(len(newbase16) * 2)
|
||||||
|
copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
|
||||||
|
|
||||||
|
var iosb ioStatusBlock
|
||||||
|
status := ntSetInformationFile(
|
||||||
|
oldf.Fd(),
|
||||||
|
&iosb,
|
||||||
|
linkinfoBuffer,
|
||||||
|
uint32(size),
|
||||||
|
_FileLinkInformation,
|
||||||
|
)
|
||||||
|
if status != 0 {
|
||||||
|
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
|
||||||
|
}
|
||||||
|
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// deleteOnClose marks a file to be deleted when the handle is closed.
|
||||||
|
func deleteOnClose(f *os.File) error {
|
||||||
|
disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
|
||||||
|
var iosb ioStatusBlock
|
||||||
|
status := ntSetInformationFile(
|
||||||
|
f.Fd(),
|
||||||
|
&iosb,
|
||||||
|
uintptr(unsafe.Pointer(&disposition)),
|
||||||
|
uint32(unsafe.Sizeof(disposition)),
|
||||||
|
_FileDispositionInformationEx,
|
||||||
|
)
|
||||||
|
if status != 0 {
|
||||||
|
return rtlNtStatusToDosError(status)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// clearReadOnly clears the readonly attribute on a file.
|
||||||
|
func clearReadOnly(f *os.File) error {
|
||||||
|
bi, err := winio.GetFileBasicInfo(f)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
sbi := winio.FileBasicInfo{
|
||||||
|
FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
|
||||||
|
}
|
||||||
|
if sbi.FileAttributes == 0 {
|
||||||
|
sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
|
||||||
|
}
|
||||||
|
return winio.SetFileBasicInfo(f, &sbi)
|
||||||
|
}
|
||||||
|
|
||||||
|
// RemoveRelative removes a file or directory relative to a root, failing if any
|
||||||
|
// intermediate path components are reparse points.
|
||||||
|
func RemoveRelative(path string, root *os.File) error {
|
||||||
|
f, err := openRelativeInternal(
|
||||||
|
path,
|
||||||
|
root,
|
||||||
|
FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
|
||||||
|
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||||
|
FILE_OPEN,
|
||||||
|
FILE_OPEN_REPARSE_POINT)
|
||||||
|
if err == nil {
|
||||||
|
defer f.Close()
|
||||||
|
err = deleteOnClose(f)
|
||||||
|
if err == syscall.ERROR_ACCESS_DENIED {
|
||||||
|
// Maybe the file is marked readonly. Clear the bit and retry.
|
||||||
|
clearReadOnly(f)
|
||||||
|
err = deleteOnClose(f)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if err != nil {
|
||||||
|
return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// RemoveAllRelative removes a directory tree relative to a root, failing if any
|
||||||
|
// intermediate path components are reparse points.
|
||||||
|
func RemoveAllRelative(path string, root *os.File) error {
|
||||||
|
fi, err := LstatRelative(path, root)
|
||||||
|
if err != nil {
|
||||||
|
if os.IsNotExist(err) {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
|
||||||
|
if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
|
||||||
|
// If this is a reparse point, it can't have children. Simple remove will do.
|
||||||
|
err := RemoveRelative(path, root)
|
||||||
|
if err == nil || os.IsNotExist(err) {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// It is necessary to use os.Open as Readdirnames does not work with
|
||||||
|
// OpenRelative. This is safe because the above lstatrelative fails
|
||||||
|
// if the target is outside the root, and we know this is not a
|
||||||
|
// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
|
||||||
|
fd, err := os.Open(filepath.Join(root.Name(), path))
|
||||||
|
if err != nil {
|
||||||
|
if os.IsNotExist(err) {
|
||||||
|
// Race. It was deleted between the Lstat and Open.
|
||||||
|
// Return nil per RemoveAll's docs.
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// Remove contents & return first error.
|
||||||
|
for {
|
||||||
|
names, err1 := fd.Readdirnames(100)
|
||||||
|
for _, name := range names {
|
||||||
|
err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
|
||||||
|
if err == nil {
|
||||||
|
err = err1
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if err1 == io.EOF {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
// If Readdirnames returned an error, use it.
|
||||||
|
if err == nil {
|
||||||
|
err = err1
|
||||||
|
}
|
||||||
|
if len(names) == 0 {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
}
|
||||||
|
fd.Close()
|
||||||
|
|
||||||
|
// Remove directory.
|
||||||
|
err1 := RemoveRelative(path, root)
|
||||||
|
if err1 == nil || os.IsNotExist(err1) {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
if err == nil {
|
||||||
|
err = err1
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// MkdirRelative creates a directory relative to a root, failing if any
|
||||||
|
// intermediate path components are reparse points.
|
||||||
|
func MkdirRelative(path string, root *os.File) error {
|
||||||
|
f, err := openRelativeInternal(
|
||||||
|
path,
|
||||||
|
root,
|
||||||
|
0,
|
||||||
|
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||||
|
FILE_CREATE,
|
||||||
|
FILE_DIRECTORY_FILE)
|
||||||
|
if err == nil {
|
||||||
|
f.Close()
|
||||||
|
} else {
|
||||||
|
err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
|
||||||
|
}
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
|
||||||
|
// LstatRelative performs a stat operation on a file relative to a root, failing
|
||||||
|
// if any intermediate path components are reparse points.
|
||||||
|
func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
|
||||||
|
f, err := openRelativeInternal(
|
||||||
|
path,
|
||||||
|
root,
|
||||||
|
FILE_READ_ATTRIBUTES,
|
||||||
|
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||||
|
FILE_OPEN,
|
||||||
|
FILE_OPEN_REPARSE_POINT)
|
||||||
|
if err != nil {
|
||||||
|
return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
|
||||||
|
}
|
||||||
|
defer f.Close()
|
||||||
|
return f.Stat()
|
||||||
|
}
|
||||||
|
|
||||||
|
// EnsureNotReparsePointRelative validates that a given file (relative to a
|
||||||
|
// root) and all intermediate path components are not a reparse points.
|
||||||
|
func EnsureNotReparsePointRelative(path string, root *os.File) error {
|
||||||
|
// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
|
||||||
|
f, err := OpenRelative(
|
||||||
|
path,
|
||||||
|
root,
|
||||||
|
0,
|
||||||
|
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
|
||||||
|
FILE_OPEN,
|
||||||
|
0)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
f.Close()
|
||||||
|
return nil
|
||||||
|
}
|
||||||
79
vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
generated
vendored
Normal file
79
vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go
generated
vendored
Normal file
|
|
@ -0,0 +1,79 @@
|
||||||
|
// Code generated by 'go generate'; DO NOT EDIT.
|
||||||
|
|
||||||
|
package safefile
|
||||||
|
|
||||||
|
import (
|
||||||
|
"syscall"
|
||||||
|
"unsafe"
|
||||||
|
|
||||||
|
"golang.org/x/sys/windows"
|
||||||
|
)
|
||||||
|
|
||||||
|
var _ unsafe.Pointer
|
||||||
|
|
||||||
|
// Do the interface allocations only once for common
|
||||||
|
// Errno values.
|
||||||
|
const (
|
||||||
|
errnoERROR_IO_PENDING = 997
|
||||||
|
)
|
||||||
|
|
||||||
|
var (
|
||||||
|
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
|
||||||
|
)
|
||||||
|
|
||||||
|
// errnoErr returns common boxed Errno values, to prevent
|
||||||
|
// allocations at runtime.
|
||||||
|
func errnoErr(e syscall.Errno) error {
|
||||||
|
switch e {
|
||||||
|
case 0:
|
||||||
|
return nil
|
||||||
|
case errnoERROR_IO_PENDING:
|
||||||
|
return errERROR_IO_PENDING
|
||||||
|
}
|
||||||
|
// TODO: add more here, after collecting data on the common
|
||||||
|
// error values see on Windows. (perhaps when running
|
||||||
|
// all.bat?)
|
||||||
|
return e
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
modntdll = windows.NewLazySystemDLL("ntdll.dll")
|
||||||
|
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
|
||||||
|
|
||||||
|
procNtCreateFile = modntdll.NewProc("NtCreateFile")
|
||||||
|
procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile")
|
||||||
|
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
|
||||||
|
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
|
||||||
|
procLocalFree = modkernel32.NewProc("LocalFree")
|
||||||
|
)
|
||||||
|
|
||||||
|
func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
|
||||||
|
r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
|
||||||
|
status = uint32(r0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
|
||||||
|
r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
|
||||||
|
status = uint32(r0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func rtlNtStatusToDosError(status uint32) (winerr error) {
|
||||||
|
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
|
||||||
|
if r0 != 0 {
|
||||||
|
winerr = syscall.Errno(r0)
|
||||||
|
}
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func localAlloc(flags uint32, size int) (ptr uintptr) {
|
||||||
|
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
|
||||||
|
ptr = uintptr(r0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
func localFree(ptr uintptr) {
|
||||||
|
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,245 @@
|
||||||
|
package schema1
|
||||||
|
|
||||||
|
import (
|
||||||
|
"encoding/json"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/Microsoft/hcsshim/internal/schema2"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ProcessConfig is used as both the input of Container.CreateProcess
|
||||||
|
// and to convert the parameters to JSON for passing onto the HCS
|
||||||
|
type ProcessConfig struct {
|
||||||
|
ApplicationName string `json:",omitempty"`
|
||||||
|
CommandLine string `json:",omitempty"`
|
||||||
|
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
|
||||||
|
User string `json:",omitempty"`
|
||||||
|
WorkingDirectory string `json:",omitempty"`
|
||||||
|
Environment map[string]string `json:",omitempty"`
|
||||||
|
EmulateConsole bool `json:",omitempty"`
|
||||||
|
CreateStdInPipe bool `json:",omitempty"`
|
||||||
|
CreateStdOutPipe bool `json:",omitempty"`
|
||||||
|
CreateStdErrPipe bool `json:",omitempty"`
|
||||||
|
ConsoleSize [2]uint `json:",omitempty"`
|
||||||
|
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
|
||||||
|
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
|
||||||
|
}
|
||||||
|
|
||||||
|
type Layer struct {
|
||||||
|
ID string
|
||||||
|
Path string
|
||||||
|
}
|
||||||
|
|
||||||
|
type MappedDir struct {
|
||||||
|
HostPath string
|
||||||
|
ContainerPath string
|
||||||
|
ReadOnly bool
|
||||||
|
BandwidthMaximum uint64
|
||||||
|
IOPSMaximum uint64
|
||||||
|
CreateInUtilityVM bool
|
||||||
|
// LinuxMetadata - Support added in 1803/RS4+.
|
||||||
|
LinuxMetadata bool `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type MappedPipe struct {
|
||||||
|
HostPath string
|
||||||
|
ContainerPipeName string
|
||||||
|
}
|
||||||
|
|
||||||
|
type HvRuntime struct {
|
||||||
|
ImagePath string `json:",omitempty"`
|
||||||
|
SkipTemplate bool `json:",omitempty"`
|
||||||
|
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
|
||||||
|
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
|
||||||
|
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
|
||||||
|
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
|
||||||
|
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
|
||||||
|
}
|
||||||
|
|
||||||
|
type MappedVirtualDisk struct {
|
||||||
|
HostPath string `json:",omitempty"` // Path to VHD on the host
|
||||||
|
ContainerPath string // Platform-specific mount point path in the container
|
||||||
|
CreateInUtilityVM bool `json:",omitempty"`
|
||||||
|
ReadOnly bool `json:",omitempty"`
|
||||||
|
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
|
||||||
|
AttachOnly bool `json:",omitempty:`
|
||||||
|
}
|
||||||
|
|
||||||
|
// AssignedDevice represents a device that has been directly assigned to a container
|
||||||
|
//
|
||||||
|
// NOTE: Support added in RS5
|
||||||
|
type AssignedDevice struct {
|
||||||
|
// InterfaceClassGUID of the device to assign to container.
|
||||||
|
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ContainerConfig is used as both the input of CreateContainer
|
||||||
|
// and to convert the parameters to JSON for passing onto the HCS
|
||||||
|
type ContainerConfig struct {
|
||||||
|
SystemType string // HCS requires this to be hard-coded to "Container"
|
||||||
|
Name string // Name of the container. We use the docker ID.
|
||||||
|
Owner string `json:",omitempty"` // The management platform that created this container
|
||||||
|
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
|
||||||
|
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
|
||||||
|
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
|
||||||
|
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
|
||||||
|
Credentials string `json:",omitempty"` // Credentials information
|
||||||
|
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
|
||||||
|
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
|
||||||
|
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
|
||||||
|
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
|
||||||
|
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
|
||||||
|
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
|
||||||
|
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
|
||||||
|
HostName string `json:",omitempty"` // Hostname
|
||||||
|
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
|
||||||
|
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
|
||||||
|
HvPartition bool // True if it a Hyper-V Container
|
||||||
|
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
|
||||||
|
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
|
||||||
|
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
|
||||||
|
Servicing bool `json:",omitempty"` // True if this container is for servicing
|
||||||
|
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
|
||||||
|
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
|
||||||
|
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
|
||||||
|
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
|
||||||
|
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
|
||||||
|
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
|
||||||
|
}
|
||||||
|
|
||||||
|
type ComputeSystemQuery struct {
|
||||||
|
IDs []string `json:"Ids,omitempty"`
|
||||||
|
Types []string `json:",omitempty"`
|
||||||
|
Names []string `json:",omitempty"`
|
||||||
|
Owners []string `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type PropertyType string
|
||||||
|
|
||||||
|
const (
|
||||||
|
PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2
|
||||||
|
PropertyTypeProcessList = "ProcessList" // V1 and V2
|
||||||
|
PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call
|
||||||
|
PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5
|
||||||
|
)
|
||||||
|
|
||||||
|
type PropertyQuery struct {
|
||||||
|
PropertyTypes []PropertyType `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ContainerProperties holds the properties for a container and the processes running in that container
|
||||||
|
type ContainerProperties struct {
|
||||||
|
ID string `json:"Id"`
|
||||||
|
State string
|
||||||
|
Name string
|
||||||
|
SystemType string
|
||||||
|
Owner string
|
||||||
|
SiloGUID string `json:"SiloGuid,omitempty"`
|
||||||
|
RuntimeID string `json:"RuntimeId,omitempty"`
|
||||||
|
IsRuntimeTemplate bool `json:",omitempty"`
|
||||||
|
RuntimeImagePath string `json:",omitempty"`
|
||||||
|
Stopped bool `json:",omitempty"`
|
||||||
|
ExitType string `json:",omitempty"`
|
||||||
|
AreUpdatesPending bool `json:",omitempty"`
|
||||||
|
ObRoot string `json:",omitempty"`
|
||||||
|
Statistics Statistics `json:",omitempty"`
|
||||||
|
ProcessList []ProcessListItem `json:",omitempty"`
|
||||||
|
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
|
||||||
|
GuestConnectionInfo GuestConnectionInfo `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// MemoryStats holds the memory statistics for a container
|
||||||
|
type MemoryStats struct {
|
||||||
|
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
|
||||||
|
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
|
||||||
|
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProcessorStats holds the processor statistics for a container
|
||||||
|
type ProcessorStats struct {
|
||||||
|
TotalRuntime100ns uint64 `json:",omitempty"`
|
||||||
|
RuntimeUser100ns uint64 `json:",omitempty"`
|
||||||
|
RuntimeKernel100ns uint64 `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// StorageStats holds the storage statistics for a container
|
||||||
|
type StorageStats struct {
|
||||||
|
ReadCountNormalized uint64 `json:",omitempty"`
|
||||||
|
ReadSizeBytes uint64 `json:",omitempty"`
|
||||||
|
WriteCountNormalized uint64 `json:",omitempty"`
|
||||||
|
WriteSizeBytes uint64 `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// NetworkStats holds the network statistics for a container
|
||||||
|
type NetworkStats struct {
|
||||||
|
BytesReceived uint64 `json:",omitempty"`
|
||||||
|
BytesSent uint64 `json:",omitempty"`
|
||||||
|
PacketsReceived uint64 `json:",omitempty"`
|
||||||
|
PacketsSent uint64 `json:",omitempty"`
|
||||||
|
DroppedPacketsIncoming uint64 `json:",omitempty"`
|
||||||
|
DroppedPacketsOutgoing uint64 `json:",omitempty"`
|
||||||
|
EndpointId string `json:",omitempty"`
|
||||||
|
InstanceId string `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Statistics is the structure returned by a statistics call on a container
|
||||||
|
type Statistics struct {
|
||||||
|
Timestamp time.Time `json:",omitempty"`
|
||||||
|
ContainerStartTime time.Time `json:",omitempty"`
|
||||||
|
Uptime100ns uint64 `json:",omitempty"`
|
||||||
|
Memory MemoryStats `json:",omitempty"`
|
||||||
|
Processor ProcessorStats `json:",omitempty"`
|
||||||
|
Storage StorageStats `json:",omitempty"`
|
||||||
|
Network []NetworkStats `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// ProcessList is the structure of an item returned by a ProcessList call on a container
|
||||||
|
type ProcessListItem struct {
|
||||||
|
CreateTimestamp time.Time `json:",omitempty"`
|
||||||
|
ImageName string `json:",omitempty"`
|
||||||
|
KernelTime100ns uint64 `json:",omitempty"`
|
||||||
|
MemoryCommitBytes uint64 `json:",omitempty"`
|
||||||
|
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
|
||||||
|
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
|
||||||
|
ProcessId uint32 `json:",omitempty"`
|
||||||
|
UserTime100ns uint64 `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
|
||||||
|
type MappedVirtualDiskController struct {
|
||||||
|
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM
|
||||||
|
type GuestDefinedCapabilities struct {
|
||||||
|
NamespaceAddRequestSupported bool `json:",omitempty"`
|
||||||
|
SignalProcessSupported bool `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
|
||||||
|
type GuestConnectionInfo struct {
|
||||||
|
SupportedSchemaVersions []hcsschema.Version `json:",omitempty"`
|
||||||
|
ProtocolVersion uint32 `json:",omitempty"`
|
||||||
|
GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// Type of Request Support in ModifySystem
|
||||||
|
type RequestType string
|
||||||
|
|
||||||
|
// Type of Resource Support in ModifySystem
|
||||||
|
type ResourceType string
|
||||||
|
|
||||||
|
// RequestType const
|
||||||
|
const (
|
||||||
|
Add RequestType = "Add"
|
||||||
|
Remove RequestType = "Remove"
|
||||||
|
Network ResourceType = "Network"
|
||||||
|
)
|
||||||
|
|
||||||
|
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
|
||||||
|
// Supported resource types are Network and Request Types are Add/Remove
|
||||||
|
type ResourceModificationRequestResponse struct {
|
||||||
|
Resource ResourceType `json:"ResourceType"`
|
||||||
|
Data interface{} `json:"Settings"`
|
||||||
|
Request RequestType `json:"RequestType,omitempty"`
|
||||||
|
}
|
||||||
31
vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
generated
vendored
Normal file
31
vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go
generated
vendored
Normal file
|
|
@ -0,0 +1,31 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type Attachment struct {
|
||||||
|
|
||||||
|
Type_ string `json:"Type,omitempty"`
|
||||||
|
|
||||||
|
Path string `json:"Path,omitempty"`
|
||||||
|
|
||||||
|
IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"`
|
||||||
|
|
||||||
|
CachingMode string `json:"CachingMode,omitempty"`
|
||||||
|
|
||||||
|
NoWriteHardening bool `json:"NoWriteHardening,omitempty"`
|
||||||
|
|
||||||
|
DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"`
|
||||||
|
|
||||||
|
IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"`
|
||||||
|
|
||||||
|
CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"`
|
||||||
|
|
||||||
|
ReadOnly bool `json:"ReadOnly,omitempty"`
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,13 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type Battery struct {
|
||||||
|
}
|
||||||
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
generated
vendored
Normal file
19
vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go
generated
vendored
Normal file
|
|
@ -0,0 +1,19 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type CacheQueryStatsResponse struct {
|
||||||
|
|
||||||
|
L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
|
||||||
|
|
||||||
|
L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
|
||||||
|
|
||||||
|
L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"`
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,27 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type Chipset struct {
|
||||||
|
Uefi *Uefi `json:"Uefi,omitempty"`
|
||||||
|
|
||||||
|
IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"`
|
||||||
|
|
||||||
|
BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"`
|
||||||
|
|
||||||
|
ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"`
|
||||||
|
|
||||||
|
ChassisAssetTag string `json:"ChassisAssetTag,omitempty"`
|
||||||
|
|
||||||
|
UseUtc bool `json:"UseUtc,omitempty"`
|
||||||
|
|
||||||
|
// LinuxKernelDirect - Added in v2.2 Builds >=181117
|
||||||
|
LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"`
|
||||||
|
}
|
||||||
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
generated
vendored
Normal file
15
vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go
generated
vendored
Normal file
|
|
@ -0,0 +1,15 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type CloseHandle struct {
|
||||||
|
|
||||||
|
Handle string `json:"Handle,omitempty"`
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,18 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
// ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
|
||||||
|
type ComPort struct {
|
||||||
|
|
||||||
|
NamedPipe string `json:"NamedPipe,omitempty"`
|
||||||
|
|
||||||
|
OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`
|
||||||
|
}
|
||||||
27
vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
generated
vendored
Normal file
27
vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go
generated
vendored
Normal file
|
|
@ -0,0 +1,27 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type ComputeSystem struct {
|
||||||
|
|
||||||
|
Owner string `json:"Owner,omitempty"`
|
||||||
|
|
||||||
|
SchemaVersion *Version `json:"SchemaVersion,omitempty"`
|
||||||
|
|
||||||
|
HostingSystemId string `json:"HostingSystemId,omitempty"`
|
||||||
|
|
||||||
|
HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
|
||||||
|
|
||||||
|
Container *Container `json:"Container,omitempty"`
|
||||||
|
|
||||||
|
VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"`
|
||||||
|
|
||||||
|
ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"`
|
||||||
|
}
|
||||||
72
vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
generated
vendored
Normal file
72
vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go
generated
vendored
Normal file
|
|
@ -0,0 +1,72 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
import (
|
||||||
|
"net/http"
|
||||||
|
)
|
||||||
|
|
||||||
|
// contextKeys are used to identify the type of value in the context.
|
||||||
|
// Since these are string, it is possible to get a short description of the
|
||||||
|
// context key for logging and debugging using key.String().
|
||||||
|
|
||||||
|
type contextKey string
|
||||||
|
|
||||||
|
func (c contextKey) String() string {
|
||||||
|
return "auth " + string(c)
|
||||||
|
}
|
||||||
|
|
||||||
|
var (
|
||||||
|
// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
|
||||||
|
ContextOAuth2 = contextKey("token")
|
||||||
|
|
||||||
|
// ContextBasicAuth takes BasicAuth as authentication for the request.
|
||||||
|
ContextBasicAuth = contextKey("basic")
|
||||||
|
|
||||||
|
// ContextAccessToken takes a string oauth2 access token as authentication for the request.
|
||||||
|
ContextAccessToken = contextKey("accesstoken")
|
||||||
|
|
||||||
|
// ContextAPIKey takes an APIKey as authentication for the request
|
||||||
|
ContextAPIKey = contextKey("apikey")
|
||||||
|
)
|
||||||
|
|
||||||
|
// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth
|
||||||
|
type BasicAuth struct {
|
||||||
|
UserName string `json:"userName,omitempty"`
|
||||||
|
Password string `json:"password,omitempty"`
|
||||||
|
}
|
||||||
|
|
||||||
|
// APIKey provides API key based authentication to a request passed via context using ContextAPIKey
|
||||||
|
type APIKey struct {
|
||||||
|
Key string
|
||||||
|
Prefix string
|
||||||
|
}
|
||||||
|
|
||||||
|
type Configuration struct {
|
||||||
|
BasePath string `json:"basePath,omitempty"`
|
||||||
|
Host string `json:"host,omitempty"`
|
||||||
|
Scheme string `json:"scheme,omitempty"`
|
||||||
|
DefaultHeader map[string]string `json:"defaultHeader,omitempty"`
|
||||||
|
UserAgent string `json:"userAgent,omitempty"`
|
||||||
|
HTTPClient *http.Client
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewConfiguration() *Configuration {
|
||||||
|
cfg := &Configuration{
|
||||||
|
BasePath: "https://localhost",
|
||||||
|
DefaultHeader: make(map[string]string),
|
||||||
|
UserAgent: "Swagger-Codegen/2.1.0/go",
|
||||||
|
}
|
||||||
|
return cfg
|
||||||
|
}
|
||||||
|
|
||||||
|
func (c *Configuration) AddDefaultHeader(key string, value string) {
|
||||||
|
c.DefaultHeader[key] = value
|
||||||
|
}
|
||||||
17
vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
generated
vendored
Normal file
17
vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go
generated
vendored
Normal file
|
|
@ -0,0 +1,17 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type ConsoleSize struct {
|
||||||
|
|
||||||
|
Height int32 `json:"Height,omitempty"`
|
||||||
|
|
||||||
|
Width int32 `json:"Width,omitempty"`
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,35 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type Container struct {
|
||||||
|
|
||||||
|
GuestOs *GuestOs `json:"GuestOs,omitempty"`
|
||||||
|
|
||||||
|
Storage *Storage `json:"Storage,omitempty"`
|
||||||
|
|
||||||
|
MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"`
|
||||||
|
|
||||||
|
MappedPipes []MappedPipe `json:"MappedPipes,omitempty"`
|
||||||
|
|
||||||
|
Memory *Memory `json:"Memory,omitempty"`
|
||||||
|
|
||||||
|
Processor *Processor `json:"Processor,omitempty"`
|
||||||
|
|
||||||
|
Networking *Networking `json:"Networking,omitempty"`
|
||||||
|
|
||||||
|
HvSocket *HvSocket `json:"HvSocket,omitempty"`
|
||||||
|
|
||||||
|
ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"`
|
||||||
|
|
||||||
|
RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"`
|
||||||
|
|
||||||
|
AssignedDevices []Device `json:"AssignedDevices,omitempty"`
|
||||||
|
}
|
||||||
25
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go
generated
vendored
Normal file
25
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go
generated
vendored
Normal file
|
|
@ -0,0 +1,25 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type ContainerCredentialGuardState struct {
|
||||||
|
|
||||||
|
// Authentication cookie for calls to a Container Credential Guard instance.
|
||||||
|
Cookie string `json:"Cookie,omitempty"`
|
||||||
|
|
||||||
|
// Name of the RPC endpoint of the Container Credential Guard instance.
|
||||||
|
RpcEndpoint string `json:"RpcEndpoint,omitempty"`
|
||||||
|
|
||||||
|
// Transport used for the configured Container Credential Guard instance.
|
||||||
|
Transport string `json:"Transport,omitempty"`
|
||||||
|
|
||||||
|
// Credential spec used for the configured Container Credential Guard instance.
|
||||||
|
CredentialSpec string `json:"CredentialSpec,omitempty"`
|
||||||
|
}
|
||||||
26
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
generated
vendored
Normal file
26
vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go
generated
vendored
Normal file
|
|
@ -0,0 +1,26 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
// memory usage as viewed from within the container
|
||||||
|
type ContainerMemoryInformation struct {
|
||||||
|
|
||||||
|
TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
|
||||||
|
|
||||||
|
TotalUsage int32 `json:"TotalUsage,omitempty"`
|
||||||
|
|
||||||
|
CommittedBytes int32 `json:"CommittedBytes,omitempty"`
|
||||||
|
|
||||||
|
SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"`
|
||||||
|
|
||||||
|
CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"`
|
||||||
|
|
||||||
|
PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"`
|
||||||
|
}
|
||||||
|
|
@ -0,0 +1,16 @@
|
||||||
|
/*
|
||||||
|
* HCS API
|
||||||
|
*
|
||||||
|
* No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
|
||||||
|
*
|
||||||
|
* API version: 2.1
|
||||||
|
* Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
|
||||||
|
*/
|
||||||
|
|
||||||
|
package hcsschema
|
||||||
|
|
||||||
|
type Device struct {
|
||||||
|
|
||||||
|
// The interface class guid of the device to assign to container.
|
||||||
|
InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"`
|
||||||
|
}
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue